Abstract
In the title compound, [Cu(C8H4F3O2S)2(C10H14N2O)], the CuII atom exists in a distorted CuNO4 square-pyramidal geometry; the metal atom lies above a square plane defined by four O atoms of the two chelating anionic ligands, displaced in the direction of the axial occupant, the pyridine N atom, by 0.179 (1) Å. Weak intermolecular C—H⋯O and C—H⋯F hydrogen bonding is present in the crystal structure. One thienyl ring is disordered over two orientations in an occupancy ratio of 0.69 (1):0.31.
Related literature
For the related crystal structure of bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato]copper(II), see: Lecomte et al. (1988 ▶); Wang et al. (1996 ▶); Xu et al. (2010 ▶). For some adducts with N-heterocycles, see: Gou et al. (1991 ▶); Li et al. (1994 ▶); Liu et al. (1986 ▶); Yu et al. (1988 ▶).
Experimental
Crystal data
[Cu(C8H4F3O2S)2(C10H14N2O)]
M r = 684.12
Triclinic,
a = 11.4324 (5) Å
b = 12.8606 (5) Å
c = 13.0104 (5) Å
α = 62.837 (1)°
β = 64.110 (1)°
γ = 88.783 (1)°
V = 1492.72 (10) Å3
Z = 2
Mo Kα radiation
μ = 0.95 mm−1
T = 293 K
0.30 × 0.30 × 0.30 mm
Data collection
Bruker APEXII diffractometer
Absorption correction: multi-scan (SADABS; Sheldrick, 1996 ▶) T min = 0.618, T max = 0.746
16434 measured reflections
6849 independent reflections
5423 reflections with I > 2σ(I)
R int = 0.021
Refinement
R[F 2 > 2σ(F 2)] = 0.048
wR(F 2) = 0.152
S = 1.05
6849 reflections
392 parameters
80 restraints
H-atom parameters constrained
Δρmax = 0.80 e Å−3
Δρmin = −0.48 e Å−3
Data collection: APEX2 (Bruker, 2005 ▶); cell refinement: SAINT (Bruker, 2005 ▶); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008 ▶); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008 ▶); molecular graphics: X-SEED (Barbour, 2001 ▶); software used to prepare material for publication: publCIF (Westrip, 2010 ▶).
Supplementary Material
Crystal structure: contains datablocks global, I. DOI: 10.1107/S1600536811014401/xu5194sup1.cif
Structure factors: contains datablocks I. DOI: 10.1107/S1600536811014401/xu5194Isup2.hkl
Additional supplementary materials: crystallographic information; 3D view; checkCIF report
Table 1. Selected bond lengths (Å).
| Cu1—O1 | 1.9432 (19) |
| Cu1—O2 | 1.942 (2) |
| Cu1—O3 | 1.944 (2) |
| Cu1—O4 | 1.934 (2) |
| Cu1—N1 | 2.262 (2) |
Table 2. Hydrogen-bond geometry (Å, °).
| D—H⋯A | D—H | H⋯A | D⋯A | D—H⋯A |
|---|---|---|---|---|
| C1—H1⋯O5i | 0.93 | 2.49 | 3.358 (7) | 156 |
| C19—H19⋯O5ii | 0.93 | 2.56 | 3.338 (6) | 141 |
| C24—H24C⋯F1iii | 0.96 | 2.36 | 3.233 (13) | 151 |
Symmetry codes: (i)
; (ii)
; (iii)
.
Acknowledgments
We thank Baku State University and the University of Malaya for supporting this study.
supplementary crystallographic information
Comment
Square-planar bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato]copper is a Lewis acid that forms adducts with a number of N-heterocycles. The parent Lewis acid exists as a square-planar molecule; its crystal structure has been determined several times (Lecomte et al., 1988; Wang et al., 1996; Xu et al., 2010). For most adducts, the Cu atom exists in a six-coordinate geometry, e.g., the pyridine adduct (Liu et al., 1986). The 4,4'-bipyridine adduct exists in two forms; in one form, the Cu atom is octahedrally coordinated (Gou et al., 1991). The other is a dinuclear adduct in which the Cu atom shows the square-pyramidal coordination. In the title N,N-diethylbenzamide adduct (Scheme I), the Cu atom is similarly five-coordinate. The metal atom lies above the square plane defined by the O atoms of the two chelating anionic ligands in the direction of the axial occupant by 0.179 (1) Å.
Experimental
Bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato]copper was synthesized by using a literature procedure (Lecomte et al., 1988; Wang et al., 1996; Xu et al., 2010). A solution of theonyltrifluoroacetylacetone (0.44 g, 0.002 mol) in ethanol (50 ml) and N,N-diethylnicotinamide (0.18 g, 0.001 mol) was added to a solution of copper sulfate pentahydrate (0.25 g, 0.001 mol) dissolved in water (50 ml). The resulting green solution has heated for a hour and then set aside for a week. The solid was filtered and recrystallized from ethanol (80%, m.p. 515 K); yield 65%. CHN&S elemental analysis. Found: C 45.69, H 3.31, S 9.48, F 16.75%; calculated for C26H22N2O5CuF6S2: C 45.61, H 3.22, S 9.36, F 16.67%.
