Comparison of mesalamine/GPTMS@SiO2@Fe3O4 with selected processes reported in the literature for the tandem Knoevenagel–Michael cyclocondensation.
| Entry | Catalyst | Reaction conditions | Time (min or h)/yield (%) |
|---|---|---|---|
| 1 | CeCl3·7H2O (10 mol%) | EtOH : H2O (4 : 2)/reflux | 1–2.5 h/70–93%45 |
| 2 | Fe3O4@GA@IG (20 mg) | EtOH/reflux | 15–110 min/78–92%46 |
| 3 | EDA/(CH2)3@SiO2@Fe3O4 (0.05 g) | Grinding/r.t. | 10–25 min/89–97%47 |
| 4 | NH4H2PO4/Al2O3 (0.03 g) | EtOH/reflux | 5–60 min/45–92%48 |
| 5 | NiFe2O4@SiO2@H14[NaP5W30O110] (0.02 g) | EtOH/ultrasonic/r.t. | 5–15 min/81–94%49 |
| 6 | NiFe2O4@SiO2@H14[NaP5W30O110] (0.02 g) | EtOH/reflux | 15–35 min/57–80%49 |
| 7 | Ag/Fe3O4@starch (15 mg) | EtOH/50 °C | 8–17 min/84–95%50 |
| 8 | Per-6-NH2–β-CD (0.09 mmol) | Solvent-free/r.t. | 1–7 min/67–97%51 |
| 9 | Fe3O4@NH2@TCT@HOProCu (0.01 g) | EtOH/reflux | 24 h/75–97%52 |
| 10 | Molecular iodine (10 mol%) | DMSO, reflux, Δ | 3.2–4 h/80–92%53 |
| 11 | Mesalamine/GPTMS@SiO2@Fe3O4 | Grinding/r.t. | 7–35 min/88–96% |