Abstract
The polymeric title compound, {[Ba2(C9H4N2O4)2(H2O)]·4.5H2O}n, adopts a layer structure parallel to (001) in which adjacent BaII atoms are connected by two benzimidazole-5,6-dicarboxylate dianions, one functioning in a μ4-bridging mode and the other in a μ5-bridging mode. The Ba atom having water in its coordination environment as well as the Ba atom without water exist in a nine-coordinate polyhedron of O atoms; the geometry is difficult to derive. Lattice water molecules occupy the space between layers and interact with the layers through O—H⋯O, O—H⋯N and N—H⋯O hydrogen bonds. ne of the five lattice water molecules is equally disordered around an inversion centre and shows half-occupancy.
Related literature
For the strontium 1H-benzimidazole-5,6-dicarboxylate derivative, see: Song et al. (2009 ▶).
Experimental
Crystal data
[Ba2(C9H4N2O4)2(H2O)]·4.5H2O
M r = 782.05
Triclinic,
a = 6.9331 (4) Å
b = 9.5950 (4) Å
c = 18.0179 (7) Å
α = 103.186 (1)°
β = 92.068 (2)°
γ = 93.032 (2)°
V = 1163.94 (9) Å3
Z = 2
Mo Kα radiation
μ = 3.44 mm−1
T = 293 K
0.33 × 0.24 × 0.21 mm
Data collection
Rigaku R-AXIS RAPID diffractometer
Absorption correction: multi-scan (ABSCOR; Higashi, 1995 ▶) T min = 0.396, T max = 0.532
11398 measured reflections
5246 independent reflections
4749 reflections with I > 2σ(I)
R int = 0.025
Refinement
R[F 2 > 2σ(F 2)] = 0.028
wR(F 2) = 0.074
S = 1.07
5246 reflections
343 parameters
30 restraints
H-atom parameters constrained
Δρmax = 1.54 e Å−3
Δρmin = −0.68 e Å−3
Data collection: RAPID-AUTO (Rigaku Corporation, 1998 ▶); cell refinement: RAPID-AUTO; data reduction: CrystalStructure (Rigaku/MSC, 2002 ▶); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008 ▶); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008 ▶); molecular graphics: X-SEED (Barbour, 2001 ▶); software used to prepare material for publication: publCIF (Westrip, 2010 ▶).
Supplementary Material
Crystal structure: contains datablocks global, I. DOI: 10.1107/S160053681101590X/jh2280sup1.cif
Structure factors: contains datablocks I. DOI: 10.1107/S160053681101590X/jh2280Isup2.hkl
Additional supplementary materials: crystallographic information; 3D view; checkCIF report
Table 1. Hydrogen-bond geometry (Å, °).
| D—H⋯A | D—H | H⋯A | D⋯A | D—H⋯A |
|---|---|---|---|---|
| O1w—H11⋯O4wi | 0.84 | 1.66 | 2.49 (1) | 170 |
| O1w—H12⋯O2wii | 0.84 | 1.88 | 2.60 (1) | 143 |
| O2w—H21⋯N2 | 0.84 | 2.00 | 2.83 (1) | 168 |
| O2w—H22⋯N2iii | 0.84 | 2.28 | 2.83 (1) | 124 |
| O3w—H31⋯N3 | 0.84 | 2.34 | 2.95 (1) | 129 |
| O3w—H32⋯O6wiv | 0.84 | 1.85 | 2.68 (1) | 174 |
| O4w—H41⋯O3wv | 0.84 | 2.03 | 2.84 (2) | 161 |
| O5w—H51⋯O1wv | 0.84 | 2.31 | 2.75 (1) | 113 |
| O6w—H61⋯O4vi | 0.84 | 1.99 | 2.76 (1) | 152 |
| O6w—H62⋯O8 | 0.84 | 2.09 | 2.86 (1) | 152 |
| N1—H1⋯O1w | 0.88 | 1.93 | 2.80 (1) | 168 |
| N4—H4⋯O4w | 0.88 | 1.99 | 2.86 (1) | 167 |
Symmetry codes: (i)
; (ii)
; (iii)
; (iv)
; (v)
; (vi)
.
Acknowledgments
We thank the Scientific Research Foundation of the Education Department of Heilongjiang Province (No. 11544005), the Scientific Research Innovation Foundation for young teachers of Zhoukou Normal University (No. zknuqn201044B) and the University of Malaya for supporting this study.
supplementary crystallographic information
Comment
The 1H-benzimidazole-5,6-dicarboxylate dianion affords a large number of metal salts; most of the crystal structure studies involve rare earth metals. The crystal structures of only few main group derivatives have been reported. The SrII derivative exists as a monohydrate; the metal atom is also coordinated by two water ligands in an eight-coordinate square-antiprismatic geometry. The dianion functions in a \m4 bridging mode (Song et al., 2009). The BaII analog has 4.5 lattice water molecules (Scheme I). Polymeric Ba2(H2O)(C9H4NO4)2.4.5H2O adopts a layer structure in which adjacent BaII atoms are connected by two benzimidazole-5,6-dicarboxylate dianions, one functioning in a µ4 bridging mode and the other in a µ5 bridging mode. The Ba atom having water in its coordination environment as well as the Ba atom without water exist in a nine-coordinate polyhedron of O atom; the geometry is undefined. Lattice water molecules occupy the space between layers, and interact with the layers through O–H···O and N–H···O hydrogen bonds to generate a three-dimensional network (Table 1).
Experimental
Barium chloride (0.0416 g, 0.20 mmol) and 1H-benzimidazole-5,6-dicarboxylic acid (0.0412 g, 0.20 mmol) were placed in water (35 ml); the reactants dissolved upon addition of several drops of dilute sodium hydroxide to a pH of 7. The solution was set aside for the growth of crystals over several weeks; yield 60% based on Ba.
Refinement
Hydrogen atoms were placed in calculated positions (C–H 0.93 Å) and were included in the refinement in the riding model approximation, with U(H) set to 1.2Ueq(C). The amino and water H atoms were placed in chemically sensible positions on the basis of hydrogen bonding interactions (O–H 0.84 Å and N–H 0.88 Å); their temperature factors were tied by a factor of 1.2–1.5 times. Positioning the H atoms lead to H12···H21 and H31···H42 distances of about 2 Å, which are regarded as being acceptable. The O5w molecule then forms only one hydrogen bond. Positioning the second H atom elsewhere led to too short interactions.
