Abstract
The title compound, [1-(CH3)3NCH2-1,2-C2B10H11]+·I− or C6H22B10N+·I−, was obtained by the reaction of (1,2-dicarba-closo-dodecaboranyl)dimethylmethanamine with methyl iodide. The asymmetric unit contains two iodide anions and two (o-carboranyl)tetramethylammonium cations. The bond lengths and angles in the carborane cage are within normal ranges, but the N—Cmethylene—Ccage angle is very large [120.2 (2)°] because of repulsion between the carborane and tetramethylammonium units. In the crystal, ions are linked through C—H⋯I hydrogen bonds.
Related literature
For background to quaternaryammonium salts, see: Wiebcke & Felsche (2001 ▶); Zhang et al. (2004 ▶); Carr et al. (2006 ▶). For background to o-carborane structures, see: Davidson et al. (1996 ▶); Lee et al. (2000 ▶); Welch et al. (2001 ▶). For a related structure, see: Lee et al. (1999 ▶).
Experimental
Crystal data
C6H22B10N+·I−
M r = 343.25
Monoclinic,
a = 6.7435 (14) Å
b = 25.013 (5) Å
c = 18.694 (4) Å
β = 94.800 (4)°
V = 3142.2 (11) Å3
Z = 8
Mo Kα radiation
μ = 2.01 mm−1
T = 293 K
0.28 × 0.25 × 0.20 mm
Data collection
Bruker SMART 1000 CCD diffractometer
Absorption correction: multi-scan (SADABS; Sheldrick, 2008 ▶) T min = 0.603, T max = 0.689
32138 measured reflections
7772 independent reflections
5834 reflections with I > 2σ(I)
R int = 0.032
Refinement
R[F 2 > 2σ(F 2)] = 0.031
wR(F 2) = 0.076
S = 1.02
7772 reflections
325 parameters
H-atom parameters constrained
Δρmax = 0.88 e Å−3
Δρmin = −0.92 e Å−3
Data collection: SMART (Bruker, 1999 ▶); cell refinement: SAINT-Plus (Bruker, 1999 ▶); data reduction: SAINT-Plus; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008 ▶); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008 ▶); molecular graphics: ORTEP-3 for Windows (Farrugia, 1997 ▶); software used to prepare material for publication: SHELXL97.
Supplementary Material
Crystal structure: contains datablock(s) global, I. DOI: 10.1107/S160053681102928X/dn2706sup1.cif
Structure factors: contains datablock(s) I. DOI: 10.1107/S160053681102928X/dn2706Isup2.hkl
Additional supplementary materials: crystallographic information; 3D view; checkCIF report
Table 1. Hydrogen-bond geometry (Å, °).
| D—H⋯A | D—H | H⋯A | D⋯A | D—H⋯A |
|---|---|---|---|---|
| C2—H2⋯I1 | 1.10 | 3.03 | 3.946 (3) | 141 |
| C3—H3B⋯I1 | 0.97 | 2.94 | 3.904 (3) | 172 |
| C23—H23B⋯I1 | 0.97 | 2.96 | 3.921 (3) | 170 |
Acknowledgments
This study was supported by the research fund of Chosun University, 2010.
supplementary crystallographic information
Comment
N,N-dimethyl-(1,2-dicarba-closo-dodecaboranyl)methanamine is a useful intramolecular coordinating ligand for many different metals (Lee et al., 1999, 2000). Since the starting material is an oil, it could not be characterized by X-ray diffraction. However, we found that the corresponding methyl iodide forms crystals suitable for crystallographic study. We report here the synthesis and structure of the title compound (I).
In (I), shown in Fig. 1 and Table 1, the average bond length N—C [1.508 (2) Å] in the tetramethylammonium unit is similar to 1.492 (5) Å in an o-carboranyl organogallium compound [Cl3Ga][N(CH3)2CH2-1,2-C2B10H11] (Lee et al., 1999), 1.505 (2) Å in a benzyltrimethylammonium hydroxide trihydrate system (Wiebcke & Felsche, 2001) and 1.478 (5) Å in a tetramethylammonium pentaborate 0.25-hydrate compound (Zhang et al., 2004).
The average bond angle of Ccage—Cmethylene—N [120.3 (1)°] in (I) is almost same as 120.5 (6)° of o-carboranyl organogallium compound (Lee et al., 1999). Their large difference from the tetrahedral angle might be attributable to the repulsion between the carborane and tetramethylammonium unit. On the other hand, Carr and co-workers reported far smaller angle [113.5 (2)°] for the same methylene unit of [H3NCH2C2B10H11][H3CCH2CB11H11] with a smaller methylammonium unit than tetramethylammonium one. Compared with these two values, it would seem the above-mentioned repulsion logic would be affirmatively accepted.
The carborane moiety forms an icosahedrons consisting of twenty triangles with sides of the average bond length of Ccage—Ccage 1.659 (3), Ccage—Bcage 1.713 (1), and Bcage—Bcage 1.771 (1) Å. All of the compounds containing mono-substituted o-carboranes (Lee et al., 1999; Welch, et al., 2001) including unsubstituted ortho-, meta-, and para-carboranes with hexamethylphosphoramide (Davidson, et al., 1996) surveyed by our group so far exhibit the same trend of d(Ccage—Ccage) < d(Ccage—Bcage) < d(Bcage—Bcage). Since the boron atom has one valence electron less than carbon, this result confirms that the bond lengths will become shorter when more electrons participate in bond formation.
As shown in Table 1 and Figure 1, I1 atom participates in two intramolecular and an intermolecular hydrogen bonds, while I2 atom has only weak interaction with the closest interatomic distances I2···H3Ai 3.126 Å and I2···H5Aii 3.126 Å [symmetry code: (i) 0.5 - x, 1/2 + y, 1.5 - z; (ii) -1/2 + x, 1.5 - y, 1/2 + z]. The shortest interdimer's distance B26···H24iii 2.912 Å [symmetry code: (iii) -1 + x, y, z] suggests the dimer's packing of (I) is governed by van der Waals forces.
