Table 1.
Protection against chemical carcinogenesis by oltipraz in rodents
| Carcinogen | Species (sex/strain) | Tumor target organ | Reference |
|---|---|---|---|
| BBN | Mouse (♂, BDF and C57BL/6) | Bladder | (27, 81) |
|
| |||
| PhIP | Rat (♂, F344) | Blood/Lymphoma | (82) |
|
| |||
| AOM | Rat (♂, F344 and Sprague-Dawley) | Colon | (13, 83–86) |
|
| |||
| AFB1 | Rat (♂, F344) | Kidney | (9) |
|
| |||
| AFB1 | Rat (♂, F344) | Liver | (26, 87–90) |
|
| |||
| B[a]P, DEN, UM | Mouse (Mice (♀, ICR/Ha) | Lung | (8) |
| B[a]P | Mouse (Mice (♀, A/J) | Lung | (91) |
| MNU, DEN | Hamster (♂, Syrian) | Lung | (10) |
| BOP | Hamster (Mice (♀, Syrian) | Lung | (92) |
|
| |||
| BOP | Hamster (Mice (♀, Syrian) | Pancreas | (93) |
|
| |||
| DEN | Hamster (♂, Syrian) | Trachea | (94) |
|
| |||
| MNNG | Rat (♂, Wistar) | Glandular stomach | (95) |
| B[a]P | Mice (♀, ICR) | Forestomach | (96) |
AFB1, aflatoxin B1; AOM, azoxymethane; BBN, N-butyl-N-(4-hydroxybutyl) nitrosamine; B[a]P, benzo[a]pyrene; BOP, N-nitrosobis(2-oxopropyl) amine; DEN, diethylnitrosamine; MNNG, N-methyl-N′-nitro-N-nitrosoguanidine; MNU, N-methyl-N-nitrosourea; PhIP, 2-amino-1-methyl-6-phenylimidazo[4,5-b]pyridine; UM, uracil mustard;