Abstract
The title compound, [CoCl2(C11H15N3O2Si)2]·C3H7NO, was synthesized from 5-nitro-1-trimethylsilylmethyl-1H-benzimidazole and cobalt(II) chloride in dimethylformamide. The CoII atom is coordinated in a distorted tetrahedral environment by two Cl atoms and two N atoms. In the crystal structure, there are a number of C—H⋯Cl and C—H⋯O hydrogen-bonding interactions between symmetry-related molecules.
Related literature
For the structures and properties of benzimidazole compounds and their metal complexes, see: Akkurt et al. (2005 ▶); Castro et al. (2002 ▶); Küçükbay et al. (1996 ▶, 2004 ▶, 2009 ▶); Liu et al. (2004 ▶); Lukevics et al. (2001 ▶); Pınar et al. (2006 ▶); Pan & Xu (2004 ▶); Türktekin et al. (2004 ▶); Tavman et al. (2005 ▶); Özdemir et al. (2005 ▶); Çetinkaya et al. (1996 ▶).
Experimental
Crystal data
[CoCl2(C11H15N3O2Si)2]·C3H7NO
M r = 701.63
Triclinic,
a = 9.8982 (4) Å
b = 11.6936 (5) Å
c = 15.9293 (6) Å
α = 106.041 (2)°
β = 107.408 (2)°
γ = 99.040 (3)°
V = 1631.97 (12) Å3
Z = 2
Mo Kα radiation
μ = 0.81 mm−1
T = 100 K
0.20 × 0.12 × 0.08 mm
Data collection
Bruker APEXII QUAZAR diffractometer
Absorption correction: multi-scan (SADABS; Bruker, 2008 ▶) T min = 0.890, T max = 0.937
30895 measured reflections
8851 independent reflections
5342 reflections with I > 2σ(I)
R int = 0.059
Refinement
R[F 2 > 2σ(F 2)] = 0.053
wR(F 2) = 0.123
S = 1.02
8851 reflections
387 parameters
H-atom parameters constrained
Δρmax = 0.90 e Å−3
Δρmin = −0.48 e Å−3
Data collection: APEX2 (Bruker, 2009 ▶); cell refinement: SAINT (Bruker, 2009 ▶); data reduction: SAINT; program(s) used to solve structure: SIR97 (Altomare et al., 1999 ▶); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008 ▶); molecular graphics: ORTEP-3 for Windows (Farrugia, 1997 ▶) and PLATON (Spek, 2009 ▶); software used to prepare material for publication: WinGX (Farrugia, 1999 ▶) and PLATON.
Supplementary Material
Crystal structure: contains datablocks global, I. DOI: 10.1107/S1600536810003922/bt5186sup1.cif
Structure factors: contains datablocks I. DOI: 10.1107/S1600536810003922/bt5186Isup2.hkl
Additional supplementary materials: crystallographic information; 3D view; checkCIF report
Table 1. Hydrogen-bond geometry (Å, °).
| D—H⋯A | D—H | H⋯A | D⋯A | D—H⋯A |
|---|---|---|---|---|
| C5—H5⋯Cl1i | 0.95 | 2.79 | 3.564 (3) | 140 |
| C7—H7⋯O5ii | 0.95 | 2.32 | 3.132 (4) | 143 |
| C8—H8B⋯O5ii | 0.99 | 2.54 | 3.406 (4) | 145 |
| C19—H19A⋯Cl2iii | 0.99 | 2.67 | 3.659 (3) | 175 |
| C19—H19B⋯O4i | 0.99 | 2.38 | 3.182 (4) | 137 |
| C22—H22C⋯Cl1iv | 0.98 | 2.82 | 3.695 (3) | 149 |
| C24—H24A⋯O5 | 0.98 | 2.42 | 2.793 (5) | 102 |
Symmetry codes: (i)
; (ii)
; (iii)
; (iv)
.
Acknowledgments
We thank Dr Holger Ott (Bruker AXS GmbH, Karlsruhe, Germany) for the data collection. HK & NŞ also thank İnönü University Research Fund (BAPB-2008–60) for financial support of this study.
supplementary crystallographic information
Comment
Benzimidazole compounds and their metal complexes have been extensively investigated for their versatile properties such as biological activities (Küçükbay et al., 2004; Çetinkaya et al., 1996; Küçükbay et al., 2009; Tavman et al., 2005) and catalytic activities of their metal complexes in many organic syntheses (Küçükbay et al.,1996, Özdemir et al., 2005). Contrary to an extensive chemistry about substituted alkyl derivatives of benzimidazole, there are a limited number of studies of alkylsilyl substituted benzimidazoles (Lukevics et al., 2001). Alkylsilyl substituted benzimidazole derivatives exhibit important in vitro cytotoxicactivity. The insertion of the silicon atom into the N-alkyl chain in benzimidazoles increases the cytotoxic activity. For example,1-(3-trimethylsilylpropyl)benzimidazole inhibits carcinoma S-180 tumour growth in dose 1 mg kg-1 by 62 % (on ICR mice) (Lukevics et al., 2001). The objective of the present study was to synthesize a trimethylsilylmethyl and NO2 substituted benzimidazole CoII complex for the first time and compare it to those of related benzimidazole derivatives (Türktekin et al., 2004; Pınar et al., 2006; Akkurt et al., 2005) reported previously.
In the title molecule (Fig. 1), the CoII atom is coordinated in a distorted tetrahedral environment by two Cl atoms and two N atoms. The bond lengths involving the Co atoms are Co1—N1 = 2.013 (3), Co1—N4 = 2.013 (2), Co1—Cl1 = 2.2330 (10) and Co1—Cl2 = 2.2455 (9) Å, while the angles around the Co atom are Cl1— Co1— Cl2 = 112.94 (4), Cl1— Co1— N1 = 111.06 (8), Cl1— Co1— N4 = 110.18 (7), Cl2— Co1— N1 = 106.74 (7), Cl2— Co1— N4 = 111.81 (7) and N1— Co1— N4 = 103.67 (9)°. The average Co—N bond length of 2.013 (3)Å is almost equal to the value of 2.008 (2)Å in dichlorobis[1-(2-ethoxyethyl)-1H-benzimidazole-κN3]cobalt(II) (Türktekin et al., 2004) and 2.032 (2) Å inbis[1-(but-2-enyl)-5-nitro-1H-benzimidazole-κN3]\ dichlorocobalt(II) (Pınar et al., 2006).
The Co—Cl bond lengths [2.2330 (10) and 2.2455 (9) Å] are comparable to the values of 2.2525 (8)Å inquinolinium trichloro(quinoline-N)cobaltate(II) (Pan & Xu, 2004) and 2.236 (1) Å in dichlorobis(1-propylimidazolidine-2-thione-κS)cobalt(II) (Castro et al., 2002) and 2.2680 (8) in bis[1-(but-2-enyl)-5-nitro-1H-benzimidazole-κN3]\ dichlorocobalt(II)(Pınar et al., 2006), but shorter than the value of 2.391 (1)Å observed in aquachlorobis(1,10-phenanthroline)cobalt(II)chloride dimethyl formamide solvate (Liu et al., 2004).
