Table 2.
SGAs and their respective association with cancer treatment in the last 10 years.
| Compound | Cancer Type | Ref. |
|---|---|---|
| α-Solanine | Non small-cell lung cancer, hepatocellular carcinoma, choriocarcinoma, leukemia, esophageal, pancreatic, breast, adenocarcinoma, colorectal, endometrium, prostate, glioma, testicular, lung carcinoma, epithelial carcinoma | [98,99,100,101,102,103,104,105,106,107,108,109,110,111,112,113,114,115,116,117,118,119,120,121] |
| Solamargine | Nasopharyngeal carcinoma, prostate, multiple myeloma, lung cancer, leukemia, hepatoma, hepatocellular carcinoma, non-selective cytotoxicity, gastric | [122,123,124,125,126,127,128,129,130,131,132,133] |
| Solasodine | Ovarian | [134] |
| α -Tomatine | Ovarian | [135] |
| Solasonine | Gastric, pancreatic, bladder, leukemia, hepatocellular carcinoma | [123,132,136,137,138,139,140] |
| Khasianine | Leukemia | [123] |
| α-Chaconine | Endometrium, glioma | [100,104] |
| Solanidine | EAC solid tumor, CAM xenograft | [141] |
| Solanindin | Leukemia, lung, breast, colon | [91] |
| Solalyraine A-E | Lung carcinoma | [142] |
| (25R)-22αN-4-nor-spirosol-5(6)-en-3β-ol-6-al glycosides | Leukemia, histiocytic lymphoma, hepatocellular carcinoma | [92] |
| 16, 23-epoxy-22, 26-epimino-cholest22(N), 23, 25(26)-trien-3β-ol | Gastric, hepatic | [143] |
| Solanigroside P | Gastric | [132] |
| Lycoperoside H | Colorectal | [144] |