On this basis, the N1 and N4 atoms are atoms having a hydrogen connected to them whereas the N2 and N3 atoms do not.
One of the water molecules (O5w) is disordered about a center-of-inversion.
The anisotropic temperature factors of the free water molecules were restrained to be nearly isotropic.
The final difference Fourier map had peaks in the vicinity of both Ba atoms.
Figures
Fig. 1.
Thermal ellipsoid plot (Barbour, 2001) of a portion of the layer structure of Ba2(H2O)(C9H4NO4)2.4.5H2O at the 50% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. Symmetry code: (i) -x, -y + 1, -z + 1; (ii) -x + 1, -y + 1, -z + 1; (iii) x, y + 1, z; (iv) x, y - 1, z; (v) -x + 1, -y, -z + 1; (vi) -x, -y, -z + 1.
Crystal data
| [Ba2(C9H4N2O4)2(H2O)]·4.5H2O | Z = 2 |
| Mr = 782.05 | F(000) = 750 |
| Triclinic, P1 | Dx = 2.231 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 6.9331 (4) Å | Cell parameters from 10107 reflections |
| b = 9.5950 (4) Å | θ = 3.1–27.5° |
| c = 18.0179 (7) Å | µ = 3.44 mm−1 |
| α = 103.186 (1)° | T = 293 K |
| β = 92.068 (2)° | Prism, colorless |
| γ = 93.032 (2)° | 0.33 × 0.24 × 0.21 mm |
| V = 1163.94 (9) Å3 |
Data collection
| Rigaku R-AXIS RAPID diffractometer | 5246 independent reflections |
| Radiation source: fine-focus sealed tube | 4749 reflections with I > 2σ(I) |
| graphite | Rint = 0.025 |
| Detector resolution: 10.000 pixels mm-1 | θmax = 27.5°, θmin = 3.1° |
| ω scans | h = −8→8 |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | k = −11→12 |
| Tmin = 0.396, Tmax = 0.532 | l = −23→23 |
| 11398 measured reflections |
Refinement
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.028 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.074 | H-atom parameters constrained |
| S = 1.07 | w = 1/[σ2(Fo2) + (0.0388P)2 + 1.7294P] where P = (Fo2 + 2Fc2)/3 |
| 5246 reflections | (Δ/σ)max = 0.001 |
| 343 parameters | Δρmax = 1.54 e Å−3 |
| 30 restraints | Δρmin = −0.68 e Å−3 |
Fractional atomic coordinates and isotropic or equivalent isotropic displacement parameters (Å2)
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Ba1 | 0.26276 (3) | 0.610140 (19) | 0.450910 (11) | 0.02043 (7) | |
| Ba2 | 0.26062 (3) | 0.078630 (18) | 0.581428 (11) | 0.01842 (7) | |
| O1 | 0.1686 (4) | 0.8140 (3) | 0.60189 (15) | 0.0296 (5) | |
| O2 | 0.0501 (4) | 0.5894 (3) | 0.57721 (14) | 0.0267 (5) | |
| O3 | 0.3591 (4) | 0.3818 (3) | 0.61724 (16) | 0.0335 (6) | |
| O4 | 0.0593 (4) | 0.3350 (3) | 0.64668 (16) | 0.0325 (6) | |
| O5 | 0.4310 (4) | 0.3577 (2) | 0.43836 (15) | 0.0282 (5) | |
| O6 | 0.4612 (3) | 0.1417 (2) | 0.46119 (14) | 0.0228 (5) | |
| O7 | 0.1291 (3) | −0.0557 (3) | 0.43544 (14) | 0.0259 (5) | |
| O8 | 0.3566 (3) | −0.1786 (3) | 0.37175 (15) | 0.0262 (5) | |
| O1w | 0.3097 (12) | 1.1921 (6) | 0.8946 (3) | 0.128 (2) | |
| H11 | 0.2025 | 1.2235 | 0.9081 | 0.192* | |
| H12 | 0.3998 | 1.2440 | 0.9213 | 0.192* | |
| O2w | 0.5133 (16) | 0.5633 (9) | 1.0382 (5) | 0.083 (3) | 0.50 |
| H21 | 0.4591 | 0.5883 | 1.0013 | 0.124* | 0.50 |
| H22 | 0.5884 | 0.4986 | 1.0218 | 0.124* | 0.50 |
| O3w | 0.2112 (15) | 0.4994 (10) | 0.1075 (5) | 0.177 (4) | |
| H31 | 0.1689 | 0.4135 | 0.0922 | 0.266* | |
| H32 | 0.2282 | 0.5210 | 0.1552 | 0.266* | |
| O4w | −0.0138 (16) | −0.3037 (13) | 0.0517 (7) | 0.225 (5) | |
| H41 | 0.0288 | −0.3661 | 0.0729 | 0.337* | |
| H42 | −0.0152 | −0.3286 | 0.0039 | 0.337* | |
| O5w | 0.3529 (5) | 0.1624 (4) | 0.74063 (18) | 0.0466 (8) | |
