| C-X-C Chemokine Receptor Type 4 (CXCR4) |
1 |
Receptor for the C-X-C chemokine CXCL12/SDF-1 |
Antiviral |
| Farnesyl Pyrophosphate Synthase (FPPS) |
1 |
Key enzyme in isoprenoid biosynthesis |
Antimicrobial and Anticancer |
| Thymidine Kinase (KITH) |
1 |
Catalyzes the addition of a gamma-phosphate group to thymidine |
Antimicrobial and Anticancer |
| Adenosylhomocysteinase (SAHH) |
1 |
Competitive inhibitor of S-adenosyl-L-methionine dependent methyl transferase reaction |
Anti-inflammatory |
| Phosphoribosylamine (PUR2) |
1 |
Involved in the synthesizes of N(1)-(5-phospho-D-ribosyl) glycinamide |
Antimicrobial and Anticancer |
| Fatty Acid-Binding Protein (FABP4) |
1 |
Lipid transport protein in adipocytes |
Anti-inflammatory |
| 3-Hydroxy-3-Methylglutaryl Coenzyme A Reductase (HMDH) |
1 |
Transmembrane glycoprotein, rate-limiting enzyme in biosynthesis of cholesterol and nonsterol isoprenoids |
None |
| Natural Resistance-Associated Macrophage Protein (NRAM) |
1 |
Divalent transition metal transporter and host resistance to certain pathogens |
Antibacterial and Immunomodulator |
| Heat Shock Protein 90-Alpha 1 (HS90A) |
1 |
Involved in cell cycle control and signal transduction |
Anticancer |
| Catechol O-Methyltransferase (COMT) |
1 |
Catalyzes the O-methylation—Inactivation of catecholamine neurotransmitters |
Parkison’s disease |