The two benzimidazole ring systems N1/N2/C1–C7 and N4/N5/C12–C18 are almost planar, with maximum deviations of -0.037 (3) for C6 and -0.016 (2) for N4, respectively. The dihedral angle between them is 64.54 (10)°. The angles around the Si atoms with a distorted tetrahedral geometry rang from 106.02 (18)° to 113.60 (17)°.
The crystal structure of the title compound is stabilized by C—H···Cl and C—H···O hydrogen-bonding interactions (Fig. 2 and Table 1).
Experimental
1-(Trimethylsilylmethyl)-5-nitrobenzimidazole used in this work as a starting compounds were prepared from reaction of 5(6)-methylbenzimidazole, (chloromethyl)trimethylsilane and KOH under reflux in EtOH.
A solution of 1-(trimethylsilylmethyl)-5-nitrobenzimidazole (2.0 g, 8.02 mmol) and cobalt(II) chloride (0.52 g, 4.01 mmol) in DMF (4 ml) was heated under reflux for 2 h. The mixture was then cooled to room temperature, after which the solvent was then removed from the filtrate in vacuo. The precipitate was then crystallized from EtOH / DMF(2:1). Yield : 2.30 g, 91%; m.p.: 473-474 K. Analysis calculated for C22H30N6O4Si2CoCl2.HCON(CH3)2 : C 42.80, H 5.32, N 13.97%. Found: C 42.79, H 5.31, N 13.92%. IR : ν(C=N): 1523 cm-1. 1H-NMR (DMSO-d6): δ = 7.97 ppm (s, 2H, N=CH—N), 6.39 (m, 6H, Ar—H), 4.25 (m, 4H, CH2Si), -0.27 (s, 18H, Si (CH3)3).
Refinement
All H atoms were placed at calculated positions and treated as riding atoms, with C—H = 0.95–0.99 Å, and Uiso(H) = 1.2 or 1.5Ueq(C).
Figures
Fig. 1.
The title molecule showing the atom-labelling scheme. The probability level for the anisotropic displacement parameters is at 50%.
Fig. 2.
View of the packing diagram of the title compound in the unit cell. Hydrogen bonds are indicated as dashed lines.
Crystal data
| [CoCl2(C11H15N3O2Si)2]·C3H7NO | Z = 2 |
| Mr = 701.63 | F(000) = 730 |
| Triclinic, P1 | Dx = 1.428 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 9.8982 (4) Å | Cell parameters from 4864 reflections |
| b = 11.6936 (5) Å | θ = 5.4–51.0° |
| c = 15.9293 (6) Å | µ = 0.81 mm−1 |
| α = 106.041 (2)° | T = 100 K |
| β = 107.408 (2)° | Plate, blue |
| γ = 99.040 (3)° | 0.20 × 0.12 × 0.08 mm |
| V = 1631.97 (12) Å3 |
Data collection
| Brruker APEXII QUAZAR diffractometer | 8851 independent reflections |
| Radiation source: ImuS | 5342 reflections with I > 2σ(I) |
| multilayer | Rint = 0.059 |
| ω and φ scans | θmax = 29.4°, θmin = 1.4° |
| Absorption correction: multi-scan (SADABS; Bruker, 2008) | h = −13→13 |
| Tmin = 0.890, Tmax = 0.937 | k = −16→16 |
| 30895 measured reflections | l = −21→21 |
Refinement
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.053 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.123 | H-atom parameters constrained |
| S = 1.02 | w = 1/[σ2(Fo2) + (0.0506P)2 + 0.0752P] where P = (Fo2 + 2Fc2)/3 |
| 8851 reflections | (Δ/σ)max = 0.001 |
| 387 parameters | Δρmax = 0.90 e Å−3 |
| 0 restraints | Δρmin = −0.48 e Å−3 |
Special details
| Experimental. Data were collected on an APEX II QUAZAR diffractometer equipped with a brilliant, high intense IµS (microfocus source) with multilayer mirrors for monochromation and collimation. |
| Geometry. Bond distances, angles etc. have been calculated using the rounded fractional coordinates. All su's are estimated from the variances of the (full) variance-covariance matrix. The cell esds are taken into account in the estimation of distances, angles and torsion angles |
| Refinement. Refinement on F2 for ALL reflections except those flagged by the user for potential systematic errors. Weighted R-factors wR and all goodnesses of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The observed criterion of F2 > σ(F2) is used only for calculating -R-factor-obs etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R-factors based on ALL data will be even larger. |
Fractional atomic coordinates and isotropic or equivalent isotropic displacement parameters (Å2)
| x | y | z | Uiso*/Ueq | ||