Experimental
A mixture of N,N-dimethyl-(1,2-dicarba-closo-dodecaboranyl)methanamine (0.2 g, 1.0 mmol) and 1.2 equiv of methyl iodide (0.17 g, 1.2 mmol) was dissolved in distilled diethyl ether (10 ml) and stirred at room temperature for 30 min. The resulting white solid was collected by filtration and washed with cold diethyl ether (quantitative yield, m.p. 389 K). The purity was checked by 1H, 13C, and 11B NMR spectroscopies. Suitable single crystals of (I) were obtained by recrystallization from acetone.
Refinement
All of the hydrogen atoms were placed at idealized positions and treated using a riding model, with constrained distances and Uiso(H) values fixed at xUeq (parent atom) [C/B—H = 1.1 Å and x = 1.2 for carborane H atoms, C—H = 0.97 Å, and x = 1.2 for methylene H atoms, and C—H = 0.96 Å and x = 1.5 for methyl H atoms].
Figures
Fig. 1.
The molecular structure of (I), showing the atom-numbering scheme. Displacement ellipsoids are drawn at the 30% probability level, and H atoms (except for H2, H3B, and H23B) have been omitted for clarity. Dashed lines indicate intra- and intermolecular hydrogen bonds.
Crystal data
| C6H22B10N+·I− | F(000) = 1344 |
| Mr = 343.25 | Dx = 1.451 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 5251 reflections |
| a = 6.7435 (14) Å | θ = 2.3–27.3° |
| b = 25.013 (5) Å | µ = 2.01 mm−1 |
| c = 18.694 (4) Å | T = 293 K |
| β = 94.800 (4)° | Block, colourless |
| V = 3142.2 (11) Å3 | 0.28 × 0.25 × 0.20 mm |
| Z = 8 |
Data collection
| Bruker SMART 1000 CCD diffractometer | 7772 independent reflections |
| Radiation source: fine-focus sealed tube | 5834 reflections with I > 2σ(I) |
| graphite | Rint = 0.032 |
| ω scans | θmax = 28.3°, θmin = 1.4° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2008) | h = −8→8 |
| Tmin = 0.603, Tmax = 0.689 | k = −33→33 |
| 32138 measured reflections | l = −24→24 |
Refinement
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.031 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.076 | H-atom parameters constrained |
| S = 1.02 | w = 1/[σ2(Fo2) + (0.0267P)2 + 2.9488P] where P = (Fo2 + 2Fc2)/3 |
| 7772 reflections | (Δ/σ)max = 0.002 |
| 325 parameters | Δρmax = 0.88 e Å−3 |
| 0 restraints | Δρmin = −0.92 e Å−3 |
Special details
| Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
| Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
Fractional atomic coordinates and isotropic or equivalent isotropic displacement parameters (Å2)
| x | y | z | Uiso*/Ueq | ||
| I2 | 0.30391 (3) | 0.913655 (9) | 0.909132 (12) | 0.05540 (7) | |
| I1 | 0.26909 (3) | 0.657927 (8) | 0.774753 (12) | 0.04975 (7) | |
| N1 | 0.6119 (4) | 0.55189 (9) | 0.62825 (12) | 0.0392 (5) | |
| B3 | 0.5023 (5) | 0.46207 (12) | 0.79957 (17) | 0.0363 (6) | |
| H3 | 0.3559 | 0.4472 | 0.7779 | 0.044* | |
| B4 | 0.7252 (5) | 0.44574 (12) | 0.76026 (17) | 0.0356 (6) | |
| H4 | 0.7240 | 0.4198 | 0.7127 | 0.043* | |
| B5 | 0.8919 (5) | 0.50059 (13) | 0.77262 (18) | 0.0385 (7) | |
| H5 | 0.9993 | 0.5100 | 0.7333 | 0.046* | |
| B6 | 0.7713 (5) | 0.55209 (13) | 0.81841 (17) | 0.0406 (7) | |
| H6 | 0.7968 | 0.5948 | 0.8088 | 0.049* | |
| B7 | 0.6790 (5) | 0.42083 (12) | 0.84662 (17) | 0.0404 (7) | |
| H7 | 0.6493 | 0.3783 | 0.8559 | 0.048* | |
| B8 | 0.5593 (5) | 0.47206 (13) | 0.89249 (18) | 0.0431 (7) | |
| H8 | 0.4497 | 0.4635 | 0.9313 | 0.052* | |
| B9 | 0.7252 (6) | 0.52692 (14) | 0.90438 (18) | 0.0462 (8) | |
| H9 | 0.7227 | 0.5536 | 0.9511 | 0.055* | |
| B10 | 0.9492 (6) | 0.51054 (15) | 0.86573 (19) | 0.0490 (8) | |
