Table 1.
Competitive ELISA analysis of molecular interaction of Mab 4E4 with Spd analogues.a
| Chemical | Molecular formula | Mab 4E4 | |
|---|---|---|---|
| ID50a (nmol) | Cross‐reaction (%) | ||
| Ornithine | C5H12N2O2 | 34.1 | 0.0016 |
| Putrescine | NH2(CH2)4NH2 | 28.2 | 0.0020 |
| Cadaverine | NH2(CH2)5NH2 | 21 | 0.0026 |
| Spermine | NH2(CH2)3NH(CH2)4NH(CH2)3NH2 | 0.54 × 10−3 | 100 |
| Spermidine | NH2(CH2)3NH(CH2)4NH2 | 0.53 × 10−3 | 98 |
a
ID50 means 50% inhibitory dose in the competitive ELISA assay. The experiment was repeated three times with similar results. The table lists a set of representative data.