| Co1 | 0.38557 (4) | 0.69835 (4) | 0.77352 (3) | 0.0194 (1) | |
| Cl1 | 0.23442 (8) | 0.51641 (7) | 0.74255 (6) | 0.0299 (2) | |
| Cl2 | 0.28764 (9) | 0.80333 (7) | 0.68299 (5) | 0.0305 (3) | |
| Si1 | 0.80522 (9) | 0.66034 (8) | 0.52977 (6) | 0.0220 (3) | |
| Si2 | 0.76085 (9) | 0.79463 (8) | 1.19186 (6) | 0.0242 (3) | |
| O1 | 0.6900 (3) | 0.3815 (2) | 0.93714 (16) | 0.0374 (8) | |
| O2 | 0.9030 (3) | 0.3653 (2) | 0.93302 (19) | 0.0490 (10) | |
| O3 | −0.0582 (2) | 0.8517 (2) | 0.90291 (16) | 0.0357 (8) | |
| O4 | −0.0395 (2) | 0.8620 (2) | 1.04422 (17) | 0.0393 (8) | |
| N1 | 0.5723 (3) | 0.6770 (2) | 0.75277 (16) | 0.0202 (8) | |
| N2 | 0.7576 (3) | 0.7092 (2) | 0.70128 (16) | 0.0210 (8) | |
| N3 | 0.7937 (3) | 0.4046 (2) | 0.91233 (19) | 0.0310 (9) | |
| N4 | 0.4540 (2) | 0.7981 (2) | 0.91071 (16) | 0.0183 (7) | |
| N5 | 0.6010 (2) | 0.8884 (2) | 1.06061 (15) | 0.0172 (7) | |
| N6 | 0.0135 (3) | 0.8609 (2) | 0.98339 (19) | 0.0264 (8) | |
| C1 | 0.6695 (3) | 0.6074 (3) | 0.78068 (19) | 0.0206 (9) | |
| C2 | 0.6672 (3) | 0.5322 (3) | 0.8338 (2) | 0.0239 (9) | |
| C3 | 0.7870 (3) | 0.4827 (3) | 0.8532 (2) | 0.0240 (10) | |
| C4 | 0.9025 (3) | 0.5029 (3) | 0.8219 (2) | 0.0262 (10) | |
| C5 | 0.9033 (3) | 0.5751 (3) | 0.7674 (2) | 0.0249 (10) | |
| C6 | 0.7850 (3) | 0.6276 (3) | 0.74777 (19) | 0.0209 (9) | |
| C7 | 0.6315 (3) | 0.7364 (3) | 0.70664 (19) | 0.0211 (9) | |
| C8 | 0.8477 (3) | 0.7615 (3) | 0.6555 (2) | 0.0233 (9) | |
| C9 | 0.8366 (4) | 0.5082 (3) | 0.5292 (2) | 0.0316 (11) | |
| C10 | 0.9278 (3) | 0.7459 (3) | 0.4868 (2) | 0.0286 (10) | |
| C11 | 0.6093 (3) | 0.6419 (3) | 0.4624 (2) | 0.0301 (11) | |
| C12 | 0.3698 (3) | 0.8356 (3) | 0.96419 (19) | 0.0173 (9) | |
| C13 | 0.2206 (3) | 0.8261 (3) | 0.9372 (2) | 0.0190 (9) | |
| C14 | 0.1713 (3) | 0.8717 (3) | 1.0084 (2) | 0.0215 (9) | |
| C15 | 0.2602 (3) | 0.9252 (3) | 1.1030 (2) | 0.0221 (9) | |
| C16 | 0.4089 (3) | 0.9373 (3) | 1.1298 (2) | 0.0206 (9) | |
| C17 | 0.4614 (3) | 0.8913 (3) | 1.05910 (19) | 0.0167 (8) | |
| C18 | 0.5901 (3) | 0.8324 (3) | 0.97189 (19) | 0.0176 (8) | |
| C19 | 0.7347 (3) | 0.9258 (3) | 1.14482 (19) | 0.0204 (9) | |
| C20 | 0.6391 (3) | 0.7803 (3) | 1.2593 (2) | 0.0302 (11) | |
| C21 | 0.9569 (4) | 0.8365 (4) | 1.2669 (3) | 0.0517 (16) | |
| C22 | 0.7128 (4) | 0.6516 (3) | 1.0898 (2) | 0.0424 (14) | |
| O5 | 0.3510 (3) | 1.0259 (2) | 0.34832 (19) | 0.0470 (10) | |
| N7 | 0.3118 (3) | 0.8861 (2) | 0.41855 (17) | 0.0256 (8) | |
| C23 | 0.3349 (4) | 0.9199 (4) | 0.3519 (3) | 0.0478 (16) | |
| C24 | 0.2906 (4) | 0.9746 (4) | 0.4965 (3) | 0.0484 (14) | |
| C25 | 0.2834 (4) | 0.7605 (3) | 0.4171 (3) | 0.0472 (14) | |
| H2 | 0.58920 | 0.51540 | 0.85550 | 0.0290* | |
| H4 | 0.98130 | 0.46640 | 0.83840 | 0.0310* | |
| H5 | 0.98000 | 0.58890 | 0.74420 | 0.0300* | |
| H7 | 0.58970 | 0.79200 | 0.68020 | 0.0250* | |
| H8A | 0.95250 | 0.77410 | 0.69220 | 0.0280* | |
| H8B | 0.83170 | 0.84310 | 0.65610 | 0.0280* | |
| H9A | 0.81830 | 0.45610 | 0.46500 | 0.0470* | |
| H9B | 0.76970 | 0.46860 | 0.55370 | 0.0470* | |
| H9C | 0.93820 | 0.51920 | 0.56880 | 0.0470* | |
| H10A | 1.03020 | 0.76020 | 0.52660 | 0.0430* | |
| H10B | 0.90560 | 0.82520 | 0.48890 | 0.0430* | |
| H10C | 0.91240 | 0.69750 | 0.42220 | 0.0430* | |
| H11A | 0.59310 | 0.72290 | 0.46410 | 0.0450* | |
| H11B | 0.54730 | 0.60370 | 0.49030 | 0.0450* | |
| H11C | 0.58410 | 0.58930 | 0.39730 | 0.0450* | |
| H13 | 0.15650 | 0.79030 | 0.87350 | 0.0230* | |
| H15 | 0.21820 | 0.95320 | 1.14870 | 0.0270* | |
| H16 | 0.47250 | 0.97530 | 1.19340 | 0.0250* | |
| H18 | 0.67190 | 0.81890 | 0.95490 | 0.0210* | |
| H19A | 0.72860 | 0.99600 | 1.19400 | 0.0250* | |
| H19B | 0.82100 | 0.95400 | 1.12940 | 0.0250* | |
| H20A | 0.65820 | 0.71800 | 1.28850 | 0.0450* | |
| H20B | 0.53650 | 0.75540 | 1.21700 | 0.0450* | |
| H20C | 0.65840 | 0.85980 | 1.30800 | 0.0450* | |
| H21A | 0.97770 | 0.76980 | 1.29050 | 0.0780* | |
| H21B | 0.97900 | 0.91240 | 1.31980 | 0.0780* | |