| H51 | 0.2820 | 0.1137 | 0.7634 | 0.070* | |
| H52 | 0.4694 | 0.1486 | 0.7492 | 0.070* | |
| O6w | 0.2361 (6) | −0.4351 (4) | 0.2606 (3) | 0.0666 (11) | |
| H61 | 0.1264 | −0.4298 | 0.2790 | 0.100* | |
| H62 | 0.3069 | −0.3650 | 0.2855 | 0.100* | |
| N1 | 0.3285 (6) | 0.9029 (4) | 0.8973 (2) | 0.0397 (8) | |
| H1 | 0.3280 | 0.9966 | 0.9036 | 0.048* | |
| N2 | 0.3607 (6) | 0.6883 (4) | 0.9229 (2) | 0.0424 (9) | |
| N3 | 0.2152 (6) | 0.2189 (5) | 0.1479 (2) | 0.0434 (9) | |
| N4 | 0.1238 (6) | −0.0140 (5) | 0.1170 (2) | 0.0473 (10) | |
| H4 | 0.0825 | −0.0992 | 0.0897 | 0.057* | |
| C1 | 0.1336 (4) | 0.6990 (3) | 0.62169 (19) | 0.0198 (6) | |
| C2 | 0.1978 (5) | 0.6878 (3) | 0.70029 (19) | 0.0199 (6) | |
| C3 | 0.2313 (5) | 0.8127 (4) | 0.7571 (2) | 0.0250 (7) | |
| H3A | 0.2173 | 0.9023 | 0.7467 | 0.030* | |
| C4 | 0.2863 (6) | 0.7997 (4) | 0.8300 (2) | 0.0290 (7) | |
| C5 | 0.3694 (7) | 0.8313 (5) | 0.9496 (2) | 0.0459 (11) | |
| H5 | 0.4014 | 0.8757 | 1.0004 | 0.055* | |
| C6 | 0.3078 (6) | 0.6659 (4) | 0.8458 (2) | 0.0305 (8) | |
| C7 | 0.2809 (6) | 0.5397 (4) | 0.7887 (2) | 0.0294 (8) | |
| H7 | 0.2983 | 0.4506 | 0.7992 | 0.035* | |
| C8 | 0.2277 (5) | 0.5522 (3) | 0.71628 (19) | 0.0208 (6) | |
| C9 | 0.2134 (5) | 0.4149 (3) | 0.6539 (2) | 0.0241 (7) | |
| C10 | 0.4047 (4) | 0.2236 (3) | 0.41961 (19) | 0.0198 (6) | |
| C11 | 0.3099 (5) | 0.1562 (3) | 0.34209 (19) | 0.0201 (6) | |
| C12 | 0.3057 (5) | 0.2372 (4) | 0.2876 (2) | 0.0271 (7) | |
| H12A | 0.3482 | 0.3337 | 0.2999 | 0.033* | |
| C13 | 0.2370 (5) | 0.1713 (4) | 0.2147 (2) | 0.0306 (8) | |
| C14 | 0.1482 (8) | 0.1045 (6) | 0.0937 (3) | 0.0517 (12) | |
| H14 | 0.1213 | 0.1093 | 0.0434 | 0.062* | |
| C15 | 0.1772 (6) | 0.0235 (4) | 0.1942 (2) | 0.0312 (8) | |
| C16 | 0.1771 (5) | −0.0567 (4) | 0.2494 (2) | 0.0285 (7) | |
| H16 | 0.1342 | −0.1530 | 0.2371 | 0.034* | |
| C17 | 0.2418 (5) | 0.0098 (3) | 0.32264 (19) | 0.0206 (6) | |
| C18 | 0.2422 (5) | −0.0791 (3) | 0.38180 (19) | 0.0201 (6) |
Atomic displacement parameters (Å2)
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Ba1 | 0.01885 (11) | 0.01795 (11) | 0.02441 (11) | −0.00112 (7) | −0.00104 (7) | 0.00554 (8) |
| Ba2 | 0.01508 (11) | 0.01541 (10) | 0.02374 (11) | −0.00021 (7) | 0.00126 (7) | 0.00261 (8) |
| O1 | 0.0343 (14) | 0.0228 (12) | 0.0336 (14) | −0.0030 (10) | 0.0009 (11) | 0.0118 (11) |
| O2 | 0.0294 (13) | 0.0237 (12) | 0.0247 (12) | −0.0051 (10) | −0.0022 (10) | 0.0027 (10) |
| O3 | 0.0334 (15) | 0.0224 (12) | 0.0429 (16) | 0.0048 (10) | 0.0116 (12) | 0.0014 (11) |
| O4 | 0.0310 (14) | 0.0199 (12) | 0.0433 (15) | −0.0043 (10) | −0.0035 (11) | 0.0024 (11) |
| O5 | 0.0296 (14) | 0.0170 (11) | 0.0360 (14) | 0.0010 (10) | −0.0055 (11) | 0.0032 (10) |
| O6 | 0.0206 (12) | 0.0219 (11) | 0.0260 (12) | −0.0023 (9) | −0.0012 (9) | 0.0066 (10) |
| O7 | 0.0189 (12) | 0.0325 (13) | 0.0245 (12) | −0.0055 (10) | 0.0009 (9) | 0.0042 (10) |
| O8 | 0.0210 (12) | 0.0212 (11) | 0.0377 (14) | 0.0022 (9) | 0.0004 (10) | 0.0096 (11) |
| O1w | 0.250 (7) | 0.084 (3) | 0.052 (3) | 0.056 (4) | −0.013 (4) | 0.010 (3) |
| O2w | 0.115 (7) | 0.066 (5) | 0.070 (5) | 0.018 (5) | −0.021 (5) | 0.024 (4) |
| O3w | 0.222 (8) | 0.179 (7) | 0.139 (6) | 0.058 (6) | 0.037 (6) | 0.036 (5) |
| O4w | 0.220 (9) | 0.245 (8) | 0.216 (9) | 0.008 (7) | 0.022 (7) | 0.067 (7) |
| O5w | 0.049 (2) | 0.0500 (18) | 0.0395 (17) | 0.0039 (15) | 0.0036 (14) | 0.0080 (15) |