| H10 | 1.0944 | 0.5262 | 0.8874 | 0.059* | |
| B11 | 0.9206 (5) | 0.44426 (14) | 0.82976 (19) | 0.0449 (8) | |
| H11 | 1.0474 | 0.4168 | 0.8281 | 0.054* | |
| B12 | 0.8182 (6) | 0.46069 (14) | 0.91206 (18) | 0.0480 (8) | |
| H12 | 0.8790 | 0.4440 | 0.9638 | 0.058* | |
| C1 | 0.6407 (4) | 0.50998 (9) | 0.75779 (13) | 0.0307 (5) | |
| C2 | 0.5473 (4) | 0.52448 (10) | 0.83484 (14) | 0.0373 (6) | |
| H2 | 0.4198 | 0.5518 | 0.8356 | 0.045* | |
| C3 | 0.5144 (4) | 0.53300 (10) | 0.69337 (14) | 0.0353 (6) | |
| H3A | 0.4176 | 0.5060 | 0.6774 | 0.042* | |
| H3B | 0.4406 | 0.5630 | 0.7106 | 0.042* | |
| C4 | 0.7509 (5) | 0.59801 (12) | 0.64407 (18) | 0.0549 (8) | |
| H4A | 0.7942 | 0.6116 | 0.5999 | 0.082* | |
| H4B | 0.8643 | 0.5862 | 0.6744 | 0.082* | |
| H4C | 0.6833 | 0.6257 | 0.6679 | 0.082* | |
| C5 | 0.7167 (5) | 0.50697 (12) | 0.59283 (16) | 0.0512 (8) | |
| H5A | 0.7591 | 0.5191 | 0.5478 | 0.077* | |
| H5B | 0.6272 | 0.4773 | 0.5846 | 0.077* | |
| H5C | 0.8305 | 0.4959 | 0.6235 | 0.077* | |
| C6 | 0.4426 (5) | 0.57103 (14) | 0.57671 (17) | 0.0558 (8) | |
| H6A | 0.3784 | 0.6009 | 0.5973 | 0.084* | |
| H6B | 0.3483 | 0.5426 | 0.5676 | 0.084* | |
| H6C | 0.4935 | 0.5818 | 0.5325 | 0.084* | |
| N2 | 0.7834 (3) | 0.77280 (8) | 0.79247 (11) | 0.0325 (5) | |
| B23 | 0.8766 (5) | 0.67804 (12) | 0.96808 (17) | 0.0367 (7) | |
| H23 | 0.9569 | 0.6459 | 0.9426 | 0.044* | |
| B24 | 0.9750 (5) | 0.74312 (13) | 0.97941 (17) | 0.0380 (7) | |
| H24 | 1.1216 | 0.7534 | 0.9615 | 0.046* | |
| B25 | 0.7765 (6) | 0.78988 (13) | 0.97298 (18) | 0.0479 (8) | |
| H25 | 0.7942 | 0.8304 | 0.9514 | 0.058* | |
| B26 | 0.5520 (5) | 0.75335 (18) | 0.9567 (2) | 0.0550 (10) | |
| H26 | 0.4227 | 0.7695 | 0.9239 | 0.066* | |
| B27 | 0.6239 (8) | 0.7764 (2) | 1.0435 (2) | 0.0782 (16) | |
| H27 | 0.5411 | 0.8084 | 1.0682 | 0.094* | |
| B28 | 0.8867 (7) | 0.76998 (15) | 1.05814 (19) | 0.0594 (11) | |
| H28 | 0.9769 | 0.7979 | 1.0927 | 0.071* | |
| B29 | 0.9465 (5) | 0.70112 (13) | 1.05485 (17) | 0.0389 (7) | |
| H29 | 1.0750 | 0.6841 | 1.0872 | 0.047* | |
| B30 | 0.7242 (5) | 0.66515 (15) | 1.03832 (18) | 0.0453 (8) | |
| H30 | 0.7053 | 0.6244 | 1.0587 | 0.054* | |
| B31 | 0.5269 (6) | 0.7114 (2) | 1.0320 (2) | 0.0712 (14) | |
| H31 | 0.3797 | 0.7005 | 1.0488 | 0.085* | |
| B32 | 0.7311 (6) | 0.72198 (17) | 1.09454 (19) | 0.0555 (10) | |
| H32 | 0.7188 | 0.7188 | 1.1527 | 0.067* | |
| C21 | 0.7687 (3) | 0.73285 (9) | 0.92250 (13) | 0.0281 (5) | |
| C22 | 0.6242 (4) | 0.68780 (13) | 0.95729 (16) | 0.0488 (8) | |
| H22 | 0.5352 | 0.6600 | 0.9221 | 0.059* | |
| C23 | 0.7767 (4) | 0.72499 (9) | 0.84162 (13) | 0.0309 (5) | |
| H23A | 0.8930 | 0.7033 | 0.8348 | 0.037* | |
| H23B | 0.6613 | 0.7039 | 0.8248 | 0.037* | |
| C24 | 0.6028 (4) | 0.80804 (11) | 0.79378 (16) | 0.0439 (7) | |
| H24A | 0.4848 | 0.7869 | 0.7839 | 0.066* | |
| H24B | 0.6074 | 0.8355 | 0.7580 | 0.066* | |
| H24C | 0.6009 | 0.8242 | 0.8403 | 0.066* | |
| C25 | 0.7839 (5) | 0.74947 (13) | 0.71782 (15) | 0.0486 (7) | |
| H25A | 0.6646 | 0.7291 | 0.7070 | 0.073* | |
| H25B | 0.8977 | 0.7266 | 0.7156 | 0.073* | |
| H25C | 0.7899 | 0.7779 | 0.6836 | 0.073* | |
| C26 | 0.9719 (4) | 0.80439 (12) | 0.80762 (16) | 0.0450 (7) | |
| H26A | 0.9709 | 0.8345 | 0.7757 | 0.067* | |
| H26B | 1.0843 | 0.7821 | 0.8004 | 0.067* | |
| H26C | 0.9808 | 0.8168 | 0.8564 | 0.067* |
Atomic displacement parameters (Å2)
| U11 | U22 | U33 | U12 | U13 | U23 | |
| I2 | 0.05902 (14) | 0.04948 (13) | 0.05873 (14) | 0.00517 (10) | 0.01109 (10) | −0.00694 (10) |