| H21C | 1.01770 | 0.84960 | 1.23020 | 0.0780* | |
| H22A | 0.77640 | 0.66230 | 1.05430 | 0.0640* | |
| H22B | 0.61020 | 0.63470 | 1.04940 | 0.0640* | |
| H22C | 0.72650 | 0.58240 | 1.11190 | 0.0640* | |
| H23 | 0.33990 | 0.85760 | 0.30080 | 0.0580* | |
| H24A | 0.33100 | 1.05880 | 0.50050 | 0.0720* | |
| H24B | 0.34120 | 0.96270 | 0.55530 | 0.0720* | |
| H24C | 0.18560 | 0.96110 | 0.48560 | 0.0720* | |
| H25A | 0.18070 | 0.73140 | 0.40970 | 0.0710* | |
| H25B | 0.34760 | 0.75680 | 0.47610 | 0.0710* | |
| H25C | 0.30270 | 0.70800 | 0.36470 | 0.0710* |
Atomic displacement parameters (Å2)
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Co1 | 0.0190 (2) | 0.0224 (2) | 0.0177 (2) | 0.0079 (2) | 0.0067 (2) | 0.0069 (2) |
| Cl1 | 0.0287 (4) | 0.0262 (4) | 0.0359 (4) | 0.0061 (3) | 0.0135 (4) | 0.0110 (4) |
| Cl2 | 0.0374 (5) | 0.0281 (4) | 0.0214 (4) | 0.0142 (4) | 0.0023 (3) | 0.0075 (3) |
| Si1 | 0.0215 (5) | 0.0251 (5) | 0.0226 (4) | 0.0078 (4) | 0.0107 (4) | 0.0090 (4) |
| Si2 | 0.0231 (5) | 0.0326 (5) | 0.0214 (4) | 0.0123 (4) | 0.0080 (4) | 0.0135 (4) |
| O1 | 0.0466 (15) | 0.0345 (14) | 0.0415 (14) | 0.0148 (12) | 0.0206 (12) | 0.0211 (12) |
| O2 | 0.0418 (15) | 0.0509 (17) | 0.0700 (19) | 0.0243 (13) | 0.0154 (14) | 0.0429 (15) |
| O3 | 0.0227 (12) | 0.0408 (15) | 0.0360 (14) | 0.0129 (11) | 0.0039 (11) | 0.0066 (12) |
| O4 | 0.0273 (13) | 0.0520 (16) | 0.0509 (15) | 0.0176 (12) | 0.0260 (12) | 0.0193 (13) |
| N1 | 0.0220 (13) | 0.0228 (14) | 0.0194 (13) | 0.0090 (11) | 0.0087 (11) | 0.0094 (11) |
| N2 | 0.0212 (13) | 0.0264 (14) | 0.0209 (13) | 0.0091 (11) | 0.0118 (11) | 0.0102 (11) |
| N3 | 0.0365 (17) | 0.0254 (15) | 0.0351 (16) | 0.0097 (13) | 0.0128 (14) | 0.0157 (13) |
| N4 | 0.0162 (13) | 0.0227 (13) | 0.0195 (12) | 0.0071 (11) | 0.0082 (10) | 0.0097 (11) |
| N5 | 0.0160 (12) | 0.0194 (13) | 0.0182 (12) | 0.0076 (10) | 0.0055 (10) | 0.0086 (10) |
| N6 | 0.0215 (14) | 0.0193 (14) | 0.0369 (16) | 0.0071 (11) | 0.0116 (13) | 0.0054 (12) |
| C1 | 0.0240 (16) | 0.0192 (16) | 0.0168 (15) | 0.0085 (13) | 0.0056 (13) | 0.0040 (12) |
| C2 | 0.0283 (17) | 0.0217 (16) | 0.0220 (16) | 0.0045 (14) | 0.0102 (14) | 0.0078 (13) |
| C3 | 0.0320 (18) | 0.0171 (16) | 0.0220 (16) | 0.0087 (14) | 0.0049 (14) | 0.0094 (13) |
| C4 | 0.0234 (17) | 0.0263 (17) | 0.0272 (17) | 0.0097 (14) | 0.0057 (14) | 0.0085 (14) |
| C5 | 0.0205 (16) | 0.0278 (18) | 0.0256 (16) | 0.0079 (14) | 0.0082 (13) | 0.0071 (14) |
| C6 | 0.0200 (16) | 0.0227 (16) | 0.0199 (15) | 0.0073 (13) | 0.0060 (13) | 0.0075 (13) |
| C7 | 0.0236 (16) | 0.0269 (17) | 0.0176 (15) | 0.0119 (14) | 0.0102 (13) | 0.0089 (13) |
| C8 | 0.0241 (16) | 0.0250 (17) | 0.0259 (16) | 0.0063 (14) | 0.0148 (14) | 0.0102 (14) |
| C9 | 0.043 (2) | 0.0286 (19) | 0.0313 (18) | 0.0171 (16) | 0.0195 (16) | 0.0115 (15) |
| C10 | 0.0207 (16) | 0.038 (2) | 0.0291 (17) | 0.0065 (15) | 0.0111 (14) | 0.0130 (15) |
| C11 | 0.0245 (17) | 0.034 (2) | 0.0329 (18) | 0.0062 (15) | 0.0098 (15) | 0.0144 (16) |
| C12 | 0.0171 (15) | 0.0176 (15) | 0.0203 (15) | 0.0058 (12) | 0.0072 (12) | 0.0099 (12) |
| C13 | 0.0186 (15) | 0.0161 (15) | 0.0221 (15) | 0.0048 (12) | 0.0034 (12) | 0.0103 (12) |
| C14 | 0.0169 (15) | 0.0194 (16) | 0.0334 (17) | 0.0078 (13) | 0.0117 (13) | 0.0125 (14) |
| C15 | 0.0254 (16) | 0.0208 (16) | 0.0259 (16) | 0.0078 (13) | 0.0153 (14) | 0.0092 (13) |
| C16 | 0.0241 (16) | 0.0216 (16) | 0.0185 (15) | 0.0088 (13) | 0.0094 (13) | 0.0072 (13) |
| C17 | 0.0174 (15) | 0.0156 (15) | 0.0200 (14) | 0.0062 (12) | 0.0072 (12) | 0.0088 (12) |
| C18 | 0.0200 (15) | 0.0193 (15) | 0.0191 (14) | 0.0084 (13) | 0.0112 (13) | 0.0085 (12) |
| C19 | 0.0175 (15) | 0.0226 (16) | 0.0192 (15) | 0.0053 (13) | 0.0053 (12) | 0.0056 (13) |
| C20 | 0.0287 (18) | 0.038 (2) | 0.0277 (17) | 0.0101 (16) | 0.0114 (14) | 0.0151 (16) |
| C21 | 0.026 (2) | 0.088 (3) | 0.058 (3) | 0.020 (2) | 0.0110 (19) | 0.052 (3) |
| C22 | 0.074 (3) | 0.036 (2) | 0.038 (2) | 0.030 (2) | 0.032 (2) | 0.0223 (18) |