| O6w | 0.058 (2) | 0.046 (2) | 0.089 (3) | 0.0012 (17) | 0.014 (2) | 0.002 (2) |
| N1 | 0.051 (2) | 0.0288 (16) | 0.0326 (17) | 0.0046 (15) | −0.0052 (15) | −0.0057 (14) |
| N2 | 0.059 (2) | 0.042 (2) | 0.0234 (16) | −0.0016 (17) | −0.0061 (15) | 0.0048 (15) |
| N3 | 0.039 (2) | 0.062 (2) | 0.0366 (19) | 0.0035 (18) | −0.0018 (15) | 0.0271 (19) |
| N4 | 0.052 (2) | 0.061 (2) | 0.0265 (17) | 0.0011 (19) | −0.0085 (16) | 0.0065 (18) |
| C1 | 0.0138 (14) | 0.0201 (15) | 0.0252 (16) | 0.0012 (11) | 0.0034 (12) | 0.0045 (13) |
| C2 | 0.0161 (15) | 0.0184 (14) | 0.0244 (16) | 0.0021 (11) | 0.0013 (12) | 0.0031 (13) |
| C3 | 0.0246 (17) | 0.0189 (15) | 0.0304 (18) | 0.0025 (13) | 0.0012 (14) | 0.0028 (14) |
| C4 | 0.0298 (19) | 0.0263 (17) | 0.0259 (17) | 0.0017 (14) | −0.0002 (14) | −0.0044 (14) |
| C5 | 0.059 (3) | 0.049 (3) | 0.0234 (19) | 0.002 (2) | −0.0075 (18) | −0.0030 (18) |
| C6 | 0.035 (2) | 0.0309 (18) | 0.0237 (17) | −0.0003 (15) | −0.0015 (14) | 0.0036 (15) |
| C7 | 0.037 (2) | 0.0222 (16) | 0.0284 (18) | 0.0018 (14) | −0.0023 (15) | 0.0061 (14) |
| C8 | 0.0197 (16) | 0.0163 (14) | 0.0248 (16) | −0.0008 (12) | 0.0001 (12) | 0.0021 (13) |
| C9 | 0.0289 (18) | 0.0157 (14) | 0.0276 (17) | 0.0026 (13) | −0.0018 (13) | 0.0052 (13) |
| C10 | 0.0135 (14) | 0.0200 (14) | 0.0258 (16) | 0.0013 (11) | 0.0014 (12) | 0.0048 (13) |
| C11 | 0.0155 (15) | 0.0179 (14) | 0.0272 (16) | 0.0033 (11) | 0.0017 (12) | 0.0051 (13) |
| C12 | 0.0228 (17) | 0.0273 (17) | 0.0342 (19) | 0.0011 (13) | 0.0021 (14) | 0.0128 (15) |
| C13 | 0.0247 (18) | 0.041 (2) | 0.0309 (19) | 0.0055 (15) | 0.0008 (14) | 0.0178 (17) |
| C14 | 0.049 (3) | 0.079 (4) | 0.030 (2) | 0.004 (3) | −0.0050 (19) | 0.022 (2) |
| C15 | 0.0285 (19) | 0.038 (2) | 0.0248 (17) | 0.0024 (15) | −0.0037 (14) | 0.0022 (16) |
| C16 | 0.0274 (18) | 0.0265 (17) | 0.0292 (18) | 0.0013 (14) | −0.0015 (14) | 0.0019 (15) |
| C17 | 0.0166 (15) | 0.0202 (15) | 0.0248 (16) | 0.0026 (12) | 0.0006 (12) | 0.0044 (13) |
| C18 | 0.0157 (15) | 0.0176 (14) | 0.0258 (16) | −0.0047 (11) | −0.0032 (12) | 0.0044 (13) |
Geometric parameters (Å, °)
| Ba1—O1 | 3.080 (3) | O3w—H31 | 0.8400 |
| Ba1—O2 | 2.795 (2) | O3w—H32 | 0.8400 |
| Ba1—O2i | 2.769 (2) | O4w—H41 | 0.8401 |
| Ba1—O3ii | 2.940 (3) | O4w—H42 | 0.8400 |
| Ba1—O4i | 2.936 (3) | O5w—H51 | 0.8401 |
| Ba1—O5 | 2.711 (2) | O5w—H52 | 0.8400 |
| Ba1—O5ii | 2.816 (3) | O6w—H61 | 0.8401 |
| Ba1—O6ii | 3.069 (2) | O6w—H62 | 0.8400 |
| Ba1—O8iii | 2.795 (2) | N1—C5 | 1.318 (6) |
| Ba2—O1iv | 2.695 (2) | N1—C4 | 1.389 (5) |
| Ba2—O3 | 2.871 (3) | N1—H1 | 0.8800 |
| Ba2—O4 | 2.923 (3) | N2—C5 | 1.343 (6) |
| Ba2—O6 | 2.778 (2) | N2—C6 | 1.389 (5) |
| Ba2—O6v | 2.928 (2) | N3—C14 | 1.342 (7) |
| Ba2—O7vi | 2.700 (2) | N3—C13 | 1.387 (5) |
| Ba2—O7 | 2.751 (2) | N4—C14 | 1.304 (7) |
| Ba2—O8v | 2.806 (2) | N4—C15 | 1.386 (5) |
| Ba2—O5w | 2.836 (3) | N4—H4 | 0.8800 |
| O1—C1 | 1.249 (4) | C1—C2 | 1.498 (5) |
| O1—Ba2iii | 2.695 (2) | C2—C3 | 1.390 (5) |
| O2—C1 | 1.266 (4) | C2—C8 | 1.419 (4) |
| O2—Ba1i | 2.769 (2) | C3—C4 | 1.389 (5) |
| O3—C9 | 1.242 (4) | C3—H3A | 0.9300 |
| O3—Ba1ii | 2.940 (3) | C4—C6 | 1.392 (5) |
| O4—C9 | 1.266 (4) | C5—H5 | 0.9300 |
| O4—Ba1i | 2.936 (3) | C6—C7 | 1.398 (5) |
| O5—C10 | 1.255 (4) | C7—C8 | 1.376 (5) |
| O5—Ba1ii | 2.816 (3) | C7—H7 | 0.9300 |
| O6—C10 | 1.270 (4) | C8—C9 | 1.521 (5) |
| O6—Ba2v | 2.928 (2) | C10—C11 | 1.509 (5) |