| I1 | 0.04172 (11) | 0.04153 (11) | 0.06601 (14) | 0.00482 (8) | 0.00458 (9) | −0.00515 (9) |
| N1 | 0.0525 (14) | 0.0311 (11) | 0.0343 (12) | −0.0003 (10) | 0.0058 (10) | 0.0047 (9) |
| B3 | 0.0390 (16) | 0.0297 (14) | 0.0411 (17) | −0.0052 (12) | 0.0085 (13) | 0.0027 (12) |
| B4 | 0.0421 (17) | 0.0274 (14) | 0.0384 (16) | 0.0028 (12) | 0.0097 (13) | −0.0001 (12) |
| B5 | 0.0339 (16) | 0.0387 (16) | 0.0433 (17) | −0.0013 (13) | 0.0058 (13) | 0.0018 (13) |
| B6 | 0.0488 (19) | 0.0333 (15) | 0.0399 (17) | −0.0108 (13) | 0.0057 (14) | −0.0052 (13) |
| B7 | 0.0510 (19) | 0.0300 (15) | 0.0406 (17) | −0.0011 (13) | 0.0054 (14) | 0.0077 (13) |
| B8 | 0.054 (2) | 0.0395 (17) | 0.0371 (17) | −0.0033 (14) | 0.0116 (15) | 0.0043 (13) |
| B9 | 0.065 (2) | 0.0397 (17) | 0.0338 (17) | −0.0077 (16) | 0.0063 (15) | −0.0031 (13) |
| B10 | 0.048 (2) | 0.052 (2) | 0.0456 (19) | −0.0099 (16) | −0.0047 (15) | 0.0051 (16) |
| B11 | 0.0425 (18) | 0.0448 (18) | 0.0473 (19) | 0.0059 (14) | 0.0033 (15) | 0.0075 (15) |
| B12 | 0.060 (2) | 0.0464 (19) | 0.0371 (18) | −0.0033 (16) | −0.0004 (15) | 0.0065 (14) |
| C1 | 0.0362 (13) | 0.0259 (12) | 0.0307 (13) | −0.0020 (10) | 0.0070 (10) | −0.0003 (10) |
| C2 | 0.0451 (15) | 0.0326 (13) | 0.0357 (14) | 0.0003 (11) | 0.0122 (12) | −0.0015 (11) |
| C3 | 0.0398 (14) | 0.0322 (13) | 0.0344 (14) | 0.0025 (11) | 0.0058 (11) | 0.0013 (10) |
| C4 | 0.071 (2) | 0.0380 (16) | 0.0564 (19) | −0.0159 (15) | 0.0067 (16) | 0.0079 (14) |
| C5 | 0.071 (2) | 0.0469 (17) | 0.0379 (16) | 0.0065 (15) | 0.0173 (15) | −0.0019 (13) |
| C6 | 0.074 (2) | 0.0516 (18) | 0.0401 (17) | 0.0082 (16) | −0.0035 (15) | 0.0089 (14) |
| N2 | 0.0334 (11) | 0.0323 (11) | 0.0321 (11) | 0.0008 (9) | 0.0039 (9) | 0.0047 (9) |
| B23 | 0.0446 (17) | 0.0276 (14) | 0.0379 (16) | 0.0026 (12) | 0.0026 (13) | 0.0054 (12) |
| B24 | 0.0312 (15) | 0.0415 (17) | 0.0402 (17) | −0.0075 (12) | −0.0050 (12) | 0.0089 (13) |
| B25 | 0.072 (2) | 0.0325 (16) | 0.0386 (18) | 0.0116 (16) | 0.0014 (16) | −0.0033 (13) |
| B26 | 0.0347 (17) | 0.088 (3) | 0.0447 (19) | 0.0240 (18) | 0.0151 (15) | 0.0210 (19) |
| B27 | 0.103 (4) | 0.092 (3) | 0.043 (2) | 0.061 (3) | 0.026 (2) | 0.007 (2) |
| B28 | 0.097 (3) | 0.0415 (19) | 0.0372 (19) | 0.001 (2) | −0.0105 (19) | −0.0030 (15) |
| B29 | 0.0345 (16) | 0.0450 (18) | 0.0363 (16) | −0.0003 (13) | −0.0032 (13) | 0.0074 (13) |
| B30 | 0.0448 (18) | 0.053 (2) | 0.0371 (17) | −0.0124 (15) | −0.0004 (14) | 0.0158 (15) |
| B31 | 0.0376 (19) | 0.126 (4) | 0.053 (2) | 0.019 (2) | 0.0188 (17) | 0.039 (2) |
| B32 | 0.063 (2) | 0.073 (3) | 0.0321 (17) | 0.020 (2) | 0.0106 (16) | 0.0080 (17) |
| C21 | 0.0240 (11) | 0.0290 (12) | 0.0314 (12) | −0.0008 (9) | 0.0026 (9) | 0.0026 (10) |
| C22 | 0.0415 (16) | 0.065 (2) | 0.0392 (16) | −0.0214 (14) | −0.0028 (12) | 0.0161 (14) |
| C23 | 0.0347 (13) | 0.0274 (12) | 0.0307 (13) | −0.0005 (10) | 0.0035 (10) | 0.0020 (10) |
| C24 | 0.0394 (15) | 0.0400 (15) | 0.0521 (17) | 0.0115 (12) | 0.0030 (13) | 0.0123 (13) |
| C25 | 0.067 (2) | 0.0497 (17) | 0.0295 (14) | 0.0054 (15) | 0.0049 (13) | 0.0047 (12) |
| C26 | 0.0378 (15) | 0.0455 (16) | 0.0516 (17) | −0.0081 (12) | 0.0034 (13) | 0.0124 (13) |
Geometric parameters (Å, °)
| N1—C4 | 1.500 (4) | N2—C26 | 1.503 (3) |
| N1—C3 | 1.507 (3) | N2—C24 | 1.505 (3) |
| N1—C5 | 1.510 (4) | N2—C23 | 1.511 (3) |
| N1—C6 | 1.509 (4) | N2—C25 | 1.513 (3) |
| B3—C2 | 1.712 (4) | B23—C22 | 1.714 (4) |
| B3—C1 | 1.743 (4) | B23—C21 | 1.741 (4) |
| B3—B7 | 1.756 (5) | B23—B29 | 1.749 (4) |
| B3—B8 | 1.765 (5) | B23—B30 | 1.763 (5) |