| O5 | 0.0476 (16) | 0.0460 (16) | 0.0694 (19) | 0.0174 (13) | 0.0287 (14) | 0.0420 (15) |
| N7 | 0.0230 (14) | 0.0266 (15) | 0.0286 (14) | 0.0060 (12) | 0.0061 (12) | 0.0153 (12) |
| C23 | 0.039 (2) | 0.062 (3) | 0.055 (3) | 0.018 (2) | 0.020 (2) | 0.033 (2) |
| C24 | 0.056 (3) | 0.044 (2) | 0.041 (2) | 0.012 (2) | 0.018 (2) | 0.0085 (19) |
| C25 | 0.045 (2) | 0.045 (2) | 0.065 (3) | 0.0190 (19) | 0.021 (2) | 0.034 (2) |
Geometric parameters (Å, °)
| Co1—Cl1 | 2.2330 (10) | C14—C15 | 1.396 (4) |
| Co1—Cl2 | 2.2455 (9) | C15—C16 | 1.376 (4) |
| Co1—N1 | 2.013 (3) | C16—C17 | 1.390 (4) |
| Co1—N4 | 2.013 (2) | C2—H2 | 0.9500 |
| Si1—C8 | 1.902 (3) | C4—H4 | 0.9500 |
| Si1—C9 | 1.852 (4) | C5—H5 | 0.9500 |
| Si1—C10 | 1.854 (3) | C7—H7 | 0.9500 |
| Si1—C11 | 1.859 (3) | C8—H8B | 0.9900 |
| Si2—C19 | 1.904 (4) | C8—H8A | 0.9900 |
| Si2—C20 | 1.856 (3) | C9—H9A | 0.9800 |
| Si2—C21 | 1.851 (4) | C9—H9B | 0.9800 |
| Si2—C22 | 1.858 (3) | C9—H9C | 0.9800 |
| O1—N3 | 1.224 (4) | C10—H10A | 0.9800 |
| O2—N3 | 1.232 (4) | C10—H10B | 0.9800 |
| O3—N6 | 1.231 (4) | C10—H10C | 0.9800 |
| O4—N6 | 1.230 (4) | C11—H11B | 0.9800 |
| O5—C23 | 1.244 (5) | C11—H11C | 0.9800 |
| N1—C1 | 1.406 (4) | C11—H11A | 0.9800 |
| N1—C7 | 1.333 (4) | C13—H13 | 0.9500 |
| N2—C7 | 1.356 (4) | C15—H15 | 0.9500 |
| N2—C8 | 1.472 (4) | C16—H16 | 0.9500 |
| N2—C6 | 1.373 (4) | C18—H18 | 0.9500 |
| N3—C3 | 1.477 (4) | C19—H19B | 0.9900 |
| N4—C12 | 1.395 (4) | C19—H19A | 0.9900 |
| N4—C18 | 1.324 (4) | C20—H20A | 0.9800 |
| N5—C18 | 1.346 (4) | C20—H20B | 0.9800 |
| N5—C19 | 1.474 (4) | C20—H20C | 0.9800 |
| N5—C17 | 1.381 (4) | C21—H21A | 0.9800 |
| N6—C14 | 1.467 (4) | C21—H21B | 0.9800 |
| N7—C25 | 1.444 (5) | C21—H21C | 0.9800 |
| N7—C23 | 1.298 (5) | C22—H22B | 0.9800 |
| N7—C24 | 1.473 (5) | C22—H22C | 0.9800 |
| C1—C6 | 1.407 (4) | C22—H22A | 0.9800 |
| C1—C2 | 1.381 (5) | C23—H23 | 0.9500 |
| C2—C3 | 1.390 (5) | C24—H24A | 0.9800 |
| C3—C4 | 1.390 (4) | C24—H24B | 0.9800 |
| C4—C5 | 1.369 (5) | C24—H24C | 0.9800 |
| C5—C6 | 1.400 (5) | C25—H25A | 0.9800 |
| C12—C13 | 1.386 (4) | C25—H25B | 0.9800 |
| C12—C17 | 1.408 (4) | C25—H25C | 0.9800 |
| C13—C14 | 1.374 (4) | ||
| Co1···H2 | 3.4200 | C22···O1 | 3.338 (4) |
| Co1···H13 | 3.2900 | C22···C18 | 3.333 (5) |
| Cl1···N4 | 3.484 (3) | C23···C21xi | 3.446 (6) |
| Cl1···C5i | 3.564 (3) | C23···C24viii | 3.557 (6) |
| Cl2···N1 | 3.420 (3) | C24···C23viii | 3.557 (6) |
| Cl2···C7 | 3.546 (3) | C25···C9iii | 3.597 (5) |
| Cl1···H5i | 2.7900 | C5···H13v | 2.9300 |
| Cl1···H22Cii | 2.8200 | C5···H8A | 2.9400 |
| Cl1···H10Ciii | 2.8600 | C5···H9B | 3.0600 |
| Cl1···H20Aii | 3.0600 | C6···H9B | 3.0800 |
| Cl2···H7 | 3.0300 | C8···H5 | 3.0100 |
| Cl2···H10Ai | 2.8400 | C9···H9Cxii | 3.0900 |
| Cl2···H9Aiii | 3.0700 | C9···H5 | 3.0900 |
| Cl2···H16iv | 2.9400 | C13···H19Biv | 3.0800 |
| Cl2···H19Aiv | 2.6700 | C16···H20B | 3.0800 |
| Si2···O4v | 3.657 (2) | C16···H19A | 2.9200 |
| O1···C22 | 3.338 (4) | C18···H22B | 2.9100 |
| O1···C12ii | 3.399 (4) | C19···H16 | 3.0200 |
| O1···C17ii | 3.329 (4) | C23···H24Bviii | 3.0000 |
| O2···C14ii | 3.208 (4) | C23···H21Cxi | 2.9900 |
| O2···O4ii | 3.223 (4) | C24···H20Civ | 3.0200 |
| O2···O2vi | 3.178 (4) | C25···H11A | 3.0600 |
| O2···C15ii | 3.335 (4) | C25···H9Biii | 2.8400 |
| O3···C5i | 3.245 (4) | H2···O1 | 2.4500 |
| O3···C1i | 3.253 (4) | H2···Co1 | 3.4200 |
| O3···O4vii | 3.129 (3) | H4···O2 | 2.3800 |
| O3···N2i | 3.000 (3) | H5···H13v | 2.5900 |
| O3···C7i | 3.413 (4) | H5···H9C | 2.5700 |
| O3···C6i | 2.869 (4) | H5···Cl1v | 2.7900 |
| O3···N6vii | 3.234 (4) | H5···C8 | 3.0100 |
| O4···O3vii | 3.129 (3) | H5···C9 | 3.0900 |
| O4···Si2i | 3.657 (2) | H5···H8A | 2.5500 |
| O4···O2ii | 3.223 (4) | H7···Cl2 | 3.0300 |
| O4···C19i | 3.182 (4) | H7···H8B | 2.5400 |
| O5···C8viii | 3.406 (4) | H7···O5viii | 2.3200 |
| O5···C7viii | 3.132 (4) | H8A···C5 | 2.9400 |
| O1···H2 | 2.4500 | H8A···H5 | 2.5500 |