Refinement
Carbon-bound H-atoms were placed in calculated positions [C–H 0.93 to 0.97 Å; U(H) 1.2 to 1.5U(C)] and were included in the refinement in the riding model approximation.
One thienyl ring is disodered over two positions in a 69 (1): 31 ratio. The C–S distances were restrained to 1.70±0.01 Å and the C–C distances to 1.35±0.01 Å. The disordered rings were restrained to be nearly flat. The anisotropic temperature factors of S2 was set to those of C11', those of C9 to those of C10', those of C10 to that of C9' and those of C11 to those of S2'. The anisotropic temperature factors were restrained to be nearly isotropic.
The C–C distances of the ethyl chains were tightly restrained to 1.540±0.005 Å.
The anisotropic temperature factors of the fluorine atoms were also restrained to be nearly isotropic.
Figures
Fig. 1.
Thermal ellipsoid plot (Barbour, 2001) of Cu(C10H14N2O)(C8H4F3O2S)2 at the 50% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. The disorder is not shown.
Crystal data
| [Cu(C8H4F3O2S)2(C10H14N2O)] | Z = 2 |
| Mr = 684.12 | F(000) = 694 |
| Triclinic, P1 | Dx = 1.522 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 11.4324 (5) Å | Cell parameters from 5935 reflections |
| b = 12.8606 (5) Å | θ = 2.4–27.9° |
| c = 13.0104 (5) Å | µ = 0.95 mm−1 |
| α = 62.837 (1)° | T = 293 K |
| β = 64.110 (1)° | Prism, green |
| γ = 88.783 (1)° | 0.30 × 0.30 × 0.30 mm |
| V = 1492.72 (10) Å3 |
Data collection
| Bruker APEXII diffractometer | 6849 independent reflections |
| Radiation source: fine-focus sealed tube | 5423 reflections with I > 2σ(I) |
| graphite | Rint = 0.021 |
| φ and ω scans | θmax = 27.5°, θmin = 1.8° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −14→14 |
| Tmin = 0.618, Tmax = 0.746 | k = −16→16 |
| 16434 measured reflections | l = −16→16 |
Refinement
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.048 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.152 | H-atom parameters constrained |
| S = 1.05 | w = 1/[σ2(Fo2) + (0.0881P)2 + 0.5656P] where P = (Fo2 + 2Fc2)/3 |
| 6849 reflections | (Δ/σ)max = 0.001 |
| 392 parameters | Δρmax = 0.80 e Å−3 |
| 80 restraints | Δρmin = −0.48 e Å−3 |
Fractional atomic coordinates and isotropic or equivalent isotropic displacement parameters (Å2)
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Cu1 | 0.30419 (3) | 0.56562 (3) | 0.41193 (3) | 0.04574 (14) | |
| S1 | 0.54183 (10) | 0.72016 (9) | 0.54939 (11) | 0.0756 (3) | |
| S2 | 0.6254 (2) | 0.8905 (2) | −0.13505 (17) | 0.1145 (10) | 0.690 (4) |
| S2' | 0.6483 (8) | 0.9072 (7) | 0.0696 (9) | 0.1087 (19) | 0.310 (4) |
| F1 | 0.0837 (4) | 0.2134 (3) | 0.8976 (3) | 0.1525 (16) | |
| F2 | 0.1339 (5) | 0.1709 (2) | 0.7503 (4) | 0.176 (2) | |
| F3 | −0.0184 (3) | 0.2524 (3) | 0.7936 (4) | 0.1409 (14) | |
| F4 | 0.2363 (3) | 0.4454 (3) | 0.1471 (4) | 0.1172 (10) | |
| F5 | 0.0665 (2) | 0.5072 (3) | 0.2318 (2) | 0.0937 (8) | |
| F6 | 0.2142 (3) | 0.6186 (3) | 0.0325 (2) | 0.1167 (11) | |
