Table 5:
Reaction conditions and radiochemical yield (RCY; decay-corrected) for synthesis of N-boc-5-[18F]fluoroindole using concentrated [18F]fluoride. In each experiment, the concentrated [18F]fluoride was recovered with two plugs (total 12.4 µL) of eluent solution (24 mM K3PO4 + 136 mM 18-crown-6 in 1:4 v/v H2O:MeCN). Drying solution 1 is 38 mM 18-crown-6 in MeCN (500 µL). Drying solution 2 is 38 mM 18-crown-6 + 10 mM K3PO4 in 1:400 H2O:MeCN (500 µL).
| Starting activity (mCi) | Ni-indole complex amount (mg) | Oxidant amount (mg) | Drying solution | H2O content in reaction (calculated) (%v/v) | H2O content (Karl-Fischer) (%v/v) | RCY (%) |
|---|---|---|---|---|---|---|
| 3.28 | 1.12 | 1.31 | 1 | 0.48 | 0.32±0.02 (n=2) | 49 |
| 1.06 | 1.02 | 1.30 | 1 | 0.48 | 52 | |
| Average ± SD | 51 ± 2 | |||||
| 1.49 | 1.31 | 1.55 | 2 | 0.73 | 0.57±0.01 (n=2) | 53 |
| 1.17 | 1.2 | 1.4 | 2 | 0.73 | 47 | |
| Average ± SD | 50 ± 4 | |||||