| B3—B4 | 1.775 (4) | B23—B24 | 1.764 (4) |
| B3—H3 | 1.1000 | B23—H23 | 1.1000 |
| B4—C1 | 1.704 (4) | B24—C21 | 1.699 (4) |
| B4—B11 | 1.772 (5) | B24—B28 | 1.766 (5) |
| B4—B5 | 1.776 (4) | B24—B25 | 1.774 (5) |
| B4—B7 | 1.782 (4) | B24—B29 | 1.782 (4) |
| B4—H4 | 1.1000 | B24—H24 | 1.1000 |
| B5—C1 | 1.710 (4) | B25—C21 | 1.709 (4) |
| B5—B10 | 1.769 (5) | B25—B26 | 1.772 (6) |
| B5—B11 | 1.769 (5) | B25—B28 | 1.771 (5) |
| B5—B6 | 1.780 (5) | B25—B27 | 1.772 (6) |
| B5—H5 | 1.1000 | B25—H25 | 1.1000 |
| B6—C2 | 1.712 (4) | B26—C22 | 1.710 (5) |
| B6—C1 | 1.733 (4) | B26—C21 | 1.722 (4) |
| B6—B10 | 1.767 (5) | B26—B27 | 1.751 (6) |
| B6—B9 | 1.778 (5) | B26—B31 | 1.774 (5) |
| B6—H6 | 1.1000 | B26—H26 | 1.1000 |
| B7—B8 | 1.773 (5) | B27—B31 | 1.757 (8) |
| B7—B12 | 1.783 (5) | B27—B32 | 1.779 (6) |
| B7—B11 | 1.784 (5) | B27—B28 | 1.778 (7) |
| B7—H7 | 1.1000 | B27—H27 | 1.1000 |
| B8—C2 | 1.695 (4) | B28—B32 | 1.768 (6) |
| B8—B9 | 1.773 (5) | B28—B29 | 1.771 (5) |
| B8—B12 | 1.776 (5) | B28—H28 | 1.1000 |
| B8—H8 | 1.1000 | B29—B30 | 1.753 (5) |
| B9—C2 | 1.695 (5) | B29—B32 | 1.765 (5) |
| B9—B12 | 1.773 (5) | B29—H29 | 1.1000 |
| B9—B10 | 1.776 (5) | B30—C22 | 1.703 (4) |
| B9—H9 | 1.1000 | B30—B31 | 1.761 (6) |
| B10—B11 | 1.794 (5) | B30—B32 | 1.766 (6) |
| B10—B12 | 1.793 (5) | B30—H30 | 1.1000 |
| B10—H10 | 1.1000 | B31—C22 | 1.699 (5) |
| B11—B12 | 1.786 (5) | B31—B32 | 1.750 (6) |
| B11—H11 | 1.1000 | B31—H31 | 1.1000 |
| B12—H12 | 1.1000 | B32—H32 | 1.1000 |
| C1—C3 | 1.528 (4) | C21—C23 | 1.530 (3) |
| C1—C2 | 1.660 (3) | C21—C22 | 1.658 (4) |
| C2—H2 | 1.1000 | C22—H22 | 1.1000 |
| C3—H3A | 0.9700 | C23—H23A | 0.9700 |
| C3—H3B | 0.9700 | C23—H23B | 0.9700 |
| C4—H4A | 0.9600 | C24—H24A | 0.9600 |
| C4—H4B | 0.9600 | C24—H24B | 0.9600 |
| C4—H4C | 0.9600 | C24—H24C | 0.9600 |
| C5—H5A | 0.9600 | C25—H25A | 0.9600 |
| C5—H5B | 0.9600 | C25—H25B | 0.9600 |
| C5—H5C | 0.9600 | C25—H25C | 0.9600 |
| C6—H6A | 0.9600 | C26—H26A | 0.9600 |
| C6—H6B | 0.9600 | C26—H26B | 0.9600 |
| C6—H6C | 0.9600 | C26—H26C | 0.9600 |
| C4—N1—C3 | 112.9 (2) | C26—N2—C24 | 111.2 (2) |
| C4—N1—C5 | 110.5 (2) | C26—N2—C23 | 111.7 (2) |
| C3—N1—C5 | 111.9 (2) | C24—N2—C23 | 112.83 (19) |
| C4—N1—C6 | 108.0 (2) | C26—N2—C25 | 108.0 (2) |
| C3—N1—C6 | 104.9 (2) | C24—N2—C25 | 107.8 (2) |
| C5—N1—C6 | 108.2 (2) | C23—N2—C25 | 105.0 (2) |
| C2—B3—C1 | 57.41 (15) | C22—B23—C21 | 57.34 (16) |
| C2—B3—B7 | 104.6 (2) | C22—B23—B29 | 104.5 (2) |
| C1—B3—B7 | 105.2 (2) | C21—B23—B29 | 105.3 (2) |
| C2—B3—B8 | 58.33 (17) | C22—B23—B30 | 58.61 (18) |
| C1—B3—B8 | 105.3 (2) | C21—B23—B30 | 105.2 (2) |
| B7—B3—B8 | 60.48 (19) | B29—B23—B30 | 59.89 (18) |
| C2—B3—B4 | 103.9 (2) | C22—B23—B24 | 104.0 (2) |
| C1—B3—B4 | 57.94 (15) | C21—B23—B24 | 57.98 (15) |
| B7—B3—B4 | 60.62 (18) | B29—B23—B24 | 60.96 (18) |
| B8—B3—B4 | 108.5 (2) | B30—B23—B24 | 108.4 (2) |
| C2—B3—H3 | 125.1 | C22—B23—H23 | 125.0 |
| C1—B3—H3 | 124.4 | C21—B23—H23 | 124.4 |
| B7—B3—H3 | 122.5 | B29—B23—H23 | 122.6 |
| B8—B3—H3 | 121.7 | B30—B23—H23 | 121.8 |
| B4—B3—H3 | 122.3 | B24—B23—H23 | 122.2 |
| C1—B4—B3 | 60.09 (16) | C21—B24—B23 | 60.33 (16) |
| C1—B4—B11 | 105.4 (2) | C21—B24—B28 | 105.3 (2) |
| B3—B4—B11 | 107.7 (2) | B23—B24—B28 | 107.5 (2) |
| C1—B4—B5 | 58.79 (16) | C21—B24—B25 | 58.90 (17) |
| B3—B4—B5 | 108.5 (2) | B23—B24—B25 | 109.0 (2) |
| B11—B4—B5 | 59.82 (18) | B28—B24—B25 | 60.0 (2) |
| C1—B4—B7 | 105.7 (2) | C21—B24—B29 | 105.6 (2) |
| B3—B4—B7 | 59.15 (18) | B23—B24—B29 | 59.10 (17) |