| O1 | 0.39754 (19) | 0.59008 (18) | 0.4959 (2) | 0.0488 (4) | |
| O2 | 0.1956 (2) | 0.41288 (18) | 0.5671 (2) | 0.0517 (5) | |
| O3 | 0.4426 (2) | 0.69749 (19) | 0.2487 (2) | 0.0571 (5) | |
| O4 | 0.2310 (2) | 0.5291 (2) | 0.3203 (2) | 0.0563 (5) | |
| O5 | 0.2239 (4) | 1.0114 (2) | 0.4841 (4) | 0.0956 (10) | |
| N1 | 0.1673 (2) | 0.6845 (2) | 0.4613 (2) | 0.0492 (5) | |
| N2 | 0.1538 (5) | 0.8623 (4) | 0.6909 (4) | 0.1059 (14) | |
| C1 | 0.5746 (4) | 0.7210 (4) | 0.6636 (5) | 0.0816 (12) | |
| H1 | 0.6319 | 0.7840 | 0.6463 | 0.098* | |
| C2 | 0.5103 (4) | 0.6226 (4) | 0.7807 (5) | 0.0777 (11) | |
| H2 | 0.5200 | 0.6105 | 0.8524 | 0.093* | |
| C3 | 0.4245 (3) | 0.5360 (3) | 0.7883 (4) | 0.0575 (8) | |
| H3 | 0.3709 | 0.4635 | 0.8628 | 0.069* | |
| C4 | 0.4369 (3) | 0.5821 (3) | 0.6599 (3) | 0.0504 (6) | |
| C5 | 0.3676 (3) | 0.5306 (3) | 0.6161 (3) | 0.0451 (6) | |
| C6 | 0.2716 (3) | 0.4211 (3) | 0.7077 (3) | 0.0548 (7) | |
| H6 | 0.2583 | 0.3806 | 0.7935 | 0.066* | |
| C7 | 0.1978 (3) | 0.3724 (3) | 0.6751 (3) | 0.0490 (6) | |
| C8 | 0.1005 (4) | 0.2514 (3) | 0.7805 (3) | 0.0661 (9) | |
| C9 | 0.7529 (7) | 0.9912 (6) | −0.1766 (11) | 0.122 (3) | 0.690 (4) |
| H9 | 0.8160 | 1.0435 | −0.2634 | 0.147* | 0.690 (4) |
| C10 | 0.7554 (10) | 0.9894 (8) | −0.0739 (10) | 0.122 (3) | 0.690 (4) |
| H10 | 0.8190 | 1.0391 | −0.0801 | 0.146* | 0.690 (4) |
| C11 | 0.6508 (12) | 0.9040 (9) | 0.0415 (15) | 0.1087 (19) | 0.690 (4) |
| H11 | 0.6366 | 0.8905 | 0.1230 | 0.130* | 0.690 (4) |
| C9' | 0.734 (2) | 1.0246 (18) | −0.0845 (17) | 0.122 (3) | 0.31 |
| H9' | 0.7950 | 1.0882 | −0.1074 | 0.146* | 0.310 (4) |
| C10' | 0.7052 (18) | 1.0171 (19) | −0.170 (3) | 0.122 (3) | 0.31 |
| H10' | 0.7414 | 1.0720 | −0.2599 | 0.147* | 0.310 (4) |
| C11' | 0.6135 (16) | 0.9143 (16) | −0.1017 (10) | 0.1145 (10) | 0.31 |
| H11' | 0.5798 | 0.8933 | −0.1447 | 0.137* | 0.310 (4) |
| C12 | 0.5686 (4) | 0.8400 (3) | 0.0299 (4) | 0.0743 (10) | |
| C13 | 0.4566 (3) | 0.7379 (3) | 0.1354 (3) | 0.0562 (7) | |
| C14 | 0.3739 (4) | 0.6899 (3) | 0.1052 (3) | 0.0648 (9) | |
| H14 | 0.3900 | 0.7269 | 0.0185 | 0.078* | |
| C15 | 0.2713 (3) | 0.5912 (3) | 0.1982 (3) | 0.0556 (7) | |
| C16 | 0.1958 (4) | 0.5407 (4) | 0.1521 (3) | 0.0730 (10) | |
| C17 | 0.0474 (3) | 0.6793 (3) | 0.4681 (3) | 0.0534 (7) | |
| H17 | 0.0212 | 0.6284 | 0.4456 | 0.064* | |
| C18 | −0.0389 (3) | 0.7461 (3) | 0.5069 (4) | 0.0635 (8) | |
| H18 | −0.1210 | 0.7415 | 0.5089 | 0.076* | |
| C19 | −0.0020 (3) | 0.8193 (3) | 0.5426 (3) | 0.0612 (8) | |
| H19 | −0.0591 | 0.8649 | 0.5697 | 0.073* | |
| C20 | 0.1210 (3) | 0.8250 (3) | 0.5380 (3) | 0.0523 (7) | |
| C21 | 0.2024 (3) | 0.7576 (3) | 0.4951 (3) | 0.0523 (7) | |
| H21 | 0.2863 | 0.7629 | 0.4894 | 0.063* | |
| C22 | 0.1703 (4) | 0.9079 (3) | 0.5698 (4) | 0.0650 (9) | |
| C23 | 0.0985 (10) | 0.7336 (7) | 0.7935 (6) | 0.176 (4) | |
| H23A | 0.1451 | 0.7088 | 0.8449 | 0.211* | |
| H23B | 0.1097 | 0.6845 | 0.7526 | 0.211* | |