| O1···H20Bii | 2.6500 | H8B···H7 | 2.5400 |
| O2···H4 | 2.3800 | H8B···O5viii | 2.5400 |
| O3···H13 | 2.4800 | H9A···Cl2iii | 3.0700 |
| O4···H18i | 2.6800 | H9B···C5 | 3.0600 |
| O4···H19Bi | 2.3800 | H9B···C6 | 3.0800 |
| O4···H15 | 2.4600 | H9B···C25iii | 2.8400 |
| O4···H22Ai | 2.8000 | H9B···H25Biii | 2.5600 |
| O4···H21Ci | 2.8900 | H9C···H5 | 2.5700 |
| O5···H8Bviii | 2.5400 | H9C···C9xii | 3.0900 |
| O5···H7viii | 2.3200 | H10A···Cl2v | 2.8400 |
| O5···H24A | 2.4200 | H10C···Cl1iii | 2.8600 |
| O5···H15ix | 2.8700 | H11A···H24Aviii | 2.4000 |
| N1···N4 | 3.166 (3) | H11A···C25 | 3.0600 |
| N1···Cl2 | 3.420 (3) | H11A···H25B | 2.5800 |
| N1···N2 | 2.243 (4) | H11B···H11Biii | 2.5900 |
| N1···C18 | 3.397 (4) | H13···C5i | 2.9300 |
| N2···O3v | 3.000 (3) | H13···Co1 | 3.2900 |
| N2···N1 | 2.243 (4) | H13···O3 | 2.4800 |
| N4···N5 | 2.231 (3) | H13···H5i | 2.5900 |
| N4···Cl1 | 3.484 (3) | H15···O5xiii | 2.8700 |
| N4···N1 | 3.166 (3) | H15···O4 | 2.4600 |
| N5···N4 | 2.231 (3) | H16···Cl2iv | 2.9400 |
| N5···C12iv | 3.337 (4) | H16···C19 | 3.0200 |
| N6···O3vii | 3.234 (4) | H16···H19A | 2.5100 |
| N6···N6vii | 3.216 (4) | H18···O4v | 2.6800 |
| N5···H22B | 2.9400 | H19A···H16 | 2.5100 |
| C1···O3v | 3.253 (4) | H19A···C16 | 2.9200 |
| C5···C9 | 3.485 (4) | H19A···Cl2iv | 2.6700 |
| C5···Cl1v | 3.564 (3) | H19B···O4v | 2.3800 |
| C5···O3v | 3.245 (4) | H19B···C13iv | 3.0800 |
| C6···C9 | 3.596 (4) | H20A···Cl1ii | 3.0600 |
| C6···O3v | 2.869 (4) | H20B···C16 | 3.0800 |
| C7···O5viii | 3.132 (4) | H20B···O1ii | 2.6500 |
| C7···O3v | 3.413 (4) | H20C···C24iv | 3.0200 |
| C8···O5viii | 3.406 (4) | H20C···H24Biv | 2.5600 |
| C9···C6 | 3.596 (4) | H21A···H25Ax | 2.5100 |
| C9···C25iii | 3.597 (5) | H21C···O4v | 2.8900 |
| C9···C5 | 3.485 (4) | H21C···C23x | 2.9900 |
| C12···O1ii | 3.399 (4) | H22A···O4v | 2.8000 |
| C12···N5iv | 3.337 (4) | H22B···N5 | 2.9400 |
| C12···C17iv | 3.532 (5) | H22B···C18 | 2.9100 |
| C13···C19iv | 3.515 (5) | H22C···Cl1ii | 2.8200 |
| C14···O2ii | 3.208 (4) | H23···H25C | 2.2900 |
| C15···O2ii | 3.335 (4) | H24A···O5 | 2.4200 |
| C16···C18iv | 3.506 (5) | H24A···H11Aviii | 2.4000 |
| C17···C18iv | 3.492 (5) | H24B···H25B | 2.4100 |
| C17···O1ii | 3.329 (4) | H24B···C23viii | 3.0000 |
| C17···C12iv | 3.532 (5) | H24B···H20Civ | 2.5600 |
| C18···C22 | 3.333 (5) | H25A···H21Axi | 2.5100 |
| C18···C16iv | 3.506 (5) | H25B···H11A | 2.5800 |
| C18···C17iv | 3.492 (5) | H25B···H24B | 2.4100 |
| C19···C13iv | 3.515 (5) | H25B···H9Biii | 2.5600 |
| C19···O4v | 3.182 (4) | H25C···H23 | 2.2900 |
| C21···C23x | 3.446 (6) | ||
| Cl1—Co1—Cl2 | 112.94 (4) | C4—C5—H5 | 122.00 |
| Cl1—Co1—N1 | 111.06 (8) | N1—C7—H7 | 124.00 |
| Cl1—Co1—N4 | 110.18 (7) | N2—C7—H7 | 123.00 |
| Cl2—Co1—N1 | 106.74 (7) | Si1—C8—H8A | 109.00 |
| Cl2—Co1—N4 | 111.81 (7) | H8A—C8—H8B | 108.00 |
| N1—Co1—N4 | 103.67 (9) | Si1—C8—H8B | 109.00 |
| C8—Si1—C9 | 108.71 (15) | N2—C8—H8A | 109.00 |
| C8—Si1—C10 | 105.46 (15) | N2—C8—H8B | 109.00 |
| C8—Si1—C11 | 107.76 (14) | Si1—C9—H9A | 110.00 |
| C9—Si1—C10 | 113.60 (17) | Si1—C9—H9B | 109.00 |
| C9—Si1—C11 | 109.95 (17) | Si1—C9—H9C | 110.00 |
| C10—Si1—C11 | 111.09 (15) | H9B—C9—H9C | 109.00 |
| C19—Si2—C20 | 108.88 (15) | H9A—C9—H9B | 109.00 |
| C19—Si2—C21 | 106.02 (18) | H9A—C9—H9C | 110.00 |
| C19—Si2—C22 | 107.56 (14) | Si1—C10—H10B | 109.00 |
| C20—Si2—C21 | 111.80 (17) | H10A—C10—H10C | 109.00 |
| C20—Si2—C22 | 110.98 (17) | Si1—C10—H10C | 109.00 |
| C21—Si2—C22 | 111.36 (19) | H10A—C10—H10B | 110.00 |
| Co1—N1—C1 | 132.6 (2) | Si1—C10—H10A | 109.00 |
| Co1—N1—C7 | 122.7 (2) | H10B—C10—H10C | 109.00 |
| C1—N1—C7 | 104.7 (3) | Si1—C11—H11C | 109.00 |
| C6—N2—C7 | 107.3 (3) | H11A—C11—H11C | 110.00 |
| C6—N2—C8 | 127.5 (3) | H11B—C11—H11C | 109.00 |
| C7—N2—C8 | 125.2 (3) | H11A—C11—H11B | 109.00 |
| O1—N3—O2 | 123.7 (3) | Si1—C11—H11A | 109.00 |
| O1—N3—C3 | 118.3 (3) | Si1—C11—H11B | 109.00 |
| O2—N3—C3 | 118.0 (3) | C14—C13—H13 | 122.00 |