| B11—B4—B7 | 60.25 (19) | B28—B24—B29 | 59.90 (19) |
| B5—B4—B7 | 108.0 (2) | B25—B24—B29 | 108.2 (2) |
| C1—B4—H4 | 123.7 | C21—B24—H24 | 123.7 |
| B3—B4—H4 | 121.4 | B23—B24—H24 | 121.2 |
| B11—B4—H4 | 122.4 | B28—B24—H24 | 122.6 |
| B5—B4—H4 | 121.5 | B25—B24—H24 | 121.1 |
| B7—B4—H4 | 122.4 | B29—B24—H24 | 122.5 |
| C1—B5—B10 | 105.8 (2) | C21—B25—B26 | 59.24 (19) |
| C1—B5—B11 | 105.3 (2) | C21—B25—B28 | 104.7 (2) |
| B10—B5—B11 | 60.9 (2) | B26—B25—B28 | 107.3 (3) |
| C1—B5—B4 | 58.50 (16) | C21—B25—B24 | 58.36 (16) |
| B10—B5—B4 | 108.7 (2) | B26—B25—B24 | 107.5 (2) |
| B11—B5—B4 | 59.96 (18) | B28—B25—B24 | 59.8 (2) |
| C1—B5—B6 | 59.51 (17) | C21—B25—B27 | 105.0 (3) |
| B10—B5—B6 | 59.7 (2) | B26—B25—B27 | 59.2 (3) |
| B11—B5—B6 | 108.5 (2) | B28—B25—B27 | 60.2 (2) |
| B4—B5—B6 | 108.2 (2) | B24—B25—B27 | 107.8 (2) |
| C1—B5—H5 | 124.2 | C21—B25—H25 | 124.4 |
| B10—B5—H5 | 121.7 | B26—B25—H25 | 121.9 |
| B11—B5—H5 | 121.9 | B28—B25—H25 | 122.5 |
| B4—B5—H5 | 121.5 | B24—B25—H25 | 121.8 |
| B6—B5—H5 | 121.3 | B27—B25—H25 | 122.4 |
| C2—B6—C1 | 57.59 (15) | C22—B26—C21 | 57.77 (17) |
| C2—B6—B10 | 104.2 (2) | C22—B26—B27 | 104.6 (3) |
| C1—B6—B10 | 104.9 (2) | C21—B26—B27 | 105.3 (3) |
| C2—B6—B9 | 58.07 (18) | C22—B26—B25 | 104.8 (2) |
| C1—B6—B9 | 105.0 (2) | C21—B26—B25 | 58.53 (17) |
| B10—B6—B9 | 60.1 (2) | B27—B26—B25 | 60.4 (3) |
| C2—B6—B5 | 103.9 (2) | C22—B26—B31 | 58.3 (2) |
| C1—B6—B5 | 58.22 (16) | C21—B26—B31 | 105.0 (2) |
| B10—B6—B5 | 59.8 (2) | B27—B26—B31 | 59.8 (3) |
| B9—B6—B5 | 107.5 (2) | B25—B26—B31 | 107.8 (3) |
| C2—B6—H6 | 125.0 | C22—B26—H26 | 124.5 |
| C1—B6—H6 | 124.2 | C21—B26—H26 | 124.0 |
| B10—B6—H6 | 123.0 | B27—B26—H26 | 122.8 |
| B9—B6—H6 | 122.2 | B25—B26—H26 | 122.2 |
| B5—B6—H6 | 122.8 | B31—B26—H26 | 122.3 |
| B3—B7—B8 | 60.02 (18) | B26—B27—B31 | 60.8 (3) |
| B3—B7—B12 | 108.1 (2) | B26—B27—B25 | 60.4 (2) |
| B8—B7—B12 | 59.9 (2) | B31—B27—B25 | 108.6 (3) |
| B3—B7—B11 | 108.1 (2) | B26—B27—B32 | 108.3 (3) |
| B8—B7—B11 | 107.9 (2) | B31—B27—B32 | 59.3 (2) |
| B12—B7—B11 | 60.1 (2) | B25—B27—B32 | 108.0 (3) |
| B3—B7—B4 | 60.23 (17) | B26—B27—B28 | 107.9 (3) |
| B8—B7—B4 | 107.9 (2) | B31—B27—B28 | 107.0 (3) |
| B12—B7—B4 | 107.7 (2) | B25—B27—B28 | 59.9 (2) |
| B11—B7—B4 | 59.58 (18) | B32—B27—B28 | 59.6 (2) |
| B3—B7—H7 | 121.5 | B26—B27—H27 | 121.2 |
| B8—B7—H7 | 121.8 | B31—B27—H27 | 121.8 |
| B12—B7—H7 | 121.7 | B25—B27—H27 | 121.3 |
| B11—B7—H7 | 121.8 | B32—B27—H27 | 122.0 |
| B4—B7—H7 | 121.9 | B28—B27—H27 | 122.4 |
| C2—B8—B3 | 59.26 (17) | B24—B28—B32 | 108.4 (3) |
| C2—B8—B9 | 58.46 (18) | B24—B28—B25 | 60.21 (19) |
| B3—B8—B9 | 108.4 (2) | B32—B28—B25 | 108.6 (3) |
| C2—B8—B7 | 104.5 (2) | B24—B28—B29 | 60.50 (19) |
| B3—B8—B7 | 59.50 (18) | B32—B28—B29 | 59.8 (2) |
| B9—B8—B7 | 108.2 (2) | B25—B28—B29 | 108.8 (2) |
| C2—B8—B12 | 104.4 (2) | B24—B28—B27 | 107.9 (3) |
| B3—B8—B12 | 108.0 (2) | B32—B28—B27 | 60.2 (3) |
| B9—B8—B12 | 59.9 (2) | B25—B28—B27 | 59.9 (2) |
| B7—B8—B12 | 60.3 (2) | B29—B28—B27 | 108.0 (3) |
| C2—B8—H8 | 124.9 | B24—B28—H28 | 121.5 |
| B3—B8—H8 | 121.3 | B32—B28—H28 | 121.5 |
| B9—B8—H8 | 121.3 | B25—B28—H28 | 121.3 |
| B7—B8—H8 | 122.4 | B29—B28—H28 | 121.5 |
| B12—B8—H8 | 122.4 | B27—B28—H28 | 121.9 |
| C2—B9—B8 | 58.48 (18) | B23—B29—B30 | 60.46 (19) |
| C2—B9—B12 | 104.6 (2) | B23—B29—B32 | 108.7 (2) |
| B8—B9—B12 | 60.1 (2) | B30—B29—B32 | 60.3 (2) |
| C2—B9—B10 | 104.5 (2) | B23—B29—B28 | 108.0 (2) |
| B8—B9—B10 | 108.6 (2) | B30—B29—B28 | 108.2 (3) |