| C24 | −0.0489 (10) | 0.7181 (11) | 0.8820 (10) | 0.280 (9) | |
| H24A | −0.0870 | 0.6352 | 0.9483 | 0.419* | |
| H24B | −0.0939 | 0.7437 | 0.8301 | 0.419* | |
| H24C | −0.0589 | 0.7656 | 0.9235 | 0.419* | |
| C25 | 0.1991 (7) | 0.9431 (6) | 0.7257 (7) | 0.129 (2) | |
| H25A | 0.1360 | 0.9222 | 0.8154 | 0.154* | |
| H25B | 0.2010 | 1.0251 | 0.6680 | 0.154* | |
| C26 | 0.3380 (8) | 0.9343 (6) | 0.7135 (8) | 0.159 (3) | |
| H26A | 0.3657 | 0.9904 | 0.7325 | 0.238* | |
| H26B | 0.4002 | 0.9527 | 0.6255 | 0.238* | |
| H26C | 0.3351 | 0.8545 | 0.7748 | 0.238* |
Atomic displacement parameters (Å2)
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cu1 | 0.0466 (2) | 0.0444 (2) | 0.0387 (2) | −0.00173 (14) | −0.01578 (15) | −0.01905 (15) |
| S1 | 0.0621 (5) | 0.0736 (6) | 0.0836 (7) | −0.0044 (4) | −0.0266 (5) | −0.0406 (5) |
| S2 | 0.1000 (14) | 0.1279 (17) | 0.0473 (9) | −0.0235 (11) | −0.0234 (9) | −0.0022 (9) |
| S2' | 0.097 (2) | 0.0894 (19) | 0.091 (4) | −0.0344 (15) | −0.034 (2) | −0.0166 (19) |
| F1 | 0.195 (3) | 0.123 (2) | 0.0635 (16) | −0.084 (2) | −0.056 (2) | 0.0088 (16) |
| F2 | 0.219 (4) | 0.0509 (15) | 0.139 (3) | −0.0227 (19) | 0.008 (3) | −0.0456 (17) |
| F3 | 0.0871 (19) | 0.100 (2) | 0.145 (3) | −0.0385 (16) | −0.046 (2) | −0.0009 (19) |
| F4 | 0.131 (2) | 0.138 (2) | 0.165 (3) | 0.042 (2) | −0.093 (2) | −0.116 (2) |
| F5 | 0.0675 (14) | 0.127 (2) | 0.0798 (15) | −0.0058 (13) | −0.0363 (12) | −0.0444 (15) |
| F6 | 0.117 (2) | 0.148 (3) | 0.0627 (14) | −0.0227 (18) | −0.0517 (15) | −0.0253 (15) |
| O1 | 0.0455 (10) | 0.0478 (10) | 0.0471 (11) | 0.0010 (8) | −0.0206 (9) | −0.0203 (9) |
| O2 | 0.0570 (12) | 0.0456 (10) | 0.0452 (11) | −0.0042 (9) | −0.0225 (9) | −0.0186 (9) |
| O3 | 0.0571 (12) | 0.0524 (11) | 0.0442 (11) | −0.0072 (9) | −0.0162 (10) | −0.0178 (9) |
| O4 | 0.0608 (12) | 0.0578 (12) | 0.0423 (11) | −0.0058 (10) | −0.0194 (10) | −0.0234 (10) |
| O5 | 0.123 (3) | 0.0534 (15) | 0.117 (3) | 0.0057 (16) | −0.073 (2) | −0.0324 (16) |
| N1 | 0.0512 (13) | 0.0482 (13) | 0.0499 (13) | 0.0069 (10) | −0.0247 (11) | −0.0251 (11) |
| N2 | 0.172 (4) | 0.076 (2) | 0.086 (3) | 0.004 (2) | −0.062 (3) | −0.051 (2) |
| C1 | 0.061 (2) | 0.093 (3) | 0.120 (4) | 0.013 (2) | −0.044 (2) | −0.074 (3) |
| C2 | 0.077 (3) | 0.098 (3) | 0.094 (3) | 0.021 (2) | −0.054 (2) | −0.063 (3) |
| C3 | 0.0663 (19) | 0.0606 (18) | 0.071 (2) | 0.0141 (15) | −0.0448 (17) | −0.0397 (16) |
| C4 | 0.0415 (14) | 0.0540 (16) | 0.0604 (17) | 0.0091 (12) | −0.0245 (13) | −0.0317 (14) |
| C5 | 0.0410 (14) | 0.0476 (14) | 0.0485 (15) | 0.0098 (11) | −0.0203 (12) | −0.0262 (12) |
| C6 | 0.0559 (17) | 0.0551 (17) | 0.0452 (15) | −0.0030 (13) | −0.0221 (14) | −0.0203 (13) |
| C7 | 0.0496 (15) | 0.0436 (14) | 0.0449 (15) | 0.0010 (12) | −0.0174 (13) | −0.0200 (12) |
| C8 | 0.075 (2) | 0.0557 (18) | 0.0492 (17) | −0.0144 (16) | −0.0257 (16) | −0.0150 (15) |
| C9 | 0.078 (6) | 0.105 (5) | 0.082 (4) | −0.013 (4) | −0.024 (5) | 0.017 (4) |
