| ROS | Reactive oxygen species |
| NTDT | Non-transfusion dependent thalassemia |
| 20-HETE | 20-Hydroxyeicosatetraenoic acid |
| TDT | Transfusion-dependent thalassemia |
| CYP450 | Cytochrome P450 |
| NADPH | Nicotinamide adenine dinucleotide phosphate |
| EETs | Epoxyeicosatrienoic acids |
| DHETs | Dihydroxyeicosatrienoic acids |
| Nrf2 | Nuclear factor erythroid 2-related factor 2 |
| HET0016 | N-Hydroxy-N′-(4-butyl-2-methylphenyl)-formamidine |
| TS-011 | N-(3-chloro-4-morpholin-4-yl) phenyl-N′-hydroxyimido formamide |
| HPLC | High-performance liquid chromatography |
| PCR | Polymerase chain reaction |
| H&E | Hematoxylin and eosin |
| SEM | Standard error of the mean |
Official websites use .gov
A
.gov website belongs to an official
government organization in the United States.
Secure .gov websites use HTTPS
A lock (
) or https:// means you've safely
connected to the .gov website. Share sensitive
information only on official, secure websites.