| B12—B9—B10 | 60.7 (2) | B32—B29—B28 | 60.0 (2) |
| C2—B9—B6 | 59.03 (18) | B23—B29—B24 | 59.94 (17) |
| B8—B9—B6 | 108.5 (2) | B30—B29—B24 | 108.1 (2) |
| B12—B9—B6 | 108.5 (2) | B32—B29—B24 | 107.8 (2) |
| B10—B9—B6 | 59.65 (19) | B28—B29—B24 | 59.6 (2) |
| C2—B9—H9 | 125.0 | B23—B29—H29 | 121.4 |
| B8—B9—H9 | 121.2 | B30—B29—H29 | 121.4 |
| B12—B9—H9 | 122.1 | B32—B29—H29 | 121.5 |
| B10—B9—H9 | 122.2 | B28—B29—H29 | 121.9 |
| B6—B9—H9 | 121.2 | B24—B29—H29 | 122.0 |
| B6—B10—B5 | 60.46 (18) | C22—B30—B29 | 104.8 (2) |
| B6—B10—B9 | 60.2 (2) | C22—B30—B23 | 59.26 (18) |
| B5—B10—B9 | 108.0 (2) | B29—B30—B23 | 59.65 (18) |
| B6—B10—B11 | 108.0 (2) | C22—B30—B31 | 58.7 (2) |
| B5—B10—B11 | 59.54 (19) | B29—B30—B31 | 107.7 (3) |
| B9—B10—B11 | 107.3 (2) | B23—B30—B31 | 108.3 (2) |
| B6—B10—B12 | 108.0 (3) | C22—B30—B32 | 104.5 (3) |
| B5—B10—B12 | 107.5 (2) | B29—B30—B32 | 60.2 (2) |
| B9—B10—B12 | 59.6 (2) | B23—B30—B32 | 107.9 (2) |
| B11—B10—B12 | 59.7 (2) | B31—B30—B32 | 59.5 (2) |
| B6—B10—H10 | 121.3 | C22—B30—H30 | 124.6 |
| B5—B10—H10 | 121.8 | B29—B30—H30 | 122.5 |
| B9—B10—H10 | 122.0 | B23—B30—H30 | 121.3 |
| B11—B10—H10 | 122.2 | B31—B30—H30 | 121.6 |
| B12—B10—H10 | 122.0 | B32—B30—H30 | 122.6 |
| B5—B11—B4 | 60.22 (18) | C22—B31—B32 | 105.4 (2) |
| B5—B11—B7 | 108.2 (2) | C22—B31—B27 | 104.9 (3) |
| B4—B11—B7 | 60.16 (18) | B32—B31—B27 | 61.0 (3) |
| B5—B11—B12 | 107.8 (2) | C22—B31—B30 | 58.9 (2) |
| B4—B11—B12 | 108.0 (2) | B32—B31—B30 | 60.4 (2) |
| B7—B11—B12 | 59.93 (19) | B27—B31—B30 | 109.1 (3) |
| B5—B11—B10 | 59.54 (19) | C22—B31—B26 | 59.0 (2) |
| B4—B11—B10 | 107.8 (2) | B32—B31—B26 | 108.6 (3) |
| B7—B11—B10 | 108.0 (2) | B27—B31—B26 | 59.5 (2) |
| B12—B11—B10 | 60.1 (2) | B30—B31—B26 | 108.6 (2) |
| B5—B11—H11 | 121.8 | C22—B31—H31 | 124.6 |
| B4—B11—H11 | 121.6 | B32—B31—H31 | 121.7 |
| B7—B11—H11 | 121.6 | B27—B31—H31 | 122.0 |
| B12—B11—H11 | 121.7 | B30—B31—H31 | 120.8 |
| B10—B11—H11 | 121.9 | B26—B31—H31 | 121.4 |
| B9—B12—B8 | 59.9 (2) | B31—B32—B29 | 107.7 (3) |
| B9—B12—B7 | 107.7 (2) | B31—B32—B30 | 60.1 (2) |
| B8—B12—B7 | 59.76 (19) | B29—B32—B30 | 59.54 (19) |
| B9—B12—B11 | 107.8 (2) | B31—B32—B28 | 107.7 (3) |
| B8—B12—B11 | 107.7 (2) | B29—B32—B28 | 60.2 (2) |
| B7—B12—B11 | 59.96 (19) | B30—B32—B28 | 107.7 (2) |
| B9—B12—B10 | 59.8 (2) | B31—B32—B27 | 59.7 (3) |
| B8—B12—B10 | 107.7 (2) | B29—B32—B27 | 108.2 (3) |
| B7—B12—B10 | 108.0 (2) | B30—B32—B27 | 107.9 (3) |
| B11—B12—B10 | 60.2 (2) | B28—B32—B27 | 60.1 (3) |
| B9—B12—H12 | 121.9 | B31—B32—H32 | 121.9 |
| B8—B12—H12 | 122.0 | B29—B32—H32 | 121.8 |
| B7—B12—H12 | 121.8 | B30—B32—H32 | 121.9 |
| B11—B12—H12 | 121.8 | B28—B32—H32 | 121.7 |
| B10—B12—H12 | 121.7 | B27—B32—H32 | 121.6 |
| C3—C1—C2 | 112.0 (2) | C23—C21—C22 | 111.8 (2) |
| C3—C1—B4 | 122.7 (2) | C23—C21—B24 | 122.9 (2) |
| C2—C1—B4 | 109.45 (19) | C22—C21—B24 | 109.54 (19) |
| C3—C1—B5 | 131.2 (2) | C23—C21—B25 | 130.6 (2) |
| C2—C1—B5 | 109.4 (2) | C22—C21—B25 | 110.0 (2) |
| B4—C1—B5 | 62.71 (17) | B24—C21—B25 | 62.74 (19) |
| C3—C1—B6 | 120.4 (2) | C23—C21—B26 | 120.5 (2) |
| C2—C1—B6 | 60.57 (16) | C22—C21—B26 | 60.8 (2) |
| B4—C1—B6 | 113.9 (2) | B24—C21—B26 | 113.5 (2) |
| B5—C1—B6 | 62.28 (18) | B25—C21—B26 | 62.2 (2) |
| C3—C1—B3 | 109.2 (2) | C23—C21—B23 | 109.54 (19) |
| C2—C1—B3 | 60.35 (16) | C22—C21—B23 | 60.52 (17) |
| B4—C1—B3 | 61.97 (16) | B24—C21—B23 | 61.69 (17) |
| B5—C1—B3 | 113.2 (2) | B25—C21—B23 | 113.2 (2) |
| B6—C1—B3 | 112.8 (2) | B26—C21—B23 | 112.7 (2) |
| C1—C2—B9 | 112.2 (2) | C21—C22—B30 | 111.9 (2) |