| C10 | 0.090 (4) | 0.079 (6) | 0.121 (5) | −0.026 (4) | −0.046 (4) | 0.004 (4) |
| C11 | 0.097 (2) | 0.0894 (19) | 0.091 (4) | −0.0344 (15) | −0.034 (2) | −0.0166 (19) |
| C9' | 0.090 (4) | 0.079 (6) | 0.121 (5) | −0.026 (4) | −0.046 (4) | 0.004 (4) |
| C10' | 0.078 (6) | 0.105 (5) | 0.082 (4) | −0.013 (4) | −0.024 (5) | 0.017 (4) |
| C11' | 0.1000 (14) | 0.1279 (17) | 0.0473 (9) | −0.0235 (11) | −0.0234 (9) | −0.0022 (9) |
| C12 | 0.067 (2) | 0.064 (2) | 0.0507 (19) | −0.0076 (17) | −0.0194 (17) | −0.0047 (16) |
| C13 | 0.0550 (17) | 0.0488 (16) | 0.0433 (15) | 0.0010 (13) | −0.0152 (13) | −0.0144 (13) |
| C14 | 0.069 (2) | 0.064 (2) | 0.0433 (16) | −0.0022 (16) | −0.0234 (15) | −0.0156 (15) |
| C15 | 0.0583 (18) | 0.0597 (18) | 0.0472 (16) | 0.0064 (14) | −0.0244 (14) | −0.0260 (14) |
| C16 | 0.074 (2) | 0.088 (3) | 0.057 (2) | 0.002 (2) | −0.0340 (19) | −0.0326 (19) |
| C17 | 0.0526 (16) | 0.0541 (16) | 0.0524 (16) | 0.0036 (13) | −0.0256 (14) | −0.0249 (14) |
| C18 | 0.0512 (18) | 0.068 (2) | 0.069 (2) | 0.0117 (15) | −0.0291 (16) | −0.0324 (18) |
| C19 | 0.0613 (19) | 0.0570 (18) | 0.0599 (19) | 0.0201 (15) | −0.0257 (16) | −0.0287 (16) |
| C20 | 0.0638 (18) | 0.0424 (14) | 0.0487 (16) | 0.0109 (13) | −0.0266 (14) | −0.0214 (13) |
| C21 | 0.0568 (17) | 0.0479 (15) | 0.0616 (18) | 0.0118 (13) | −0.0347 (15) | −0.0284 (14) |
| C22 | 0.081 (2) | 0.0492 (18) | 0.083 (2) | 0.0232 (17) | −0.047 (2) | −0.0395 (18) |
| C23 | 0.298 (12) | 0.133 (5) | 0.088 (4) | −0.042 (6) | −0.093 (6) | −0.045 (4) |
| C24 | 0.330 (17) | 0.313 (16) | 0.147 (8) | −0.124 (13) | −0.039 (9) | −0.141 (10) |
| C25 | 0.192 (7) | 0.111 (4) | 0.128 (5) | 0.015 (4) | −0.081 (5) | −0.089 (4) |
| C26 | 0.222 (9) | 0.123 (5) | 0.202 (8) | 0.032 (6) | −0.136 (8) | −0.099 (6) |
Geometric parameters (Å, °)
| Cu1—O1 | 1.9432 (19) | C9—C10 | 1.339 (8) |
| Cu1—O2 | 1.942 (2) | C9—H9 | 0.9300 |
| Cu1—O3 | 1.944 (2) | C10—C11 | 1.369 (10) |
| Cu1—O4 | 1.934 (2) | C10—H10 | 0.9300 |
| Cu1—N1 | 2.262 (2) | C11—C12 | 1.361 (10) |
| S1—C1 | 1.688 (4) | C11—H11 | 0.9300 |
| S1—C4 | 1.707 (3) | C9'—C10' | 1.338 (11) |
| S2—C9 | 1.687 (8) | C9'—H9' | 0.9300 |
| S2—C12 | 1.725 (4) | C10'—C11' | 1.344 (11) |
| S2'—C12 | 1.641 (9) | C10'—H10' | 0.9300 |
| S2'—C9' | 1.686 (10) | C11'—C12 | 1.367 (10) |
| F1—C8 | 1.290 (4) | C11'—H11' | 0.9300 |
| F2—C8 | 1.264 (4) | C12—C13 | 1.463 (4) |
| F3—C8 | 1.295 (4) | C13—C14 | 1.414 (5) |
| F4—C16 | 1.321 (4) | C14—C15 | 1.369 (5) |
| F5—C16 | 1.315 (4) | C14—H14 | 0.9300 |
| F6—C16 | 1.331 (4) | C15—C16 | 1.535 (5) |
| O1—C5 | 1.265 (3) | C17—C18 | 1.376 (5) |
| O2—C7 | 1.268 (3) | C17—H17 | 0.9300 |
| O3—C13 | 1.252 (4) | C18—C19 | 1.365 (5) |
| O4—C15 | 1.262 (4) | C18—H18 | 0.9300 |
| O5—C22 | 1.214 (5) | C19—C20 | 1.383 (5) |
| N1—C17 | 1.335 (4) | C19—H19 | 0.9300 |
| N1—C21 | 1.337 (4) | C20—C21 | 1.373 (4) |
| N2—C22 | 1.329 (5) | C20—C22 | 1.502 (4) |
| N2—C23 | 1.487 (8) | C21—H21 | 0.9300 |
| N2—C25 | 1.487 (5) | C23—C24 | 1.522 (5) |