| O6—Ba1ii | 3.069 (2) | C10—Ba1ii | 3.290 (3) |
| O7—C18 | 1.254 (4) | C11—C12 | 1.384 (5) |
| O7—Ba2vi | 2.700 (2) | C11—C17 | 1.419 (4) |
| O8—C18 | 1.259 (4) | C12—C13 | 1.377 (5) |
| O8—Ba1iv | 2.795 (2) | C12—H12A | 0.9300 |
| O8—Ba2v | 2.806 (2) | C13—C15 | 1.417 (6) |
| O1w—H11 | 0.8400 | C14—H14 | 0.9300 |
| O1w—H12 | 0.8400 | C15—C16 | 1.388 (6) |
| O2w—O2wvii | 1.613 (18) | C16—C17 | 1.377 (5) |
| O2w—H21 | 0.8400 | C16—H16 | 0.9300 |
| O2w—H22 | 0.8400 | C17—C18 | 1.510 (4) |
| O5—Ba1—O2i | 77.01 (8) | C10—O6—Ba2 | 124.7 (2) |
| O5—Ba1—O2 | 95.97 (8) | C10—O6—Ba2v | 125.3 (2) |
| O2i—Ba1—O2 | 64.13 (8) | Ba2—O6—Ba2v | 107.25 (7) |
| O5—Ba1—O8iii | 126.34 (8) | C10—O6—Ba1ii | 88.47 (18) |
| O2i—Ba1—O8iii | 127.94 (7) | Ba2—O6—Ba1ii | 99.88 (7) |
| O2—Ba1—O8iii | 136.76 (7) | Ba2v—O6—Ba1ii | 99.38 (7) |
| O5—Ba1—O5ii | 70.23 (8) | C18—O7—Ba2vi | 125.1 (2) |
| O2i—Ba1—O5ii | 128.53 (7) | C18—O7—Ba2 | 121.1 (2) |
| O2—Ba1—O5ii | 80.81 (8) | Ba2vi—O7—Ba2 | 112.68 (8) |
| O8iii—Ba1—O5ii | 103.49 (7) | C18—O8—Ba1iv | 113.3 (2) |
| O5—Ba1—O4i | 126.10 (7) | C18—O8—Ba2v | 112.42 (19) |
| O2i—Ba1—O4i | 63.11 (7) | Ba1iv—O8—Ba2v | 106.20 (8) |
| O2—Ba1—O4i | 97.43 (8) | H11—O1w—H12 | 110.0 |
| O8iii—Ba1—O4i | 66.63 (7) | O2wvii—O2w—H21 | 66.4 |
| O5ii—Ba1—O4i | 163.60 (7) | O2wvii—O2w—H22 | 51.6 |
| O5—Ba1—O3ii | 68.84 (7) | H21—O2w—H22 | 109.5 |
| O2i—Ba1—O3ii | 132.66 (7) | H31—O3w—H32 | 110.7 |
| O2—Ba1—O3ii | 148.68 (8) | H41—O4w—H42 | 112.7 |
| O8iii—Ba1—O3ii | 60.17 (7) | Ba2—O5w—H51 | 109.4 |
| O5ii—Ba1—O3ii | 68.41 (8) | Ba2—O5w—H52 | 109.5 |
| O4i—Ba1—O3ii | 113.72 (8) | H51—O5w—H52 | 109.5 |
| O5—Ba1—O6ii | 110.03 (7) | H61—O6w—H62 | 107.7 |
| O2i—Ba1—O6ii | 158.74 (6) | C5—N1—C4 | 105.7 (4) |
| O2—Ba1—O6ii | 94.83 (7) | C5—N1—H1 | 127.1 |
| O8iii—Ba1—O6ii | 64.97 (7) | C4—N1—H1 | 127.1 |
| O5ii—Ba1—O6ii | 44.11 (6) | C5—N2—C6 | 105.2 (4) |
| O4i—Ba1—O6ii | 120.42 (7) | C14—N3—C13 | 106.3 (4) |
| O3ii—Ba1—O6ii | 67.22 (7) | C14—N4—C15 | 105.0 (4) |
| O5—Ba1—O1 | 125.39 (7) | C14—N4—H4 | 127.5 |
| O2i—Ba1—O1 | 103.10 (7) | C15—N4—H4 | 127.5 |
| O2—Ba1—O1 | 43.78 (6) | O1—C1—O2 | 122.6 (3) |
| O8iii—Ba1—O1 | 97.04 (7) | O1—C1—C2 | 119.2 (3) |
| O5ii—Ba1—O1 | 68.40 (7) | O2—C1—C2 | 118.2 (3) |
| O4i—Ba1—O1 | 98.98 (7) | C3—C2—C8 | 120.4 (3) |
| O3ii—Ba1—O1 | 123.17 (7) | C3—C2—C1 | 118.9 (3) |
| O6ii—Ba1—O1 | 56.15 (6) | C8—C2—C1 | 120.7 (3) |
| O1iv—Ba2—O7vi | 76.72 (8) | C4—C3—C2 | 118.0 (3) |
| O1iv—Ba2—O7 | 80.25 (8) | C4—C3—H3A | 121.0 |
| O7vi—Ba2—O7 | 67.32 (8) | C2—C3—H3A | 121.0 |
| O1iv—Ba2—O6 | 125.88 (8) | C3—C4—N1 | 131.1 (4) |
| O7vi—Ba2—O6 | 116.89 (7) | C3—C4—C6 | 121.1 (3) |
| O7—Ba2—O6 | 62.22 (7) | N1—C4—C6 | 107.7 (3) |
| O1iv—Ba2—O8v | 113.68 (8) | N1—C5—N2 | 113.9 (4) |
| O7vi—Ba2—O8v | 163.12 (8) | N1—C5—H5 | 123.1 |
| O7—Ba2—O8v | 126.06 (7) | N2—C5—H5 | 123.1 |
| O6—Ba2—O8v | 68.87 (7) | N2—C6—C4 | 107.4 (3) |
| O1iv—Ba2—O5w | 87.21 (9) | N2—C6—C7 | 131.1 (4) |
| O7vi—Ba2—O5w | 106.45 (9) | C4—C6—C7 | 121.4 (3) |
| O7—Ba2—O5w | 166.97 (8) | C8—C7—C6 | 117.6 (3) |
| O6—Ba2—O5w | 129.48 (9) | C8—C7—H7 | 121.2 |
| O8v—Ba2—O5w | 62.57 (9) | C6—C7—H7 | 121.2 |
| O1iv—Ba2—O3 | 159.72 (8) | C7—C8—C2 | 121.4 (3) |
| O7vi—Ba2—O3 | 104.58 (8) | C7—C8—C9 | 116.6 (3) |
| O7—Ba2—O3 | 119.27 (8) | C2—C8—C9 | 121.9 (3) |
| O6—Ba2—O3 | 72.16 (7) | O3—C9—O4 | 123.7 (3) |
| O8v—Ba2—O3 | 60.90 (8) | O3—C9—C8 | 118.1 (3) |