| Co1—N4—C12 | 128.49 (18) | C12—C13—H13 | 122.00 |
| Co1—N4—C18 | 126.50 (19) | C14—C15—H15 | 120.00 |
| C12—N4—C18 | 104.7 (2) | C16—C15—H15 | 120.00 |
| C17—N5—C18 | 107.4 (2) | C17—C16—H16 | 122.00 |
| C17—N5—C19 | 126.3 (2) | C15—C16—H16 | 122.00 |
| C18—N5—C19 | 125.9 (2) | N4—C18—H18 | 123.00 |
| O3—N6—O4 | 123.7 (3) | N5—C18—H18 | 123.00 |
| O3—N6—C14 | 118.2 (3) | Si2—C19—H19A | 109.00 |
| O4—N6—C14 | 118.1 (3) | H19A—C19—H19B | 108.00 |
| C24—N7—C25 | 114.4 (3) | Si2—C19—H19B | 109.00 |
| C23—N7—C24 | 120.3 (3) | N5—C19—H19A | 109.00 |
| C23—N7—C25 | 124.7 (3) | N5—C19—H19B | 109.00 |
| N1—C1—C6 | 108.8 (3) | Si2—C20—H20A | 109.00 |
| N1—C1—C2 | 130.4 (3) | Si2—C20—H20B | 109.00 |
| C2—C1—C6 | 120.8 (3) | Si2—C20—H20C | 109.00 |
| C1—C2—C3 | 115.2 (3) | H20B—C20—H20C | 110.00 |
| N3—C3—C2 | 118.0 (3) | H20A—C20—H20B | 109.00 |
| N3—C3—C4 | 117.5 (3) | H20A—C20—H20C | 109.00 |
| C2—C3—C4 | 124.6 (3) | Si2—C21—H21B | 109.00 |
| C3—C4—C5 | 120.3 (3) | H21A—C21—H21C | 110.00 |
| C4—C5—C6 | 116.4 (3) | Si2—C21—H21C | 109.00 |
| N2—C6—C1 | 106.2 (3) | H21A—C21—H21B | 109.00 |
| N2—C6—C5 | 131.0 (3) | Si2—C21—H21A | 109.00 |
| C1—C6—C5 | 122.7 (3) | H21B—C21—H21C | 109.00 |
| N1—C7—N2 | 113.0 (3) | Si2—C22—H22C | 109.00 |
| Si1—C8—N2 | 113.4 (2) | H22A—C22—H22C | 109.00 |
| C13—C12—C17 | 120.4 (3) | H22B—C22—H22C | 110.00 |
| N4—C12—C17 | 109.3 (3) | H22A—C22—H22B | 109.00 |
| N4—C12—C13 | 130.3 (3) | Si2—C22—H22A | 109.00 |
| C12—C13—C14 | 115.7 (3) | Si2—C22—H22B | 109.00 |
| N6—C14—C13 | 117.6 (3) | O5—C23—N7 | 126.4 (4) |
| N6—C14—C15 | 117.7 (3) | O5—C23—H23 | 117.00 |
| C13—C14—C15 | 124.7 (3) | N7—C23—H23 | 117.00 |
| C14—C15—C16 | 119.8 (3) | N7—C24—H24A | 109.00 |
| C15—C16—C17 | 116.7 (3) | N7—C24—H24B | 109.00 |
| N5—C17—C12 | 105.2 (2) | N7—C24—H24C | 109.00 |
| N5—C17—C16 | 132.0 (3) | H24A—C24—H24B | 109.00 |
| C12—C17—C16 | 122.8 (3) | H24A—C24—H24C | 110.00 |
| N4—C18—N5 | 113.3 (3) | H24B—C24—H24C | 109.00 |
| Si2—C19—N5 | 112.1 (2) | N7—C25—H25A | 109.00 |
| C1—C2—H2 | 122.00 | N7—C25—H25B | 109.00 |
| C3—C2—H2 | 122.00 | N7—C25—H25C | 110.00 |
| C3—C4—H4 | 120.00 | H25A—C25—H25B | 109.00 |
| C5—C4—H4 | 120.00 | H25A—C25—H25C | 109.00 |
| C6—C5—H5 | 122.00 | H25B—C25—H25C | 109.00 |
| Cl1—Co1—N1—C1 | −47.5 (3) | Co1—N4—C18—N5 | −174.0 (2) |
| Cl2—Co1—N1—C1 | −171.0 (2) | C17—N5—C19—Si2 | 86.6 (3) |
| N4—Co1—N1—C1 | 70.8 (3) | C18—N5—C17—C12 | −1.0 (4) |
| Cl1—Co1—N1—C7 | 134.4 (2) | C19—N5—C18—N4 | 173.7 (3) |
| Cl2—Co1—N1—C7 | 10.9 (2) | C19—N5—C17—C12 | −174.2 (3) |
| N4—Co1—N1—C7 | −107.3 (2) | C17—N5—C18—N4 | 0.4 (4) |
| Cl1—Co1—N4—C12 | −58.2 (3) | C18—N5—C19—Si2 | −85.4 (3) |
| Cl2—Co1—N4—C12 | 68.3 (3) | C19—N5—C17—C16 | 6.6 (6) |
| N1—Co1—N4—C12 | −177.1 (3) | C18—N5—C17—C16 | 179.8 (4) |
| Cl1—Co1—N4—C18 | 114.8 (3) | O3—N6—C14—C15 | 157.4 (3) |
| Cl2—Co1—N4—C18 | −118.7 (3) | O4—N6—C14—C15 | −22.3 (4) |
| N1—Co1—N4—C18 | −4.1 (3) | O3—N6—C14—C13 | −23.9 (4) |
| C11—Si1—C8—N2 | 60.1 (3) | O4—N6—C14—C13 | 156.4 (3) |
| C10—Si1—C8—N2 | 178.8 (2) | C24—N7—C23—O5 | 4.9 (6) |
| C9—Si1—C8—N2 | −59.0 (3) | C25—N7—C23—O5 | 175.4 (4) |
| C22—Si2—C19—N5 | 41.2 (3) | C2—C1—C6—C5 | −0.8 (5) |
| C20—Si2—C19—N5 | −79.2 (2) | N1—C1—C6—N2 | 0.5 (3) |
| C21—Si2—C19—N5 | 160.4 (2) | C6—C1—C2—C3 | 1.6 (4) |
| C7—N1—C1—C6 | −0.9 (3) | C2—C1—C6—N2 | −177.7 (3) |
| Co1—N1—C1—C6 | −179.3 (2) | N1—C1—C6—C5 | 177.3 (3) |
| C1—N1—C7—N2 | 1.0 (3) | N1—C1—C2—C3 | −176.1 (3) |
| C7—N1—C1—C2 | 177.0 (3) | C1—C2—C3—C4 | −1.0 (5) |
| Co1—N1—C7—N2 | 179.59 (18) | C1—C2—C3—N3 | 178.1 (3) |
| Co1—N1—C1—C2 | −1.4 (5) | C2—C3—C4—C5 | −0.5 (5) |
| C7—N2—C6—C1 | 0.2 (3) | N3—C3—C4—C5 | −179.6 (3) |
| C8—N2—C7—N1 | −179.4 (3) | C3—C4—C5—C6 | 1.3 (5) |
| C6—N2—C7—N1 | −0.8 (3) | C4—C5—C6—C1 | −0.7 (5) |
| C7—N2—C8—Si1 | −95.2 (3) | C4—C5—C6—N2 | 175.3 (3) |
| C8—N2—C6—C5 | 2.3 (5) | C17—C12—C13—C14 | −1.2 (5) |
| C8—N2—C6—C1 | 178.8 (3) | C13—C12—C17—C16 | 1.0 (6) |
