Official websites use .gov
A
.gov website belongs to an official
government organization in the United States.
Secure .gov websites use HTTPS
A lock (
) or https:// means you've safely
connected to the .gov website. Share sensitive
information only on official, secure websites.
| Customary name | Number of carbon atoms and double bonds | Molecular formula |
| oleid acid | 18:1 | CH3(CH2)7CH=CH(CH2)7COOH |
| palmitic acid | 16:0 | CH3(CH2)14COOH |
| stearic acid | 18:0 | CH3(CH2)16COOH |
| linoleic acid | 18:2 | CH3(CH2)4(CH=CHCH2)2(CH2)6COOH |
| palmitoleic acid | 16:1 | CH3(CH2)5CH=CH(CH2)7COOH |
| myristic acid | 14:0 | CH3(CH2)12COOH |
| α-linolenic acid | 18:3 | CH3CH2(CH=CHCH2)3(CH2)6COOH |
| arachidonic acid | 20:4 | CH3(CH2)4(CH=CHCH2)4(CH2)4COOH |