| C1—C2 | 1.328 (6) | C23—H23A | 0.9700 |
| C1—H1 | 0.9300 | C23—H23B | 0.9700 |
| C2—C3 | 1.440 (5) | C24—H24A | 0.9600 |
| C2—H2 | 0.9300 | C24—H24B | 0.9600 |
| C3—C4 | 1.433 (5) | C24—H24C | 0.9600 |
| C3—H3 | 0.9300 | C25—C26 | 1.532 (5) |
| C4—C5 | 1.467 (4) | C25—H25A | 0.9700 |
| C5—C6 | 1.414 (4) | C25—H25B | 0.9700 |
| C6—C7 | 1.365 (4) | C26—H26A | 0.9600 |
| C6—H6 | 0.9300 | C26—H26B | 0.9600 |
| C7—C8 | 1.527 (4) | C26—H26C | 0.9600 |
| O4—Cu1—O1 | 171.65 (9) | C10'—C11'—H11' | 119.2 |
| O4—Cu1—O2 | 87.74 (9) | C12—C11'—H11' | 119.2 |
| O1—Cu1—O2 | 92.01 (8) | C11—C12—C13 | 127.8 (7) |
| O4—Cu1—O3 | 92.32 (9) | C11'—C12—C13 | 134.9 (10) |
| O1—Cu1—O3 | 86.06 (9) | C11'—C12—S2' | 105.0 (10) |
| O2—Cu1—O3 | 167.13 (10) | C13—C12—S2' | 118.7 (4) |
| O4—Cu1—N1 | 97.55 (9) | C11—C12—S2 | 108.8 (7) |
| O1—Cu1—N1 | 90.74 (8) | C13—C12—S2 | 123.2 (3) |
| O2—Cu1—N1 | 98.28 (9) | S2'—C12—S2 | 118.1 (4) |
| O3—Cu1—N1 | 94.47 (9) | O3—C13—C14 | 124.4 (3) |
| C1—S1—C4 | 91.7 (2) | O3—C13—C12 | 115.9 (3) |
| C9—S2—C12 | 90.7 (4) | C14—C13—C12 | 119.8 (3) |
| C12—S2'—C9' | 94.1 (12) | C15—C14—C13 | 122.7 (3) |
| C5—O1—Cu1 | 127.36 (18) | C15—C14—H14 | 118.6 |
| C7—O2—Cu1 | 123.57 (18) | C13—C14—H14 | 118.6 |
| C13—O3—Cu1 | 127.3 (2) | O4—C15—C14 | 129.2 (3) |
| C15—O4—Cu1 | 123.9 (2) | O4—C15—C16 | 112.7 (3) |
| C17—N1—C21 | 117.6 (3) | C14—C15—C16 | 118.1 (3) |
| C17—N1—Cu1 | 123.2 (2) | F5—C16—F4 | 106.9 (3) |
| C21—N1—Cu1 | 119.0 (2) | F5—C16—F6 | 106.9 (3) |
| C22—N2—C23 | 124.4 (4) | F4—C16—F6 | 106.7 (3) |
| C22—N2—C25 | 118.5 (4) | F5—C16—C15 | 112.5 (3) |
| C23—N2—C25 | 117.1 (4) | F4—C16—C15 | 110.5 (3) |
| C2—C1—S1 | 113.3 (3) | F6—C16—C15 | 113.1 (3) |
| C2—C1—H1 | 123.4 | N1—C17—C18 | 122.8 (3) |
| S1—C1—H1 | 123.4 | N1—C17—H17 | 118.6 |
| C1—C2—C3 | 115.0 (4) | C18—C17—H17 | 118.6 |
| C1—C2—H2 | 122.5 | C19—C18—C17 | 118.9 (3) |
| C3—C2—H2 | 122.5 | C19—C18—H18 | 120.6 |
| C4—C3—C2 | 107.4 (3) | C17—C18—H18 | 120.6 |
| C4—C3—H3 | 126.3 | C18—C19—C20 | 119.4 (3) |
| C2—C3—H3 | 126.3 | C18—C19—H19 | 120.3 |
| C3—C4—C5 | 129.2 (3) | C20—C19—H19 | 120.3 |
| C3—C4—S1 | 112.5 (2) | C21—C20—C19 | 118.1 (3) |
| C5—C4—S1 | 118.2 (2) | C21—C20—C22 | 119.8 (3) |
| O1—C5—C6 | 123.8 (3) | C19—C20—C22 | 122.1 (3) |
| O1—C5—C4 | 116.4 (3) | N1—C21—C20 | 123.3 (3) |
| C6—C5—C4 | 119.7 (3) | N1—C21—H21 | 118.4 |
| C7—C6—C5 | 122.5 (3) | C20—C21—H21 | 118.4 |
| C7—C6—H6 | 118.7 | O5—C22—N2 | 123.7 (4) |
| C5—C6—H6 | 118.7 | O5—C22—C20 | 118.8 (3) |
| O2—C7—C6 | 129.7 (3) | N2—C22—C20 | 117.4 (3) |
| O2—C7—C8 | 112.2 (2) | N2—C23—C24 | 108.1 (8) |
| C6—C7—C8 | 118.1 (3) | N2—C23—H23A | 110.1 |
| F2—C8—F3 | 103.8 (4) | C24—C23—H23A | 110.1 |
| F2—C8—F1 | 108.3 (4) | N2—C23—H23B | 110.1 |
| F3—C8—F1 | 104.5 (4) | C24—C23—H23B | 110.1 |
| F2—C8—C7 | 111.5 (3) | H23A—C23—H23B | 108.4 |
| F3—C8—C7 | 112.6 (3) | C23—C24—H24A | 109.5 |
| F1—C8—C7 | 115.2 (3) | C23—C24—H24B | 109.5 |
| C10—C9—S2 | 114.3 (8) | H24A—C24—H24B | 109.5 |