| C7—N2—C6—C5 | −176.4 (3) | N4—C12—C17—N5 | 1.2 (4) |
| C6—N2—C8—Si1 | 86.4 (3) | N4—C12—C17—C16 | −179.5 (3) |
| O1—N3—C3—C2 | 4.0 (4) | N4—C12—C13—C14 | 179.4 (3) |
| O2—N3—C3—C2 | −176.8 (3) | C13—C12—C17—N5 | −178.4 (3) |
| O1—N3—C3—C4 | −176.9 (3) | C12—C13—C14—N6 | −178.5 (3) |
| O2—N3—C3—C4 | 2.3 (4) | C12—C13—C14—C15 | 0.0 (6) |
| C12—N4—C18—N5 | 0.3 (4) | N6—C14—C15—C16 | −180.0 (3) |
| C18—N4—C12—C17 | −1.0 (4) | C13—C14—C15—C16 | 1.4 (6) |
| Co1—N4—C12—C17 | 173.2 (2) | C14—C15—C16—C17 | −1.6 (5) |
| Co1—N4—C12—C13 | −7.3 (5) | C15—C16—C17—N5 | 179.6 (4) |
| C18—N4—C12—C13 | 178.6 (4) | C15—C16—C17—C12 | 0.5 (5) |
Symmetry codes: (i) x−1, y, z; (ii) −x+1, −y+1, −z+2; (iii) −x+1, −y+1, −z+1; (iv) −x+1, −y+2, −z+2; (v) x+1, y, z; (vi) −x+2, −y+1, −z+2; (vii) −x, −y+2, −z+2; (viii) −x+1, −y+2, −z+1; (ix) x, y, z−1; (x) x+1, y, z+1; (xi) x−1, y, z−1; (xii) −x+2, −y+1, −z+1; (xiii) x, y, z+1.
Hydrogen-bond geometry (Å, °)
| D—H···A | D—H | H···A | D···A | D—H···A |
| C5—H5···Cl1v | 0.95 | 2.79 | 3.564 (3) | 140 |
| C7—H7···O5viii | 0.95 | 2.32 | 3.132 (4) | 143 |
| C8—H8B···O5viii | 0.99 | 2.54 | 3.406 (4) | 145 |
| C19—H19A···Cl2iv | 0.99 | 2.67 | 3.659 (3) | 175 |
| C19—H19B···O4v | 0.99 | 2.38 | 3.182 (4) | 137 |
| C22—H22C···Cl1ii | 0.98 | 2.82 | 3.695 (3) | 149 |
| C24—H24A···O5 | 0.98 | 2.42 | 2.793 (5) | 102 |
Symmetry codes: (v) x+1, y, z; (viii) −x+1, −y+2, −z+1; (iv) −x+1, −y+2, −z+2; (ii) −x+1, −y+1, −z+2.
Footnotes
Supplementary data and figures for this paper are available from the IUCr electronic archives (Reference: BT5186).
References
- Akkurt, M., Karaca, S., Küçükbay, H., Orhan, E. & Büyükgüngör, O. (2005). Acta Cryst. E61, m41–m43.
- Altomare, A., Burla, M. C., Camalli, M., Cascarano, G. L., Giacovazzo, C., Guagliardi, A., Moliterni, A. G. G., Polidori, G. & Spagna, R. (1999). J. Appl. Cryst.32, 115–119.
- Bruker (2008). SADABS Bruker AXS Inc., Madison, Wisconsin, USA.
- Bruker (2009). APEX2 and SAINT Bruker AXS Inc., Madison, Wisconsin, USA.
- Castro, J., Pérez Lourido, P., Sousa-Pedrares, A., Labisbal, E., Piso, J. & García-Vázquez, J. A. (2002). Acta Cryst. C58, m319–m322. [DOI] [PubMed]
- Çetinkaya, B., Çetinkaya, E., Küçükbay, H. & Durmaz, R. (1996). Arzneim. Forsch. Drug Res 46, 1154–1158. [PubMed]
- Farrugia, L. J. (1997). J. Appl. Cryst.30, 565.
- Farrugia, L. J. (1999). J. Appl. Cryst.32, 837–838.
- Küçükbay, H., Çetinkaya, B., Guesmi, S. & Dixneuf, P. H. (1996). Organometallics, 15, 2434–2439.
- Küçükbay, H., Durmaz, R., Okuyucu, N., Günal, S. & Kazaz, C. (2004). Arzneim. Forsch. Drug Res 54, 64–68. [DOI] [PubMed]
- Küçükbay, H., Durmaz, R., Şireci, N. & Günal, S. (2009). Asian J. Chem.21, 6181–6189.
- Liu, J.-W., Gao, S., Huo, L.-H. & Ng, S. W. (2004). Acta Cryst. E60, m501–m503.
- Lukevics, E., Arsenyan, P., Shestakova, I., Domracheva, I., Nesterova, A. & Pudova, O. (2001). Eur. J. Med. Chem.36, 507–515. [DOI] [PubMed]
- Özdemir, İ., Demir, S. & Çetinkaya, B. (2005). Tetrahedron, 61, 9791–9798.
- Pan, T.-T. & Xu, D.-J. (2004). Acta Cryst. E60, m56–m58.
- Pınar, Ş., Akkurt, M., Küçükbay, H., Orhan, E. & Büyükgüngör, O. (2006). Acta Cryst. E62, m1663–m1665.
- Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. [DOI] [PubMed]
- Spek, A. L. (2009). Acta Cryst. D65, 148–155. [DOI] [PMC free article] [PubMed]
- Tavman, A., Birteksöz, S. & Ötük, G. (2005). Folia Mirobio.50, 467-472. [DOI] [PubMed]
- Türktekin, S., Akkurt, M., Orhan, E., Küçükbay, F. Z., Küçükbay, H. & Büyükgüngör, O. (2004). Acta Cryst. E60, m1220–m1222.
Associated Data
This section collects any data citations, data availability statements, or supplementary materials included in this article.
Supplementary Materials
Crystal structure: contains datablocks global, I. DOI: 10.1107/S1600536810003922/bt5186sup1.cif
Structure factors: contains datablocks I. DOI: 10.1107/S1600536810003922/bt5186Isup2.hkl
Additional supplementary materials: crystallographic information; 3D view; checkCIF report