| C1—C2—B8 | 112.4 (2) | C21—C22—B31 | 111.5 (3) |
| B9—C2—B8 | 63.06 (19) | B30—C22—B31 | 62.3 (2) |
| C1—C2—B6 | 61.84 (16) | C21—C22—B26 | 61.45 (18) |
| B9—C2—B6 | 62.90 (19) | B30—C22—B26 | 114.6 (3) |
| B8—C2—B6 | 115.5 (2) | B31—C22—B26 | 62.7 (2) |
| C1—C2—B3 | 62.24 (16) | C21—C22—B23 | 62.14 (16) |
| B9—C2—B3 | 114.8 (2) | B30—C22—B23 | 62.13 (19) |
| B8—C2—B3 | 62.41 (18) | B31—C22—B23 | 113.6 (2) |
| B6—C2—B3 | 115.4 (2) | B26—C22—B23 | 114.6 (2) |
| C1—C2—H2 | 120.0 | C21—C22—H22 | 120.3 |
| B9—C2—H2 | 118.2 | B30—C22—H22 | 118.5 |
| B8—C2—H2 | 118.0 | B31—C22—H22 | 118.9 |
| B6—C2—H2 | 117.0 | B26—C22—H22 | 117.5 |
| B3—C2—H2 | 117.3 | B23—C22—H22 | 117.8 |
| N1—C3—C1 | 120.2 (2) | N2—C23—C21 | 120.3 (2) |
| N1—C3—H3A | 107.3 | N2—C23—H23A | 107.3 |
| C1—C3—H3A | 107.3 | C21—C23—H23A | 107.3 |
| N1—C3—H3B | 107.3 | N2—C23—H23B | 107.3 |
| C1—C3—H3B | 107.3 | C21—C23—H23B | 107.3 |
| H3A—C3—H3B | 106.9 | H23A—C23—H23B | 106.9 |
| N1—C4—H4A | 109.5 | N2—C24—H24A | 109.5 |
| N1—C4—H4B | 109.5 | N2—C24—H24B | 109.5 |
| H4A—C4—H4B | 109.5 | H24A—C24—H24B | 109.5 |
| N1—C4—H4C | 109.5 | N2—C24—H24C | 109.5 |
| H4A—C4—H4C | 109.5 | H24A—C24—H24C | 109.5 |
| H4B—C4—H4C | 109.5 | H24B—C24—H24C | 109.5 |
| N1—C5—H5A | 109.5 | N2—C25—H25A | 109.5 |
| N1—C5—H5B | 109.5 | N2—C25—H25B | 109.5 |
| H5A—C5—H5B | 109.5 | H25A—C25—H25B | 109.5 |
| N1—C5—H5C | 109.5 | N2—C25—H25C | 109.5 |
| H5A—C5—H5C | 109.5 | H25A—C25—H25C | 109.5 |
| H5B—C5—H5C | 109.5 | H25B—C25—H25C | 109.5 |
| N1—C6—H6A | 109.5 | N2—C26—H26A | 109.5 |
| N1—C6—H6B | 109.5 | N2—C26—H26B | 109.5 |
| H6A—C6—H6B | 109.5 | H26A—C26—H26B | 109.5 |
| N1—C6—H6C | 109.5 | N2—C26—H26C | 109.5 |
| H6A—C6—H6C | 109.5 | H26A—C26—H26C | 109.5 |
| H6B—C6—H6C | 109.5 | H26B—C26—H26C | 109.5 |
Hydrogen-bond geometry (Å, °)
| D—H···A | D—H | H···A | D···A | D—H···A |
| C2—H2···I1 | 1.10 | 3.03 | 3.946 (3) | 141. |
| C3—H3B···I1 | 0.97 | 2.94 | 3.904 (3) | 172. |
| C23—H23B···I1 | 0.97 | 2.96 | 3.921 (3) | 170. |
Footnotes
Supplementary data and figures for this paper are available from the IUCr electronic archives (Reference: DN2706).
References
- Bruker (1999). SMART and SAINT-Plus Bruker AXS Inc., Madison, Wisconsin, USA.
- Carr, M. J., Franken, A., Macías, R. & Kennedy, J. D. (2006). Polyhedron, 25, 1069–1075.
- Davidson, M. G., Hibbert, T. G., Howard, J. A. K., Mackinnon, A. & Wade, K. (1996). Chem Commun pp. 2285–2286.
- Farrugia, L. J. (1997). J Appl Cryst 30, 565.
- Lee, J.-D., Baek, C. K., Ko, J., Park, K., Cho, S., Min, S. K. & Kang, S. O. (1999). Organometallics, 18, 2189–2197.
- Lee, J.-D., Kim, S.-J., Yoo, D., Ko, J., Cho, S. & Kang, S. O. (2000). Organometallics, 19, 1695–1703.
- Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. [DOI] [PubMed]
- Welch, A. J., Venkatasubramanian, U., Rosair, G. M., Ellis, D. & Donohoe, D. J. (2001). Acta Cryst. C57, 1295–1296. [DOI] [PubMed]
- Wiebcke, M. & Felsche, J. (2001). Acta Cryst. C57, 306–308. [DOI] [PubMed]
- Zhang, H.-X., Zheng, S.-T. & Yang, G.-Y. (2004). Acta Cryst. C60, o545–o546. [DOI] [PubMed]
Associated Data
This section collects any data citations, data availability statements, or supplementary materials included in this article.
Supplementary Materials
Crystal structure: contains datablock(s) global, I. DOI: 10.1107/S160053681102928X/dn2706sup1.cif
Structure factors: contains datablock(s) I. DOI: 10.1107/S160053681102928X/dn2706Isup2.hkl
Additional supplementary materials: crystallographic information; 3D view; checkCIF report