| C10—C9—H9 | 122.8 | C23—C24—H24C | 109.5 |
| S2—C9—H9 | 122.8 | H24A—C24—H24C | 109.5 |
| C9—C10—C11 | 110.2 (12) | H24B—C24—H24C | 109.5 |
| C9—C10—H10 | 124.9 | N2—C25—C26 | 111.8 (5) |
| C11—C10—H10 | 124.9 | N2—C25—H25A | 109.3 |
| C12—C11—C10 | 116.1 (12) | C26—C25—H25A | 109.3 |
| C12—C11—H11 | 122.0 | N2—C25—H25B | 109.3 |
| C10—C11—H11 | 122.0 | C26—C25—H25B | 109.3 |
| C10'—C9'—S2' | 113 (2) | H25A—C25—H25B | 107.9 |
| C10'—C9'—H9' | 123.4 | C25—C26—H26A | 109.5 |
| S2'—C9'—H9' | 123.4 | C25—C26—H26B | 109.5 |
| C9'—C10'—C11' | 106 (2) | H26A—C26—H26B | 109.5 |
| C9'—C10'—H10' | 126.9 | C25—C26—H26C | 109.5 |
| C11'—C10'—H10' | 126.9 | H26A—C26—H26C | 109.5 |
| C10'—C11'—C12 | 122 (2) | H26B—C26—H26C | 109.5 |
| O2—Cu1—O1—C5 | −11.0 (2) | C10'—C11'—C12—C11 | −3.7 (9) |
| O3—Cu1—O1—C5 | −178.3 (2) | C10'—C11'—C12—C13 | 166.2 (9) |
| N1—Cu1—O1—C5 | 87.3 (2) | C10'—C11'—C12—S2' | 0.7 (6) |
| O4—Cu1—O2—C7 | 177.2 (2) | C10'—C11'—C12—S2 | −137 (3) |
| O1—Cu1—O2—C7 | 5.6 (2) | C9'—S2'—C12—C11 | 27 (4) |
| O3—Cu1—O2—C7 | 86.7 (4) | C9'—S2'—C12—C11' | −0.4 (4) |
| N1—Cu1—O2—C7 | −85.5 (2) | C9'—S2'—C12—C13 | −168.8 (7) |
| O4—Cu1—O3—C13 | 5.1 (3) | C9'—S2'—C12—S2 | 13.4 (6) |
| O1—Cu1—O3—C13 | 176.9 (3) | C9—S2—C12—C11 | 0.3 (4) |
| O2—Cu1—O3—C13 | 95.1 (5) | C9—S2—C12—C11' | 50 (2) |
| N1—Cu1—O3—C13 | −92.7 (3) | C9—S2—C12—C13 | −175.1 (4) |
| O2—Cu1—O4—C15 | −172.3 (3) | C9—S2—C12—S2' | 2.6 (5) |
| O3—Cu1—O4—C15 | −5.2 (3) | Cu1—O3—C13—C14 | −2.5 (5) |
| N1—Cu1—O4—C15 | 89.6 (3) | Cu1—O3—C13—C12 | 178.7 (2) |
| O4—Cu1—N1—C17 | 23.0 (2) | C11—C12—C13—O3 | −7.5 (6) |
| O1—Cu1—N1—C17 | −158.0 (2) | C11'—C12—C13—O3 | −174.7 (9) |
| O2—Cu1—N1—C17 | −65.8 (2) | S2'—C12—C13—O3 | −10.7 (6) |
| O3—Cu1—N1—C17 | 115.9 (2) | S2—C12—C13—O3 | 167.0 (3) |
| O4—Cu1—N1—C21 | −162.3 (2) | C11—C12—C13—C14 | 173.7 (5) |
| O1—Cu1—N1—C21 | 16.8 (2) | C11'—C12—C13—C14 | 6.5 (10) |
| O2—Cu1—N1—C21 | 108.9 (2) | S2'—C12—C13—C14 | 170.5 (5) |
| O3—Cu1—N1—C21 | −69.3 (2) | S2—C12—C13—C14 | −11.8 (5) |
| C4—S1—C1—C2 | −0.1 (3) | O3—C13—C14—C15 | −1.8 (6) |
| S1—C1—C2—C3 | −0.9 (5) | C12—C13—C14—C15 | 176.9 (4) |
| C1—C2—C3—C4 | 1.6 (5) | Cu1—O4—C15—C14 | 3.2 (5) |
| C2—C3—C4—C5 | −177.9 (3) | Cu1—O4—C15—C16 | 179.6 (2) |
| C2—C3—C4—S1 | −1.6 (4) | C13—C14—C15—O4 | 1.4 (6) |
| C1—S1—C4—C3 | 1.0 (3) | C13—C14—C15—C16 | −174.9 (3) |
| C1—S1—C4—C5 | 177.7 (3) | O4—C15—C16—F5 | 43.8 (4) |
| Cu1—O1—C5—C6 | 11.2 (4) | C14—C15—C16—F5 | −139.3 (4) |
| Cu1—O1—C5—C4 | −167.59 (18) | O4—C15—C16—F4 | −75.6 (4) |
| C3—C4—C5—O1 | −179.8 (3) | C14—C15—C16—F4 | 101.3 (4) |
| S1—C4—C5—O1 | 4.1 (4) | O4—C15—C16—F6 | 165.0 (3) |
| C3—C4—C5—C6 | 1.3 (5) | C14—C15—C16—F6 | −18.1 (5) |
| S1—C4—C5—C6 | −174.7 (2) | C21—N1—C17—C18 | 0.6 (5) |
| O1—C5—C6—C7 | −3.1 (5) | Cu1—N1—C17—C18 | 175.4 (2) |
| C4—C5—C6—C7 | 175.7 (3) | N1—C17—C18—C19 | −1.3 (5) |
| Cu1—O2—C7—C6 | −0.4 (5) | C17—C18—C19—C20 | 0.4 (5) |
