Table 1.
Compound |
aIC50 (μM) |
|||||
---|---|---|---|---|---|---|
A549 | MCF-7 | MDA-MB-231 | MCF-10A | bSIMCF-7 | cSIMDA-MB-231 | |
7Aa | 15.25 ± 1.37 | 26.43 ± 1.25 | 31.51 ± 2.77 | >50 | >1.89 | >1.58 |
7Ab | 9.41 ± 0.68 | 15.31 ± 0.94 | 29.58 ± 1.80 | >50 | >3.27 | >1.69 |
7Ac | 2.33 ± 0.15 | 5.87 ± 0.42 | 1.62 ± 0.15 | 21.54 ± 0.88 | 3.67 | 13.30 |
7Ba | 9.84 ± 0.47 | 18.96 ± 1.33 | 24.22 ± 1.97 | >50 | >2.64 | >2.06 |
7Bb | 4.91 ± 0.30 | 19.67 ± 1.28 | 16.45 ± 1.55 | >50 | >2.54 | >3.04 |
7Bc | 5.05 ± 0.21 | 12.18 ± 0.92 | 18.73 ± 0.61 | >50 | >4.11 | >2.67 |
7Ca | 2.97 ± 0.14 | 2.55 ± 0.14 | 2.26 ± 0.19 | 40.68 ± 2.79 | 15.95 | 18 |
7Cb | 3.53 ± 0.29 | 4.68 ± 0.39 | 1.47 ± 0.14 | 36.71 ± 1.02 | 7.84 | 24.97 |
7Cc | 1.94 ± 0.05 | 1.75 ± 0.15 | 0.82 ± 0.02 | 27.53 ± 2.34 | 15.73 | 33.57 |
7Da | 2.79 ± 0.07 | 1.80 ± 0.11 | 0.92 ± 0.01 | 24.74 ± 1.67 | 13.74 | 26.89 |
7Db | 3.92 ± 0.31 | 2.94 ± 0.27 | 3.11 ± 0.22 | 39.47 ± 2.90 | 13.43 | 12.69 |
7Dc | 1.63 ± 0.05 | 2.18 ± 0.10 | 1.88 ± 0.09 | 19.85 ± 1.43 | 9.11 | 10.56 |
7Ea | 4.62 ± 0.16 | 25.33 ± 0.90 | 19.00 ± 0.70 | 43.61 ± 2.65 | 2.79 | 2.30 |
7Eb | 4.55 ± 0.43 | 17.89 ± 1.26 | 41.46 ± 1.48 | >50 | >2.79 | >1.21 |
7Ec | 4.81 ± 0.18 | 3.94 ± 0.28 | 1.81 ± 0.13 | 48.32 ± 3.78 | 12.26 | 26.70 |
Cisplatin | 4.97 ± 0.37 | dNT | dNT | dNT | eNC | eNC |
Adriamycin | dNT | 5.12 ± 0.31 | 4.92 ± 0.44 | dNT | eNC | eNC |
aIC50: half inhibitory concentrations measured by the CCK-8 assay. The values are expressed as average ± standard deviation of three independent experiments.
bSIMCF-7: selectivity index between MCF-7 and MCF-10A. It was calculated as: SI = IC50(MCF-10A)/IC50(MCF-7).
cSIMDA-MB-231: selectivity index between MCF-7 and MDA-MB-231. It was calculated as: SI = IC50(MCF-10A)/IC50(MDA-MB-231).
dNT: not tested.
eNC: not calculated.