| O5w—Ba2—O3 | 72.92 (9) | O4—C9—C8 | 118.0 (3) |
| O1iv—Ba2—O4 | 124.90 (8) | O5—C10—O6 | 123.3 (3) |
| O7vi—Ba2—O4 | 63.37 (7) | O5—C10—C11 | 118.2 (3) |
| O7—Ba2—O4 | 113.76 (8) | O6—C10—C11 | 118.4 (3) |
| O6—Ba2—O4 | 106.09 (7) | O5—C10—Ba1ii | 57.20 (18) |
| O8v—Ba2—O4 | 100.03 (7) | O6—C10—Ba1ii | 68.83 (18) |
| O5w—Ba2—O4 | 70.81 (9) | C11—C10—Ba1ii | 159.4 (2) |
| O3—Ba2—O4 | 44.87 (7) | C12—C11—C17 | 120.1 (3) |
| O1iv—Ba2—O6v | 61.79 (7) | C12—C11—C10 | 118.3 (3) |
| O7vi—Ba2—O6v | 129.53 (7) | C17—C11—C10 | 121.3 (3) |
| O7—Ba2—O6v | 77.96 (7) | C13—C12—C11 | 118.3 (3) |
| O6—Ba2—O6v | 72.75 (7) | C13—C12—H12A | 120.9 |
| O8v—Ba2—O6v | 66.84 (7) | C11—C12—H12A | 120.9 |
| O5w—Ba2—O6v | 99.26 (8) | C12—C13—N3 | 133.1 (4) |
| O3—Ba2—O6v | 124.42 (7) | C12—C13—C15 | 121.7 (3) |
| O4—Ba2—O6v | 166.54 (7) | N3—C13—C15 | 105.1 (4) |
| C1—O1—Ba2iii | 171.4 (2) | N4—C14—N3 | 114.6 (4) |
| C1—O1—Ba1 | 82.76 (19) | N4—C14—H14 | 122.7 |
| Ba2iii—O1—Ba1 | 104.56 (8) | N3—C14—H14 | 122.7 |
| C1—O2—Ba1i | 147.4 (2) | N4—C15—C16 | 131.3 (4) |
| C1—O2—Ba1 | 95.42 (19) | N4—C15—C13 | 108.9 (4) |
| Ba1i—O2—Ba1 | 115.87 (8) | C16—C15—C13 | 119.9 (3) |
| C9—O3—Ba2 | 95.3 (2) | C17—C16—C15 | 118.4 (3) |
| C9—O3—Ba1ii | 163.6 (2) | C17—C16—H16 | 120.8 |
| Ba2—O3—Ba1ii | 100.86 (8) | C15—C16—H16 | 120.8 |
| C9—O4—Ba2 | 92.3 (2) | C16—C17—C11 | 121.5 (3) |
| C9—O4—Ba1i | 118.6 (2) | C16—C17—C18 | 117.8 (3) |
| Ba2—O4—Ba1i | 114.25 (9) | C11—C17—C18 | 120.7 (3) |
| C10—O5—Ba1 | 145.3 (2) | O7—C18—O8 | 123.6 (3) |
| C10—O5—Ba1ii | 100.8 (2) | O7—C18—C17 | 120.6 (3) |
| Ba1—O5—Ba1ii | 109.77 (8) | O8—C18—C17 | 115.8 (3) |
| O5—Ba1—O1—C1 | −35.8 (2) | O3—Ba2—O7—C18 | 74.1 (3) |
| O2i—Ba1—O1—C1 | 47.5 (2) | O4—Ba2—O7—C18 | 124.3 (2) |
| O2—Ba1—O1—C1 | 20.40 (18) | O6v—Ba2—O7—C18 | −48.8 (2) |
| O8iii—Ba1—O1—C1 | 179.1 (2) | O1iv—Ba2—O7—Ba2vi | 79.59 (10) |
| O5ii—Ba1—O1—C1 | −79.1 (2) | O7vi—Ba2—O7—Ba2vi | 0.0 |
| O4i—Ba1—O1—C1 | 111.8 (2) | O6—Ba2—O7—Ba2vi | −140.71 (12) |
| O3ii—Ba1—O1—C1 | −122.06 (19) | O8v—Ba2—O7—Ba2vi | −168.15 (7) |
| O6ii—Ba1—O1—C1 | −127.5 (2) | O5w—Ba2—O7—Ba2vi | 63.6 (4) |
| O5—Ba1—O1—Ba2iii | 139.56 (8) | O3—Ba2—O7—Ba2vi | −94.51 (10) |
| O2i—Ba1—O1—Ba2iii | −137.20 (9) | O4—Ba2—O7—Ba2vi | −44.37 (11) |
| O2—Ba1—O1—Ba2iii | −164.28 (15) | O6v—Ba2—O7—Ba2vi | 142.60 (10) |
| O8iii—Ba1—O1—Ba2iii | −5.53 (9) | Ba1—O1—C1—O2 | −39.2 (3) |
| O5ii—Ba1—O1—Ba2iii | 96.23 (9) | Ba1—O1—C1—C2 | 138.9 (3) |
| O4i—Ba1—O1—Ba2iii | −72.88 (9) | Ba1i—O2—C1—O1 | −120.1 (4) |
| O3ii—Ba1—O1—Ba2iii | 53.27 (12) | Ba1—O2—C1—O1 | 44.0 (3) |
| O6ii—Ba1—O1—Ba2iii | 47.87 (8) | Ba1i—O2—C1—C2 | 61.8 (5) |
| O5—Ba1—O2—C1 | 117.0 (2) | Ba1—O2—C1—C2 | −134.1 (2) |
| O2i—Ba1—O2—C1 | −170.5 (3) | O1—C1—C2—C3 | 22.3 (5) |
| O8iii—Ba1—O2—C1 | −51.7 (2) | O2—C1—C2—C3 | −159.5 (3) |
| O5ii—Ba1—O2—C1 | 48.2 (2) | O1—C1—C2—C8 | −156.5 (3) |
| O4i—Ba1—O2—C1 | −115.3 (2) | O2—C1—C2—C8 | 21.7 (5) |
| O3ii—Ba1—O2—C1 | 58.8 (3) | C8—C2—C3—C4 | −2.7 (5) |
| O6ii—Ba1—O2—C1 | 6.3 (2) | C1—C2—C3—C4 | 178.5 (3) |
| O1—Ba1—O2—C1 | −20.05 (18) | C2—C3—C4—N1 | −179.8 (4) |
| O5—Ba1—O2—Ba1i | −72.43 (10) | C2—C3—C4—C6 | 0.2 (6) |
| O2i—Ba1—O2—Ba1i | 0.0 | C5—N1—C4—C3 | 179.1 (4) |
| O8iii—Ba1—O2—Ba1i | 118.81 (11) | C5—N1—C4—C6 | −0.9 (5) |
| O5ii—Ba1—O2—Ba1i | −141.24 (11) | C4—N1—C5—N2 | 0.8 (6) |
| O4i—Ba1—O2—Ba1i | 55.24 (10) | C6—N2—C5—N1 | −0.4 (6) |
| O3ii—Ba1—O2—Ba1i | −130.67 (12) | C5—N2—C6—C4 | −0.3 (5) |