| Cu1—O2—C7—C8 | 179.1 (2) | C18—C19—C20—C21 | 1.1 (5) |
| C5—C6—C7—O2 | −2.7 (5) | C18—C19—C20—C22 | 177.1 (3) |
| C5—C6—C7—C8 | 177.8 (3) | C17—N1—C21—C20 | 1.1 (5) |
| O2—C7—C8—F2 | 65.6 (5) | Cu1—N1—C21—C20 | −174.0 (2) |
| C6—C7—C8—F2 | −114.9 (4) | C19—C20—C21—N1 | −1.9 (5) |
| O2—C7—C8—F3 | −50.6 (4) | C22—C20—C21—N1 | −178.0 (3) |
| C6—C7—C8—F3 | 128.9 (4) | C23—N2—C22—O5 | −174.8 (6) |
| O2—C7—C8—F1 | −170.4 (4) | C25—N2—C22—O5 | 2.2 (7) |
| C6—C7—C8—F1 | 9.1 (5) | C23—N2—C22—C20 | 4.3 (8) |
| C12—S2—C9—C10 | −0.12 (18) | C25—N2—C22—C20 | −178.7 (5) |
| S2—C9—C10—C11 | −0.1 (2) | C21—C20—C22—O5 | 92.2 (4) |
| C9—C10—C11—C12 | 0.3 (5) | C19—C20—C22—O5 | −83.7 (5) |
| C12—S2'—C9'—C10' | 0.14 (19) | C21—C20—C22—N2 | −86.9 (5) |
| S2'—C9'—C10'—C11' | 0.2 (2) | C19—C20—C22—N2 | 97.2 (5) |
| C9'—C10'—C11'—C12 | −0.6 (5) | C22—N2—C23—C24 | −97.6 (7) |
| C10—C11—C12—C11' | −14.3 (9) | C25—N2—C23—C24 | 85.4 (7) |
| C10—C11—C12—C13 | 174.7 (5) | C22—N2—C25—C26 | −97.1 (7) |
| C10—C11—C12—S2' | −168 (4) | C23—N2—C25—C26 | 80.1 (8) |
| C10—C11—C12—S2 | −0.4 (6) |
Hydrogen-bond geometry (Å, °)
| D—H···A | D—H | H···A | D···A | D—H···A |
| C1—H1···O5i | 0.93 | 2.49 | 3.358 (7) | 156 |
| C19—H19···O5ii | 0.93 | 2.56 | 3.338 (6) | 141 |
| C24—H24C···F1iii | 0.96 | 2.36 | 3.233 (13) | 151 |
Symmetry codes: (i) −x+1, −y+2, −z+1; (ii) −x, −y+2, −z+1; (iii) −x, −y+1, −z+2.
Footnotes
Supplementary data and figures for this paper are available from the IUCr electronic archives (Reference: XU5194).
References
- Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191.
- Bruker (2005). APEX2 and SAINT Bruker AXS Inc., Madison, Wisconsin, USA.
- Gou, S.-H., You, X.-Z., Xu, Z., Zhou, Z.-Y., Yu, K.-B., Yu, Y.-P. & Zhu, D.-L. (1991). Acta Cryst. C47, 1303–1305.
- Lecomte, C., Bayeul, D., Senglet, N. & Guilard, R. (1988). Polyhedron, 7, 303–306.
- Li, M.-X., Xu, Z., You, X.-Z. & Chen, C.-G. (1994). Acta Cryst. C50, 1699–1701.
- Liu, X.-S., Lin, C.-C., Xu, Z., Yu, Y.-P. & You, X.-Z. (1986). Chin. J. Struct. Chem. 5, 135–138.
- Sheldrick, G. M. (1996). SADABS University of Göttingen, Germany.
- Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. [DOI] [PubMed]
- Wang, D.-M., Yang, R.-N., Hu, Y.-M. & Jin, D.-M. (1996). Chin. J. Struct. Chem. 15, 3327–3329.
- Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925.
- Xu, D.-F., Shen, Z.-H., Shi, Y., He, Q. & Xia, Q.-C. (2010). Russ. J. Coord. Chem. 36, 458–462.
- Yu, Y.-P., Xu, Z., You, X.-Z., Lu, J.-N., Shi, S., Liu, S.-X. & Lin, C.-C. (1988). Chin. J. Inorg. Chem. 4, 30–34.
Associated Data
This section collects any data citations, data availability statements, or supplementary materials included in this article.
Supplementary Materials
Crystal structure: contains datablocks global, I. DOI: 10.1107/S1600536811014401/xu5194sup1.cif
Structure factors: contains datablocks I. DOI: 10.1107/S1600536811014401/xu5194Isup2.hkl
Additional supplementary materials: crystallographic information; 3D view; checkCIF report