| O6ii—Ba1—O2—Ba1i | 176.81 (9) | C5—N2—C6—C7 | 178.3 (5) |
| O1—Ba1—O2—Ba1i | 150.49 (16) | C3—C4—C6—N2 | −179.3 (4) |
| O1iv—Ba2—O3—C9 | −57.0 (4) | N1—C4—C6—N2 | 0.7 (5) |
| O7vi—Ba2—O3—C9 | 34.1 (2) | C3—C4—C6—C7 | 2.0 (6) |
| O7—Ba2—O3—C9 | 106.0 (2) | N1—C4—C6—C7 | −178.0 (4) |
| O6—Ba2—O3—C9 | 148.1 (2) | N2—C6—C7—C8 | −179.9 (4) |
| O8v—Ba2—O3—C9 | −136.6 (2) | C4—C6—C7—C8 | −1.5 (6) |
| O5w—Ba2—O3—C9 | −69.0 (2) | C6—C7—C8—C2 | −1.1 (5) |
| O4—Ba2—O3—C9 | 10.7 (2) | C6—C7—C8—C9 | 175.7 (3) |
| O6v—Ba2—O3—C9 | −158.6 (2) | C3—C2—C8—C7 | 3.2 (5) |
| O1iv—Ba2—O3—Ba1ii | 120.0 (2) | C1—C2—C8—C7 | −178.0 (3) |
| O7vi—Ba2—O3—Ba1ii | −148.87 (8) | C3—C2—C8—C9 | −173.4 (3) |
| O7—Ba2—O3—Ba1ii | −76.98 (10) | C1—C2—C8—C9 | 5.4 (5) |
| O6—Ba2—O3—Ba1ii | −34.84 (8) | Ba2—O3—C9—O4 | −21.3 (4) |
| O8v—Ba2—O3—Ba1ii | 40.43 (8) | Ba1ii—O3—C9—O4 | 169.0 (7) |
| O5w—Ba2—O3—Ba1ii | 108.05 (11) | Ba2—O3—C9—C8 | 152.6 (3) |
| O4—Ba2—O3—Ba1ii | −172.25 (15) | Ba1ii—O3—C9—C8 | −17.2 (11) |
| O6v—Ba2—O3—Ba1ii | 18.42 (12) | Ba2—O4—C9—O3 | 20.8 (4) |
| O1iv—Ba2—O4—C9 | 146.5 (2) | Ba1i—O4—C9—O3 | −98.5 (4) |
| O7vi—Ba2—O4—C9 | −165.0 (2) | Ba2—O4—C9—C8 | −153.0 (3) |
| O7—Ba2—O4—C9 | −118.8 (2) | Ba1i—O4—C9—C8 | 87.6 (3) |
| O6—Ba2—O4—C9 | −52.6 (2) | C7—C8—C9—O3 | −91.7 (4) |
| O8v—Ba2—O4—C9 | 18.2 (2) | C2—C8—C9—O3 | 85.1 (4) |
| O5w—Ba2—O4—C9 | 74.3 (2) | C7—C8—C9—O4 | 82.5 (4) |
| O3—Ba2—O4—C9 | −10.4 (2) | C2—C8—C9—O4 | −100.7 (4) |
| O6v—Ba2—O4—C9 | 30.6 (4) | Ba1—O5—C10—O6 | −131.3 (3) |
| O1iv—Ba2—O4—Ba1i | −90.55 (11) | Ba1ii—O5—C10—O6 | 20.4 (4) |
| O7vi—Ba2—O4—Ba1i | −42.08 (8) | Ba1—O5—C10—C11 | 51.7 (5) |
| O7—Ba2—O4—Ba1i | 4.13 (11) | Ba1ii—O5—C10—C11 | −156.6 (2) |
| O6—Ba2—O4—Ba1i | 70.37 (10) | Ba1—O5—C10—Ba1ii | −151.7 (4) |
| O8v—Ba2—O4—Ba1i | 141.10 (9) | Ba2—O6—C10—O5 | 82.7 (4) |
| O5w—Ba2—O4—Ba1i | −162.74 (12) | Ba2v—O6—C10—O5 | −118.7 (3) |
| O3—Ba2—O4—Ba1i | 112.48 (14) | Ba1ii—O6—C10—O5 | −18.3 (3) |
| O6v—Ba2—O4—Ba1i | 153.5 (2) | Ba2—O6—C10—C11 | −100.4 (3) |
| O2i—Ba1—O5—C10 | 10.7 (4) | Ba2v—O6—C10—C11 | 58.2 (3) |
| O2—Ba1—O5—C10 | 72.3 (4) | Ba1ii—O6—C10—C11 | 158.7 (3) |
| O8iii—Ba1—O5—C10 | −117.2 (4) | Ba2—O6—C10—Ba1ii | 100.96 (18) |
| O5ii—Ba1—O5—C10 | 150.3 (5) | Ba2v—O6—C10—Ba1ii | −100.42 (18) |
| O4i—Ba1—O5—C10 | −31.4 (4) | O5—C10—C11—C12 | 17.9 (5) |
| O3ii—Ba1—O5—C10 | −136.0 (4) | O6—C10—C11—C12 | −159.2 (3) |
| O6ii—Ba1—O5—C10 | 169.7 (4) | Ba1ii—C10—C11—C12 | −53.5 (7) |
| O1—Ba1—O5—C10 | 107.6 (4) | O5—C10—C11—C17 | −167.7 (3) |
| O2i—Ba1—O5—Ba1ii | −139.66 (10) | O6—C10—C11—C17 | 15.2 (5) |
| O2—Ba1—O5—Ba1ii | −77.98 (9) | Ba1ii—C10—C11—C17 | 121.0 (5) |
| O8iii—Ba1—O5—Ba1ii | 92.48 (11) | C17—C11—C12—C13 | −1.0 (5) |
| O5ii—Ba1—O5—Ba1ii | 0.0 | C10—C11—C12—C13 | 173.5 (3) |
| O4i—Ba1—O5—Ba1ii | 178.30 (8) | C11—C12—C13—N3 | −179.2 (4) |
| O3ii—Ba1—O5—Ba1ii | 73.73 (10) | C11—C12—C13—C15 | −2.0 (6) |
| O6ii—Ba1—O5—Ba1ii | 19.40 (11) | C14—N3—C13—C12 | 177.3 (5) |
| O1—Ba1—O5—Ba1ii | −42.68 (12) | C14—N3—C13—C15 | −0.2 (5) |
| O1iv—Ba2—O6—C10 | 128.5 (2) | C15—N4—C14—N3 | 0.6 (6) |
| O7vi—Ba2—O6—C10 | 35.7 (3) | C13—N3—C14—N4 | −0.2 (6) |
| O7—Ba2—O6—C10 | 76.6 (2) | C14—N4—C15—C16 | 178.2 (5) |
| O8v—Ba2—O6—C10 | −126.9 (3) | C14—N4—C15—C13 | −0.7 (5) |
| O5w—Ba2—O6—C10 | −110.3 (3) | C12—C13—C15—N4 | −177.3 (4) |
| O3—Ba2—O6—C10 | −62.0 (2) | N3—C13—C15—N4 | 0.6 (5) |
| O4—Ba2—O6—C10 | −32.2 (3) | C12—C13—C15—C16 | 3.6 (6) |
| O6v—Ba2—O6—C10 | 161.8 (3) | N3—C13—C15—C16 | −178.5 (4) |
| O1iv—Ba2—O6—Ba2v | −33.33 (12) | N4—C15—C16—C17 | 179.1 (4) |
| O7vi—Ba2—O6—Ba2v | −126.14 (8) | C13—C15—C16—C17 | −2.1 (6) |
| O7—Ba2—O6—Ba2v | −85.22 (9) | C15—C16—C17—C11 | −0.8 (5) |
| O8v—Ba2—O6—Ba2v | 71.25 (8) | C15—C16—C17—C18 | −179.5 (3) |
| O5w—Ba2—O6—Ba2v | 87.86 (12) | C12—C11—C17—C16 | 2.4 (5) |
| O3—Ba2—O6—Ba2v | 136.20 (10) | C10—C11—C17—C16 | −171.9 (3) |
| O4—Ba2—O6—Ba2v | 165.99 (7) | C12—C11—C17—C18 | −178.9 (3) |
| O6v—Ba2—O6—Ba2v | 0.0 | C10—C11—C17—C18 | 6.8 (5) |
| O1iv—Ba2—O6—Ba1ii | −136.47 (8) | Ba2vi—O7—C18—O8 | −115.8 (3) |
| O7vi—Ba2—O6—Ba1ii | 130.72 (7) | Ba2—O7—C18—O8 | 77.0 (4) |
| O7—Ba2—O6—Ba1ii | 171.65 (10) | Ba2vi—O7—C18—C17 | 61.7 (4) |
| O8v—Ba2—O6—Ba1ii | −31.89 (7) | Ba2—O7—C18—C17 | −105.5 (3) |
| O5w—Ba2—O6—Ba1ii | −15.28 (13) | Ba1iv—O8—C18—O7 | 17.2 (4) |
| O3—Ba2—O6—Ba1ii | 33.06 (8) | Ba2v—O8—C18—O7 | −103.3 (3) |
| O4—Ba2—O6—Ba1ii | 62.86 (8) | Ba1iv—O8—C18—C17 | −160.4 (2) |
| O6v—Ba2—O6—Ba1ii | −103.13 (9) | Ba2v—O8—C18—C17 | 79.1 (3) |
| O1iv—Ba2—O7—C18 | −111.8 (3) | C16—C17—C18—O7 | −112.0 (4) |
| O7vi—Ba2—O7—C18 | 168.6 (3) | C11—C17—C18—O7 | 69.3 (4) |
| O6—Ba2—O7—C18 | 27.9 (2) | C16—C17—C18—O8 | 65.7 (4) |
| O8v—Ba2—O7—C18 | 0.5 (3) | C11—C17—C18—O8 | −113.0 (3) |
| O5w—Ba2—O7—C18 | −127.7 (4) |
Symmetry codes: (i) −x, −y+1, −z+1; (ii) −x+1, −y+1, −z+1; (iii) x, y+1, z; (iv) x, y−1, z; (v) −x+1, −y, −z+1; (vi) −x, −y, −z+1; (vii) −x+1, −y+1, −z+2.
Hydrogen-bond geometry (Å, °)
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O4wi | 0.84 | 1.66 | 2.49 (1) | 170 |
| O1w—H12···O2wviii | 0.84 | 1.88 | 2.60 (1) | 143 |
| O2w—H21···N2 | 0.84 | 2.00 | 2.83 (1) | 168 |
| O2w—H22···N2vii | 0.84 | 2.28 | 2.83 (1) | 124 |
| O3w—H31···N3 | 0.84 | 2.34 | 2.95 (1) | 129 |
| O3w—H32···O6wiii | 0.84 | 1.85 | 2.68 (1) | 174 |
| O4w—H41···O3wiv | 0.84 | 2.03 | 2.84 (2) | 161 |
| O5w—H51···O1wiv | 0.84 | 2.31 | 2.75 (1) | 113 |
| O6w—H61···O4vi | 0.84 | 1.99 | 2.76 (1) | 152 |
| O6w—H62···O8 | 0.84 | 2.09 | 2.86 (1) | 152 |
| N1—H1···O1w | 0.88 | 1.93 | 2.80 (1) | 168 |
| N4—H4···O4w | 0.88 | 1.99 | 2.86 (1) | 167 |
Symmetry codes: (i) −x, −y+1, −z+1; (viii) −x+1, −y+2, −z+2; (vii) −x+1, −y+1, −z+2; (iii) x, y+1, z; (iv) x, y−1, z; (vi) −x, −y, −z+1.
Footnotes
Supplementary data and figures for this paper are available from the IUCr electronic archives (Reference: JH2280).
References
- Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191.
- Higashi, T. (1995). ABSCOR Rigaku Corporation, Tokyo, Japan.
- Rigaku Corporation (1998). RAPID-AUTO Rigaku Corporation, Tokyo, Japan.
- Rigaku/MSC (2002). CrystalStructure Rigaku/MSC, The Woodlands, Texas, USA.
- Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. [DOI] [PubMed]
- Song, W.-D., Wang, H., Liu, J.-H., Ma, X.-T. & Ng, S. W. (2009). Acta Cryst. E65, m1643–m1644. [DOI] [PMC free article] [PubMed]
- Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925.
Associated Data
This section collects any data citations, data availability statements, or supplementary materials included in this article.
Supplementary Materials
Crystal structure: contains datablocks global, I. DOI: 10.1107/S160053681101590X/jh2280sup1.cif
Structure factors: contains datablocks I. DOI: 10.1107/S160053681101590X/jh2280Isup2.hkl
Additional supplementary materials: crystallographic information; 3D view; checkCIF report

